The part of the brain that connects the CEREBRAL HEMISPHERES with the SPINAL CORD. It consists of the MESENCEPHALON; PONS; and MEDULLA OBLONGATA.
Relatively undifferentiated cells that retain the ability to divide and proliferate throughout postnatal life to provide progenitor cells that can differentiate into specialized cells.
Changes in the amounts of various chemicals (neurotransmitters, receptors, enzymes, and other metabolites) specific to the area of the central nervous system contained within the head. These are monitored over time, during sensory stimulation, or under different disease states.
Acute and chronic (see also BRAIN INJURIES, CHRONIC) injuries to the brain, including the cerebral hemispheres, CEREBELLUM, and BRAIN STEM. Clinical manifestations depend on the nature of injury. Diffuse trauma to the brain is frequently associated with DIFFUSE AXONAL INJURY or COMA, POST-TRAUMATIC. Localized injuries may be associated with NEUROBEHAVIORAL MANIFESTATIONS; HEMIPARESIS, or other focal neurologic deficits.
Neoplasms of the intracranial components of the central nervous system, including the cerebral hemispheres, basal ganglia, hypothalamus, thalamus, brain stem, and cerebellum. Brain neoplasms are subdivided into primary (originating from brain tissue) and secondary (i.e., metastatic) forms. Primary neoplasms are subdivided into benign and malignant forms. In general, brain tumors may also be classified by age of onset, histologic type, or presenting location in the brain.
Benign and malignant intra-axial tumors of the MESENCEPHALON; PONS; or MEDULLA OBLONGATA of the BRAIN STEM. Primary and metastatic neoplasms may occur in this location. Clinical features include ATAXIA, cranial neuropathies (see CRANIAL NERVE DISEASES), NAUSEA, hemiparesis (see HEMIPLEGIA), and quadriparesis. Primary brain stem neoplasms are more frequent in children. Histologic subtypes include GLIOMA; HEMANGIOBLASTOMA; GANGLIOGLIOMA; and EPENDYMOMA.
Electrical waves in the CEREBRAL CORTEX generated by BRAIN STEM structures in response to auditory click stimuli. These are found to be abnormal in many patients with CEREBELLOPONTINE ANGLE lesions, MULTIPLE SCLEROSIS, or other DEMYELINATING DISEASES.
Imaging techniques used to colocalize sites of brain functions or physiological activity with brain structures.
Infarctions that occur in the BRAIN STEM which is comprised of the MIDBRAIN; PONS; and MEDULLA OBLONGATA. There are several named syndromes characterized by their distinctive clinical manifestations and specific sites of ischemic injury.
The part of CENTRAL NERVOUS SYSTEM that is contained within the skull (CRANIUM). Arising from the NEURAL TUBE, the embryonic brain is comprised of three major parts including PROSENCEPHALON (the forebrain); MESENCEPHALON (the midbrain); and RHOMBENCEPHALON (the hindbrain). The developed brain consists of CEREBRUM; CEREBELLUM; and other structures in the BRAIN STEM.
Parts of plants that usually grow vertically upwards towards the light and support the leaves, buds, and reproductive structures. (From Concise Dictionary of Biology, 1990)
Progenitor cells from which all blood cells derive.
The transfer of STEM CELLS from one individual to another within the same species (TRANSPLANTATION, HOMOLOGOUS) or between species (XENOTRANSPLANTATION), or transfer within the same individual (TRANSPLANTATION, AUTOLOGOUS). The source and location of the stem cells determines their potency or pluripotency to differentiate into various cell types.
Cells with high proliferative and self renewal capacities derived from adults.
Highly proliferative, self-renewing, and colony-forming stem cells which give rise to NEOPLASMS.
Non-invasive method of demonstrating internal anatomy based on the principle that atomic nuclei in a strong magnetic field absorb pulses of radiofrequency energy and emit them as radiowaves which can be reconstructed into computerized images. The concept includes proton spin tomographic techniques.
The basic cellular units of nervous tissue. Each neuron consists of a body, an axon, and dendrites. Their purpose is to receive, conduct, and transmit impulses in the NERVOUS SYSTEM.
Increased intracellular or extracellular fluid in brain tissue. Cytotoxic brain edema (swelling due to increased intracellular fluid) is indicative of a disturbance in cell metabolism, and is commonly associated with hypoxic or ischemic injuries (see HYPOXIA, BRAIN). An increase in extracellular fluid may be caused by increased brain capillary permeability (vasogenic edema), an osmotic gradient, local blockages in interstitial fluid pathways, or by obstruction of CSF flow (e.g., obstructive HYDROCEPHALUS). (From Childs Nerv Syst 1992 Sep; 8(6):301-6)
Cells that can give rise to cells of the three different GERM LAYERS.
The front part of the hindbrain (RHOMBENCEPHALON) that lies between the MEDULLA and the midbrain (MESENCEPHALON) ventral to the cerebellum. It is composed of two parts, the dorsal and the ventral. The pons serves as a relay station for neural pathways between the CEREBELLUM to the CEREBRUM.
The lower portion of the BRAIN STEM. It is inferior to the PONS and anterior to the CEREBELLUM. Medulla oblongata serves as a relay station between the brain and the spinal cord, and contains centers for regulating respiratory, vasomotor, cardiac, and reflex activities.
Localized reduction of blood flow to brain tissue due to arterial obstruction or systemic hypoperfusion. This frequently occurs in conjunction with brain hypoxia (HYPOXIA, BRAIN). Prolonged ischemia is associated with BRAIN INFARCTION.
A particular zone of tissue composed of a specialized microenvironment where stem cells are retained in a undifferentiated, self-renewable state.
Self-renewing cells that generate the main phenotypes of the nervous system in both the embryo and adult. Neural stem cells are precursors to both NEURONS and NEUROGLIA.
A state of prolonged irreversible cessation of all brain activity, including lower brain stem function with the complete absence of voluntary movements, responses to stimuli, brain stem reflexes, and spontaneous respirations. Reversible conditions which mimic this clinical state (e.g., sedative overdose, hypothermia, etc.) are excluded prior to making the determination of brain death. (From Adams et al., Principles of Neurology, 6th ed, pp348-9)
Transfer of HEMATOPOIETIC STEM CELLS from BONE MARROW or BLOOD between individuals within the same species (TRANSPLANTATION, HOMOLOGOUS) or transfer within the same individual (TRANSPLANTATION, AUTOLOGOUS). Hematopoietic stem cell transplantation has been used as an alternative to BONE MARROW TRANSPLANTATION in the treatment of a variety of neoplasms.
Cells from adult organisms that have been reprogrammed into a pluripotential state similar to that of EMBRYONIC STEM CELLS.
GRAY MATTER located in the dorsomedial part of the MEDULLA OBLONGATA associated with the solitary tract. The solitary nucleus receives inputs from most organ systems including the terminations of the facial, glossopharyngeal, and vagus nerves. It is a major coordinator of AUTONOMIC NERVOUS SYSTEM regulation of cardiovascular, respiratory, gustatory, gastrointestinal, and chemoreceptive aspects of HOMEOSTASIS. The solitary nucleus is also notable for the large number of NEUROTRANSMITTERS which are found therein.
The thin layer of GRAY MATTER on the surface of the CEREBRAL HEMISPHERES that develops from the TELENCEPHALON and folds into gyri and sulchi. It reaches its highest development in humans and is responsible for intellectual faculties and higher mental functions.
Specialized stem cells that are committed to give rise to cells that have a particular function; examples are MYOBLASTS; MYELOID PROGENITOR CELLS; and skin stem cells. (Stem Cells: A Primer [Internet]. Bethesda (MD): National Institutes of Health (US); 2000 May [cited 2002 Apr 5]. Available from: http://www.nih.gov/news/stemcell/primer.htm)
The part of brain that lies behind the BRAIN STEM in the posterior base of skull (CRANIAL FOSSA, POSTERIOR). It is also known as the "little brain" with convolutions similar to those of CEREBRAL CORTEX, inner white matter, and deep cerebellar nuclei. Its function is to coordinate voluntary movements, maintain balance, and learn motor skills.
A circumscribed collection of purulent exudate in the brain, due to bacterial and other infections. The majority are caused by spread of infected material from a focus of suppuration elsewhere in the body, notably the PARANASAL SINUSES, middle ear (see EAR, MIDDLE); HEART (see also ENDOCARDITIS, BACTERIAL), and LUNG. Penetrating CRANIOCEREBRAL TRAUMA and NEUROSURGICAL PROCEDURES may also be associated with this condition. Clinical manifestations include HEADACHE; SEIZURES; focal neurologic deficits; and alterations of consciousness. (Adams et al., Principles of Neurology, 6th ed, pp712-6)
Transfer of MESENCHYMAL STEM CELLS between individuals within the same species (TRANSPLANTATION, HOMOLOGOUS) or transfer within the same individual (TRANSPLANTATION, AUTOLOGOUS).
Elements of limited time intervals, contributing to particular results or situations.
Part of the brain located in the MEDULLA OBLONGATA and PONS. It receives neural, chemical and hormonal signals, and controls the rate and depth of respiratory movements of the DIAPHRAGM and other respiratory muscles.
Refers to animals in the period of time just after birth.
A reduction in brain oxygen supply due to ANOXEMIA (a reduced amount of oxygen being carried in the blood by HEMOGLOBIN), or to a restriction of the blood supply to the brain, or both. Severe hypoxia is referred to as anoxia, and is a relatively common cause of injury to the central nervous system. Prolonged brain anoxia may lead to BRAIN DEATH or a PERSISTENT VEGETATIVE STATE. Histologically, this condition is characterized by neuronal loss which is most prominent in the HIPPOCAMPUS; GLOBUS PALLIDUS; CEREBELLUM; and inferior olives.
Neural tracts connecting one part of the nervous system with another.
The 12th cranial nerve. The hypoglossal nerve originates in the hypoglossal nucleus of the medulla and supplies motor innervation to all of the muscles of the tongue except the palatoglossus (which is supplied by the vagus). This nerve also contains proprioceptive afferents from the tongue muscles.
A hematopoietic growth factor and the ligand of the cell surface c-kit protein (PROTO-ONCOGENE PROTEINS C-KIT). It is expressed during embryogenesis and is a growth factor for a number of cell types including the MAST CELLS and the MELANOCYTES in addition to the HEMATOPOIETIC STEM CELLS.
A cylindrical column of tissue that lies within the vertebral canal. It is composed of WHITE MATTER and GRAY MATTER.
Cells propagated in vitro in special media conducive to their growth. Cultured cells are used to study developmental, morphologic, metabolic, physiologic, and genetic processes, among others.
Bone-marrow-derived, non-hematopoietic cells that support HEMATOPOETIC STEM CELLS. They have also been isolated from other organs and tissues such as UMBILICAL CORD BLOOD, umbilical vein subendothelium, and WHARTON JELLY. These cells are considered to be a source of multipotent stem cells because they include subpopulations of mesenchymal stem cells.
A region extending from the PONS & MEDULLA OBLONGATA through the MESENCEPHALON, characterized by a diversity of neurons of various sizes and shapes, arranged in different aggregations and enmeshed in a complicated fiber network.
Multi-channel hearing devices typically used for patients who have tumors on the COCHLEAR NERVE and are unable to benefit from COCHLEAR IMPLANTS after tumor surgery that severs the cochlear nerve. The device electrically stimulates the nerves of cochlea nucleus in the BRAIN STEM rather than the inner ear as in cochlear implants.
A condition characterized by long-standing brain dysfunction or damage, usually of three months duration or longer. Potential etiologies include BRAIN INFARCTION; certain NEURODEGENERATIVE DISORDERS; CRANIOCEREBRAL TRAUMA; ANOXIA, BRAIN; ENCEPHALITIS; certain NEUROTOXICITY SYNDROMES; metabolic disorders (see BRAIN DISEASES, METABOLIC); and other conditions.
Inbred C57BL mice are a strain of laboratory mice that have been produced by many generations of brother-sister matings, resulting in a high degree of genetic uniformity and homozygosity, making them widely used for biomedical research, including studies on genetics, immunology, cancer, and neuroscience.
Histochemical localization of immunoreactive substances using labeled antibodies as reagents.
'Nerve tissue proteins' are specialized proteins found within the nervous system's biological tissue, including neurofilaments, neuronal cytoskeletal proteins, and neural cell adhesion molecules, which facilitate structural support, intracellular communication, and synaptic connectivity essential for proper neurological function.
Nuclei of the trigeminal nerve situated in the brain stem. They include the nucleus of the spinal trigeminal tract (TRIGEMINAL NUCLEUS, SPINAL), the principal sensory nucleus, the mesencephalic nucleus, and the motor nucleus.
Specialized non-fenestrated tightly-joined ENDOTHELIAL CELLS with TIGHT JUNCTIONS that form a transport barrier for certain substances between the cerebral capillaries and the BRAIN tissue.
Naturally occurring or experimentally induced animal diseases with pathological processes sufficiently similar to those of human diseases. They are used as study models for human diseases.
Four CSF-filled (see CEREBROSPINAL FLUID) cavities within the cerebral hemispheres (LATERAL VENTRICLES), in the midline (THIRD VENTRICLE) and within the PONS and MEDULLA OBLONGATA (FOURTH VENTRICLE).
The domestic cat, Felis catus, of the carnivore family FELIDAE, comprising over 30 different breeds. The domestic cat is descended primarily from the wild cat of Africa and extreme southwestern Asia. Though probably present in towns in Palestine as long ago as 7000 years, actual domestication occurred in Egypt about 4000 years ago. (From Walker's Mammals of the World, 6th ed, p801)
Use of electric potential or currents to elicit biological responses.
The developmental history of specific differentiated cell types as traced back to the original STEM CELLS in the embryo.
Accumulation of a drug or chemical substance in various organs (including those not relevant to its pharmacologic or therapeutic action). This distribution depends on the blood flow or perfusion rate of the organ, the ability of the drug to penetrate organ membranes, tissue specificity, protein binding. The distribution is usually expressed as tissue to plasma ratios.
Cells derived from a FETUS that retain the ability to divide, proliferate and provide progenitor cells that can differentiate into specialized cells.
A strain of albino rat used widely for experimental purposes because of its calmness and ease of handling. It was developed by the Sprague-Dawley Animal Company.
A condition characterized by abnormal posturing of the limbs that is associated with injury to the brainstem. This may occur as a clinical manifestation or induced experimentally in animals. The extensor reflexes are exaggerated leading to rigid extension of the limbs accompanied by hyperreflexia and opisthotonus. This condition is usually caused by lesions which occur in the region of the brainstem that lies between the red nuclei and the vestibular nuclei. In contrast, decorticate rigidity is characterized by flexion of the elbows and wrists with extension of the legs and feet. The causative lesion for this condition is located above the red nuclei and usually consists of diffuse cerebral damage. (From Adams et al., Principles of Neurology, 6th ed, p358)
The 10th cranial nerve. The vagus is a mixed nerve which contains somatic afferents (from skin in back of the ear and the external auditory meatus), visceral afferents (from the pharynx, larynx, thorax, and abdomen), parasympathetic efferents (to the thorax and abdomen), and efferents to striated muscle (of the larynx and pharynx).
The circulation of blood through the BLOOD VESSELS of the BRAIN.
A technique of inputting two-dimensional images into a computer and then enhancing or analyzing the imagery into a form that is more useful to the human observer.
Experimentation on STEM CELLS and on the use of stem cells.
Ventral part of the DIENCEPHALON extending from the region of the OPTIC CHIASM to the caudal border of the MAMMILLARY BODIES and forming the inferior and lateral walls of the THIRD VENTRICLE.
A strain of albino rat developed at the Wistar Institute that has spread widely at other institutions. This has markedly diluted the original strain.
RNA sequences that serve as templates for protein synthesis. Bacterial mRNAs are generally primary transcripts in that they do not require post-transcriptional processing. Eukaryotic mRNA is synthesized in the nucleus and must be exported to the cytoplasm for translation. Most eukaryotic mRNAs have a sequence of polyadenylic acid at the 3' end, referred to as the poly(A) tail. The function of this tail is not known for certain, but it may play a role in the export of mature mRNA from the nucleus as well as in helping stabilize some mRNA molecules by retarding their degradation in the cytoplasm.
The artery formed by the union of the right and left vertebral arteries; it runs from the lower to the upper border of the pons, where it bifurcates into the two posterior cerebral arteries.
All of the processes involved in increasing CELL NUMBER including CELL DIVISION.
The dorsal portion or roof of the midbrain which is composed of two pairs of bumps, the INFERIOR COLLICULI and the SUPERIOR COLLICULI. These four colliculi are also called the quadrigeminal bodies (TECTUM MESENCEPHALI). They are centers for visual sensorimotor integration.
The middle of the three primitive cerebral vesicles of the embryonic brain. Without further subdivision, midbrain develops into a short, constricted portion connecting the PONS and the DIENCEPHALON. Midbrain contains two major parts, the dorsal TECTUM MESENCEPHALI and the ventral TEGMENTUM MESENCEPHALI, housing components of auditory, visual, and other sensorimoter systems.
Tissue NECROSIS in any area of the brain, including the CEREBRAL HEMISPHERES, the CEREBELLUM, and the BRAIN STEM. Brain infarction is the result of a cascade of events initiated by inadequate blood flow through the brain that is followed by HYPOXIA and HYPOGLYCEMIA in brain tissue. Damage may be temporary, permanent, selective or pan-necrosis.
Nerve structures through which impulses are conducted from a nerve center toward a peripheral site. Such impulses are conducted via efferent neurons (NEURONS, EFFERENT), such as MOTOR NEURONS, autonomic neurons, and hypophyseal neurons.
A curved elevation of GRAY MATTER extending the entire length of the floor of the TEMPORAL HORN of the LATERAL VENTRICLE (see also TEMPORAL LOBE). The hippocampus proper, subiculum, and DENTATE GYRUS constitute the hippocampal formation. Sometimes authors include the ENTORHINAL CORTEX in the hippocampal formation.
The main information-processing organs of the nervous system, consisting of the brain, spinal cord, and meninges.
Portion of midbrain situated under the dorsal TECTUM MESENCEPHALI. The two ventrolateral cylindrical masses or peduncles are large nerve fiber bundles providing a tract of passage between the FOREBRAIN with the HINDBRAIN. Ventral MIDBRAIN also contains three colorful structures: the GRAY MATTER (PERIAQUEDUCTAL GRAY), the black substance (SUBSTANTIA NIGRA), and the RED NUCLEUS.
Descriptions of specific amino acid, carbohydrate, or nucleotide sequences which have appeared in the published literature and/or are deposited in and maintained by databanks such as GENBANK, European Molecular Biology Laboratory (EMBL), National Biomedical Research Foundation (NBRF), or other sequence repositories.
Laboratory mice that have been produced from a genetically manipulated EGG or EMBRYO, MAMMALIAN.
The gradual irreversible changes in structure and function of an organism that occur as a result of the passage of time.
Bleeding into structures of BRAIN STEM, including the MIDBRAIN; PONS; or MEDULLA OBLONGATA, as the result of CRANIOCEREBRAL TRAUMA. DIFFUSE AXONAL INJURY is commonly associated. Clinical manifestations may include OCULAR MOTILITY DISORDERS; ATAXIA; PARALYSIS; PERSISTENT VEGETATIVE STATE; and COMA.
Nerve structures through which impulses are conducted from a peripheral part toward a nerve center.
Nucleus of the spinal tract of the trigeminal nerve. It is divided cytoarchitectonically into three parts: oralis, caudalis (TRIGEMINAL CAUDAL NUCLEUS), and interpolaris.
The time from the onset of a stimulus until a response is observed.
The intracellular transfer of information (biological activation/inhibition) through a signal pathway. In each signal transduction system, an activation/inhibition signal from a biologically active molecule (hormone, neurotransmitter) is mediated via the coupling of a receptor/enzyme to a second messenger system or to an ion channel. Signal transduction plays an important role in activating cellular functions, cell differentiation, and cell proliferation. Examples of signal transduction systems are the GAMMA-AMINOBUTYRIC ACID-postsynaptic receptor-calcium ion channel system, the receptor-mediated T-cell activation pathway, and the receptor-mediated activation of phospholipases. Those coupled to membrane depolarization or intracellular release of calcium include the receptor-mediated activation of cytotoxic functions in granulocytes and the synaptic potentiation of protein kinase activation. Some signal transduction pathways may be part of larger signal transduction pathways; for example, protein kinase activation is part of the platelet activation signal pathway.
Theoretical representations that simulate the behavior or activity of the neurological system, processes or phenomena; includes the use of mathematical equations, computers, and other electronic equipment.
The electric response evoked in the CEREBRAL CORTEX by ACOUSTIC STIMULATION or stimulation of the AUDITORY PATHWAYS.
A meshlike structure composed of interconnecting nerve cells that are separated at the synaptic junction or joined to one another by cytoplasmic processes. In invertebrates, for example, the nerve net allows nerve impulses to spread over a wide area of the net because synapses can pass information in any direction.
Paired bodies containing mostly GRAY MATTER and forming part of the lateral wall of the THIRD VENTRICLE of the brain.
The human being as a non-anatomical and non-zoological entity. The emphasis is on the philosophical or artistic treatment of the human being, and includes lay and social attitudes toward the body in history. (From J. Cassedy, NLM History of Medicine Division)
Behavioral manifestations of cerebral dominance in which there is preferential use and superior functioning of either the left or the right side, as in the preferred use of the right hand or right foot.
Progressive restriction of the developmental potential and increasing specialization of function that leads to the formation of specialized cells, tissues, and organs.
A class of large neuroglial (macroglial) cells in the central nervous system - the largest and most numerous neuroglial cells in the brain and spinal cord. Astrocytes (from "star" cells) are irregularly shaped with many long processes, including those with "end feet" which form the glial (limiting) membrane and directly and indirectly contribute to the BLOOD-BRAIN BARRIER. They regulate the extracellular ionic and chemical environment, and "reactive astrocytes" (along with MICROGLIA) respond to injury.
Therapy for MOVEMENT DISORDERS, especially PARKINSON DISEASE, that applies electricity via stereotactic implantation of ELECTRODES in specific areas of the BRAIN such as the THALAMUS. The electrodes are attached to a neurostimulator placed subcutaneously.
A biochemical messenger and regulator, synthesized from the essential amino acid L-TRYPTOPHAN. In humans it is found primarily in the central nervous system, gastrointestinal tract, and blood platelets. Serotonin mediates several important physiological functions including neurotransmission, gastrointestinal motility, hemostasis, and cardiovascular integrity. Multiple receptor families (RECEPTORS, SEROTONIN) explain the broad physiological actions and distribution of this biochemical mediator.
Benign and malignant central nervous system neoplasms derived from glial cells (i.e., astrocytes, oligodendrocytes, and ependymocytes). Astrocytes may give rise to astrocytomas (ASTROCYTOMA) or glioblastoma multiforme (see GLIOBLASTOMA). Oligodendrocytes give rise to oligodendrogliomas (OLIGODENDROGLIOMA) and ependymocytes may undergo transformation to become EPENDYMOMA; CHOROID PLEXUS NEOPLASMS; or colloid cysts of the third ventricle. (From Escourolle et al., Manual of Basic Neuropathology, 2nd ed, p21)
Genetically identical individuals developed from brother and sister matings which have been carried out for twenty or more generations or by parent x offspring matings carried out with certain restrictions. This also includes animals with a long history of closed colony breeding.
One of three principal openings in the SUBARACHNOID SPACE. They are also known as cerebellomedullary cistern, and collectively as cisterns.
Characteristic restricted to a particular organ of the body, such as a cell type, metabolic response or expression of a particular protein or antigen.
Decrease in the size of a cell, tissue, organ, or multiple organs, associated with a variety of pathological conditions such as abnormal cellular changes, ischemia, malnutrition, or hormonal changes.
The release of stem cells from the bone marrow into the peripheral blood circulation for the purpose of leukapheresis, prior to stem cell transplantation. Hematopoietic growth factors or chemotherapeutic agents often are used to stimulate the mobilization.
Inflammation of the BRAIN due to infection, autoimmune processes, toxins, and other conditions. Viral infections (see ENCEPHALITIS, VIRAL) are a relatively frequent cause of this condition.
The 6th cranial nerve which originates in the ABDUCENS NUCLEUS of the PONS and sends motor fibers to the lateral rectus muscles of the EYE. Damage to the nerve or its nucleus disrupts horizontal eye movement control.
Diseases that affect the structure or function of the cerebellum. Cardinal manifestations of cerebellar dysfunction include dysmetria, GAIT ATAXIA, and MUSCLE HYPOTONIA.
NEURAL PATHWAYS and connections within the CENTRAL NERVOUS SYSTEM, beginning at the hair cells of the ORGAN OF CORTI, continuing along the eighth cranial nerve, and terminating at the AUDITORY CORTEX.
Recording of electric currents developed in the brain by means of electrodes applied to the scalp, to the surface of the brain, or placed within the substance of the brain.
The relationship between the dose of an administered drug and the response of the organism to the drug.
The 5th and largest cranial nerve. The trigeminal nerve is a mixed motor and sensory nerve. The larger sensory part forms the ophthalmic, mandibular, and maxillary nerves which carry afferents sensitive to external or internal stimuli from the skin, muscles, and joints of the face and mouth and from the teeth. Most of these fibers originate from cells of the TRIGEMINAL GANGLION and project to the TRIGEMINAL NUCLEUS of the brain stem. The smaller motor part arises from the brain stem trigeminal motor nucleus and innervates the muscles of mastication.
Strains of mice in which certain GENES of their GENOMES have been disrupted, or "knocked-out". To produce knockouts, using RECOMBINANT DNA technology, the normal DNA sequence of the gene being studied is altered to prevent synthesis of a normal gene product. Cloned cells in which this DNA alteration is successful are then injected into mouse EMBRYOS to produce chimeric mice. The chimeric mice are then bred to yield a strain in which all the cells of the mouse contain the disrupted gene. Knockout mice are used as EXPERIMENTAL ANIMAL MODELS for diseases (DISEASE MODELS, ANIMAL) and to clarify the functions of the genes.
The communication from a NEURON to a target (neuron, muscle, or secretory cell) across a SYNAPSE. In chemical synaptic transmission, the presynaptic neuron releases a NEUROTRANSMITTER that diffuses across the synaptic cleft and binds to specific synaptic receptors, activating them. The activated receptors modulate specific ion channels and/or second-messenger systems in the postsynaptic cell. In electrical synaptic transmission, electrical signals are communicated as an ionic current flow across ELECTRICAL SYNAPSES.
The observable response an animal makes to any situation.
Any of the processes by which nuclear, cytoplasmic, or intercellular factors influence the differential control (induction or repression) of gene action at the level of transcription or translation.
Neurons which activate MUSCLE CELLS.
The study of the generation and behavior of electrical charges in living organisms particularly the nervous system and the effects of electricity on living organisms.
A statistical technique that isolates and assesses the contributions of categorical independent variables to variation in the mean of a continuous dependent variable.
The phenotypic manifestation of a gene or genes by the processes of GENETIC TRANSCRIPTION and GENETIC TRANSLATION.
Twelve pairs of nerves that carry general afferent, visceral afferent, special afferent, somatic efferent, and autonomic efferent fibers.
Pathologic conditions affecting the BRAIN, which is composed of the intracranial components of the CENTRAL NERVOUS SYSTEM. This includes (but is not limited to) the CEREBRAL CORTEX; intracranial white matter; BASAL GANGLIA; THALAMUS; HYPOTHALAMUS; BRAIN STEM; and CEREBELLUM.
The sequence of PURINES and PYRIMIDINES in nucleic acids and polynucleotides. It is also called nucleotide sequence.
Any of the processes by which nuclear, cytoplasmic, or intercellular factors influence the differential control of gene action during the developmental stages of an organism.
The injection of very small amounts of fluid, often with the aid of a microscope and microsyringes.
Abrupt changes in the membrane potential that sweep along the CELL MEMBRANE of excitable cells in response to excitation stimuli.
An acute or subacute inflammatory process of the CENTRAL NERVOUS SYSTEM characterized histologically by multiple foci of perivascular demyelination. Symptom onset usually occurs several days after an acute viral infection or immunization, but it may coincide with the onset of infection or rarely no antecedent event can be identified. Clinical manifestations include CONFUSION, somnolence, FEVER, nuchal rigidity, and involuntary movements. The illness may progress to COMA and eventually be fatal. (Adams et al., Principles of Neurology, 6th ed, p921)
Common name for the only family (Petromyzontidae) of eellike fish in the order Petromyzontiformes. They are jawless but have a sucking mouth with horny teeth.
The non-neuronal cells of the nervous system. They not only provide physical support, but also respond to injury, regulate the ionic and chemical composition of the extracellular milieu, participate in the BLOOD-BRAIN BARRIER and BLOOD-RETINAL BARRIER, form the myelin insulation of nervous pathways, guide neuronal migration during development, and exchange metabolites with neurons. Neuroglia have high-affinity transmitter uptake systems, voltage-dependent and transmitter-gated ion channels, and can release transmitters, but their role in signaling (as in many other functions) is unclear.
Theoretical representations that simulate the behavior or activity of biological processes or diseases. For disease models in living animals, DISEASE MODELS, ANIMAL is available. Biological models include the use of mathematical equations, computers, and other electronic equipment.
A form of electrophysiologic audiometry in which an analog computer is included in the circuit to average out ongoing or spontaneous brain wave activity. A characteristic pattern of response to a sound stimulus may then become evident. Evoked response audiometry is known also as electric response audiometry.
A part of the MEDULLA OBLONGATA situated in the olivary body. It is involved with motor control and is a major source of sensory input to the CEREBELLUM.
The formation of an area of NECROSIS in the CEREBRUM caused by an insufficiency of arterial or venous blood flow. Infarcts of the cerebrum are generally classified by hemisphere (i.e., left vs. right), lobe (e.g., frontal lobe infarction), arterial distribution (e.g., INFARCTION, ANTERIOR CEREBRAL ARTERY), and etiology (e.g., embolic infarction).
Techniques used mostly during brain surgery which use a system of three-dimensional coordinates to locate the site to be operated on.
Tomography using x-ray transmission and a computer algorithm to reconstruct the image.
Cells contained in the bone marrow including fat cells (see ADIPOCYTES); STROMAL CELLS; MEGAKARYOCYTES; and the immediate precursors of most blood cells.
An element with atomic symbol O, atomic number 8, and atomic weight [15.99903; 15.99977]. It is the most abundant element on earth and essential for respiration.
Assessment of sensory and motor responses and reflexes that is used to determine impairment of the nervous system.
The act of breathing with the LUNGS, consisting of INHALATION, or the taking into the lungs of the ambient air, and of EXHALATION, or the expelling of the modified air which contains more CARBON DIOXIDE than the air taken in (Blakiston's Gould Medical Dictionary, 4th ed.). This does not include tissue respiration (= OXYGEN CONSUMPTION) or cell respiration (= CELL RESPIRATION).
The entity of a developing mammal (MAMMALS), generally from the cleavage of a ZYGOTE to the end of embryonic differentiation of basic structures. For the human embryo, this represents the first two months of intrauterine development preceding the stages of the FETUS.
A profound state of unconsciousness associated with depressed cerebral activity from which the individual cannot be aroused. Coma generally occurs when there is dysfunction or injury involving both cerebral hemispheres or the brain stem RETICULAR FORMATION.
Formation of NEURONS which involves the differentiation and division of STEM CELLS in which one or both of the daughter cells become neurons.
A diagnostic technique that incorporates the measurement of molecular diffusion (such as water or metabolites) for tissue assessment by MRI. The degree of molecular movement can be measured by changes of apparent diffusion coefficient (ADC) with time, as reflected by tissue microstructure. Diffusion MRI has been used to study BRAIN ISCHEMIA and tumor response to treatment.
The physiological renewal, repair, or replacement of tissue.
The unborn young of a viviparous mammal, in the postembryonic period, after the major structures have been outlined. In humans, the unborn young from the end of the eighth week after CONCEPTION until BIRTH, as distinguished from the earlier EMBRYO, MAMMALIAN.
The physical or mechanical action of the LUNGS; DIAPHRAGM; RIBS; and CHEST WALL during respiration. It includes airflow, lung volume, neural and reflex controls, mechanoreceptors, breathing patterns, etc.
Surgical insertion of an electronic hearing device (AUDITORY BRAIN STEM IMPLANTS) with electrodes to the cochlea nucleus in the BRAIN STEM rather than to the inner ear as in COCHLEAR IMPLANTATION.
The space between the arachnoid membrane and PIA MATER, filled with CEREBROSPINAL FLUID. It contains large blood vessels that supply the BRAIN and SPINAL CORD.
The outward appearance of the individual. It is the product of interactions between genes, and between the GENOTYPE and the environment.
A degenerative disease of the BRAIN characterized by the insidious onset of DEMENTIA. Impairment of MEMORY, judgment, attention span, and problem solving skills are followed by severe APRAXIAS and a global loss of cognitive abilities. The condition primarily occurs after age 60, and is marked pathologically by severe cortical atrophy and the triad of SENILE PLAQUES; NEUROFIBRILLARY TANGLES; and NEUROPIL THREADS. (From Adams et al., Principles of Neurology, 6th ed, pp1049-57)
Localized or diffuse reduction in blood flow through the vertebrobasilar arterial system, which supplies the BRAIN STEM; CEREBELLUM; OCCIPITAL LOBE; medial TEMPORAL LOBE; and THALAMUS. Characteristic clinical features include SYNCOPE; lightheadedness; visual disturbances; and VERTIGO. BRAIN STEM INFARCTIONS or other BRAIN INFARCTION may be associated.
Collections of small neurons centrally scattered among many fibers from the level of the TROCHLEAR NUCLEUS in the midbrain to the hypoglossal area in the MEDULLA OBLONGATA.
Established cell cultures that have the potential to propagate indefinitely.
The order of amino acids as they occur in a polypeptide chain. This is referred to as the primary structure of proteins. It is of fundamental importance in determining PROTEIN CONFORMATION.
Identification of proteins or peptides that have been electrophoretically separated by blot transferring from the electrophoresis gel to strips of nitrocellulose paper, followed by labeling with antibody probes.
Wave-like oscillations of electric potential between parts of the brain recorded by EEG.
The three membranes that cover the BRAIN and the SPINAL CORD. They are the dura mater, the arachnoid, and the pia mater.
The anterior subdivision of the embryonic PROSENCEPHALON or the corresponding part of the adult prosencephalon that includes the cerebrum and associated structures.
An octamer transcription factor that is expressed primarily in totipotent embryonic STEM CELLS and GERM CELLS and is down-regulated during CELL DIFFERENTIATION.
The making of a radiograph of an object or tissue by recording on a photographic plate the radiation emitted by radioactive material within the object. (Dorland, 27th ed)
Specialized junctions at which a neuron communicates with a target cell. At classical synapses, a neuron's presynaptic terminal releases a chemical transmitter stored in synaptic vesicles which diffuses across a narrow synaptic cleft and activates receptors on the postsynaptic membrane of the target cell. The target may be a dendrite, cell body, or axon of another neuron, or a specialized region of a muscle or secretory cell. Neurons may also communicate via direct electrical coupling with ELECTRICAL SYNAPSES. Several other non-synaptic chemical or electric signal transmitting processes occur via extracellular mediated interactions.
Cells specialized to detect chemical substances and relay that information centrally in the nervous system. Chemoreceptor cells may monitor external stimuli, as in TASTE and OLFACTION, or internal stimuli, such as the concentrations of OXYGEN and CARBON DIOXIDE in the blood.
The electric response evoked in the CEREBRAL CORTEX by stimulation along AFFERENT PATHWAYS from PERIPHERAL NERVES to CEREBRUM.
An alkaloid found in the seeds of STRYCHNOS NUX-VOMICA. It is a competitive antagonist at glycine receptors and thus a convulsant. It has been used as an analeptic, in the treatment of nonketotic hyperglycinemia and sleep apnea, and as a rat poison.
The most common inhibitory neurotransmitter in the central nervous system.
A technique that localizes specific nucleic acid sequences within intact chromosomes, eukaryotic cells, or bacterial cells through the use of specific nucleic acid-labeled probes.
The anterior of the three primitive cerebral vesicles of the embryonic brain arising from the NEURAL TUBE. It subdivides to form DIENCEPHALON and TELENCEPHALON. (Stedmans Medical Dictionary, 27th ed)
The part of the cerebral hemisphere anterior to the central sulcus, and anterior and superior to the lateral sulcus.
The infratentorial compartment that contains the CEREBELLUM and BRAIN STEM. It is formed by the posterior third of the superior surface of the body of the sphenoid (SPHENOID BONE), by the occipital, the petrous, and mastoid portions of the TEMPORAL BONE, and the posterior inferior angle of the PARIETAL BONE.
Bleeding into one or both CEREBRAL HEMISPHERES including the BASAL GANGLIA and the CEREBRAL CORTEX. It is often associated with HYPERTENSION and CRANIOCEREBRAL TRAUMA.
The cochlear part of the 8th cranial nerve (VESTIBULOCOCHLEAR NERVE). The cochlear nerve fibers originate from neurons of the SPIRAL GANGLION and project peripherally to cochlear hair cells and centrally to the cochlear nuclei (COCHLEAR NUCLEUS) of the BRAIN STEM. They mediate the sense of hearing.
The four cellular masses in the floor of the fourth ventricle giving rise to a widely dispersed special sensory system. Included is the superior, medial, inferior, and LATERAL VESTIBULAR NUCLEUS. (From Dorland, 27th ed)
An intermediate filament protein found only in glial cells or cells of glial origin. MW 51,000.
The capacity of the NERVOUS SYSTEM to change its reactivity as the result of successive activations.
Neoplasms of the brain and spinal cord derived from glial cells which vary from histologically benign forms to highly anaplastic and malignant tumors. Fibrillary astrocytomas are the most common type and may be classified in order of increasing malignancy (grades I through IV). In the first two decades of life, astrocytomas tend to originate in the cerebellar hemispheres; in adults, they most frequently arise in the cerebrum and frequently undergo malignant transformation. (From Devita et al., Cancer: Principles and Practice of Oncology, 5th ed, pp2013-7; Holland et al., Cancer Medicine, 3d ed, p1082)
The 8th cranial nerve. The vestibulocochlear nerve has a cochlear part (COCHLEAR NERVE) which is concerned with hearing and a vestibular part (VESTIBULAR NERVE) which mediates the sense of balance and head position. The fibers of the cochlear nerve originate from neurons of the SPIRAL GANGLION and project to the cochlear nuclei (COCHLEAR NUCLEUS). The fibers of the vestibular nerve arise from neurons of Scarpa's ganglion and project to the VESTIBULAR NUCLEI.
Cell separation is the process of isolating and distinguishing specific cell types or individual cells from a heterogeneous mixture, often through the use of physical or biological techniques.
A non-essential amino acid naturally occurring in the L-form. Glutamic acid is the most common excitatory neurotransmitter in the CENTRAL NERVOUS SYSTEM.
An involuntary movement or exercise of function in a part, excited in response to a stimulus applied to the periphery and transmitted to the brain or spinal cord.
A transient absence of spontaneous respiration.
Technique using an instrument system for making, processing, and displaying one or more measurements on individual cells obtained from a cell suspension. Cells are usually stained with one or more fluorescent dyes specific to cell components of interest, e.g., DNA, and fluorescence of each cell is measured as it rapidly transverses the excitation beam (laser or mercury arc lamp). Fluorescence provides a quantitative measure of various biochemical and biophysical properties of the cell, as well as a basis for cell sorting. Other measurable optical parameters include light absorption and light scattering, the latter being applicable to the measurement of cell size, shape, density, granularity, and stain uptake.
The determination of the pattern of genes expressed at the level of GENETIC TRANSCRIPTION, under specific circumstances or in a specific cell.
The brain stem nucleus that receives the central input from the cochlear nerve. The cochlear nucleus is located lateral and dorsolateral to the inferior cerebellar peduncles and is functionally divided into dorsal and ventral parts. It is tonotopically organized, performs the first stage of central auditory processing, and projects (directly or indirectly) to higher auditory areas including the superior olivary nuclei, the medial geniculi, the inferior colliculi, and the auditory cortex.
Any operation on the cranium or incision into the cranium. (Dorland, 28th ed)
Relatively complete absence of oxygen in one or more tissues.
The status during which female mammals carry their developing young (EMBRYOS or FETUSES) in utero before birth, beginning from FERTILIZATION to BIRTH.
Single cells that have the potential to form an entire organism. They have the capacity to specialize into extraembryonic membranes and tissues, the embryo, and all postembryonic tissues and organs. (Stem Cells: A Primer [Internet]. Bethesda (MD): National Institutes of Health (US); 2000 May [cited 2002 Apr 5]. Available from: http://www.nih.gov/news/stemcell/primer.htm)
Rhodanine is an organic compound with the formula S(=O)(-CH=C(SH)N(-C2H4S)) that is used as a reagent in the determination of sulfide and in the synthesis of certain types of chelating agents, but it does not have any inherent medical use or application itself.
The statistical reproducibility of measurements (often in a clinical context), including the testing of instrumentation or techniques to obtain reproducible results. The concept includes reproducibility of physiological measurements, which may be used to develop rules to assess probability or prognosis, or response to a stimulus; reproducibility of occurrence of a condition; and reproducibility of experimental results.
The number of CELLS of a specific kind, usually measured per unit volume or area of sample.
One of the catecholamine NEUROTRANSMITTERS in the brain. It is derived from TYROSINE and is the precursor to NOREPINEPHRINE and EPINEPHRINE. Dopamine is a major transmitter in the extrapyramidal system of the brain, and important in regulating movement. A family of receptors (RECEPTORS, DOPAMINE) mediate its action.
The decrease in neuronal activity (related to a decrease in metabolic demand) extending from the site of cortical stimulation. It is believed to be responsible for the decrease in cerebral blood flow that accompanies the aura of MIGRAINE WITH AURA. (Campbell's Psychiatric Dictionary, 8th ed.)
Measurable and quantifiable biological parameters (e.g., specific enzyme concentration, specific hormone concentration, specific gene phenotype distribution in a population, presence of biological substances) which serve as indices for health- and physiology-related assessments, such as disease risk, psychiatric disorders, environmental exposure and its effects, disease diagnosis, metabolic processes, substance abuse, pregnancy, cell line development, epidemiologic studies, etc.
Depolarization of membrane potentials at the SYNAPTIC MEMBRANES of target neurons during neurotransmission. Excitatory postsynaptic potentials can singly or in summation reach the trigger threshold for ACTION POTENTIALS.
An irregularly shaped cavity in the RHOMBENCEPHALON, located between the MEDULLA OBLONGATA; the PONS; and the isthmus in front, and the CEREBELLUM behind. It is continuous with the central canal of the cord below and with the CEREBRAL AQUEDUCT above, and through its lateral and median apertures it communicates with the SUBARACHNOID SPACE.
Any of various diseases affecting the white matter of the central nervous system.
Any operation on the spinal cord. (Stedman, 26th ed)
Precursor of epinephrine that is secreted by the adrenal medulla and is a widespread central and autonomic neurotransmitter. Norepinephrine is the principal transmitter of most postganglionic sympathetic fibers and of the diffuse projection system in the brain arising from the locus ceruleus. It is also found in plants and is used pharmacologically as a sympathomimetic.
The development and formation of various types of BLOOD CELLS. Hematopoiesis can take place in the BONE MARROW (medullary) or outside the bone marrow (HEMATOPOIESIS, EXTRAMEDULLARY).
The process of generating three-dimensional images by electronic, photographic, or other methods. For example, three-dimensional images can be generated by assembling multiple tomographic images with the aid of a computer, while photographic 3-D images (HOLOGRAPHY) can be made by exposing film to the interference pattern created when two laser light sources shine on an object.
A field of medicine concerned with developing and using strategies aimed at repair or replacement of damaged, diseased, or metabolically deficient organs, tissues, and cells via TISSUE ENGINEERING; CELL TRANSPLANTATION; and ARTIFICIAL ORGANS and BIOARTIFICIAL ORGANS and tissues.
Evaluation undertaken to assess the results or consequences of management and procedures used in combating disease in order to determine the efficacy, effectiveness, safety, and practicability of these interventions in individual cases or series.
A type VI intermediate filament protein expressed mostly in nerve cells where it is associated with the survival, renewal and mitogen-stimulated proliferation of neural progenitor cells.
PRESSURE of the BLOOD on the ARTERIES and other BLOOD VESSELS.
Cellular DNA-binding proteins encoded by the c-fos genes (GENES, FOS). They are involved in growth-related transcriptional control. c-fos combines with c-jun (PROTO-ONCOGENE PROTEINS C-JUN) to form a c-fos/c-jun heterodimer (TRANSCRIPTION FACTOR AP-1) that binds to the TRE (TPA-responsive element) in promoters of certain genes.
Diseases of the central and peripheral nervous system. This includes disorders of the brain, spinal cord, cranial nerves, peripheral nerves, nerve roots, autonomic nervous system, neuromuscular junction, and muscle.
Conditions characterized by persistent brain damage or dysfunction as sequelae of cranial trauma. This disorder may result from DIFFUSE AXONAL INJURY; INTRACRANIAL HEMORRHAGES; BRAIN EDEMA; and other conditions. Clinical features may include DEMENTIA; focal neurologic deficits; PERSISTENT VEGETATIVE STATE; AKINETIC MUTISM; or COMA.

FGF8 induces formation of an ectopic isthmic organizer and isthmocerebellar development via a repressive effect on Otx2 expression. (1/3138)

Beads containing recombinant FGF8 (FGF8-beads) were implanted in the prospective caudal diencephalon or midbrain of chick embryos at stages 9-12. This induced the neuroepithelium rostral and caudal to the FGF8-bead to form two ectopic, mirror-image midbrains. Furthermore, cells in direct contact with the bead formed an outgrowth that protruded laterally from the neural tube. Tissue within such lateral outgrowths developed proximally into isthmic nuclei and distally into a cerebellum-like structure. These morphogenetic effects were apparently due to FGF8-mediated changes in gene expression in the vicinity of the bead, including a repressive effect on Otx2 and an inductive effect on En1, Fgf8 and Wnt1 expression. The ectopic Fgf8 and Wnt1 expression domains formed nearly complete concentric rings around the FGF8-bead, with the Wnt1 ring outermost. These observations suggest that FGF8 induces the formation of a ring-like ectopic signaling center (organizer) in the lateral wall of the brain, similar to the one that normally encircles the neural tube at the isthmic constriction, which is located at the boundary between the prospective midbrain and hindbrain. This ectopic isthmic organizer apparently sends long-range patterning signals both rostrally and caudally, resulting in the development of the two ectopic midbrains. Interestingly, our data suggest that these inductive signals spread readily in a caudal direction, but are inhibited from spreading rostrally across diencephalic neuromere boundaries. These results provide insights into the mechanism by which FGF8 induces an ectopic organizer and suggest that a negative feedback loop between Fgf8 and Otx2 plays a key role in patterning the midbrain and anterior hindbrain.  (+info)

Characterization of an amphioxus paired box gene, AmphiPax2/5/8: developmental expression patterns in optic support cells, nephridium, thyroid-like structures and pharyngeal gill slits, but not in the midbrain-hindbrain boundary region. (2/3138)

On the basis of developmental gene expression, the vertebrate central nervous system comprises: a forebrain plus anterior midbrain, a midbrain-hindbrain boundary region (MHB) having organizer properties, and a rhombospinal domain. The vertebrate MHB is characterized by position, by organizer properties and by being the early site of action of Wnt1 and engrailed genes, and of genes of the Pax2/5/8 subfamily. Wada and others (Wada, H., Saiga, H., Satoh, N. and Holland, P. W. H. (1998) Development 125, 1113-1122) suggested that ascidian tunicates have a vertebrate-like MHB on the basis of ascidian Pax258 expression there. In another invertebrate chordate, amphioxus, comparable gene expression evidence for a vertebrate-like MHB is lacking. We, therefore, isolated and characterized AmphiPax2/5/8, the sole member of this subfamily in amphioxus. AmphiPax2/5/8 is initially expressed well back in the rhombospinal domain and not where a MHB would be expected. In contrast, most of the other expression domains of AmphiPax2/5/8 correspond to expression domains of vertebrate Pax2, Pax5 and Pax8 in structures that are probably homologous - support cells of the eye, nephridium, thyroid-like structures and pharyngeal gill slits; although AmphiPax2/5/8 is not transcribed in any structures that could be interpreted as homologues of vertebrate otic placodes or otic vesicles. In sum, the developmental expression of AmphiPax2/5/8 indicates that the amphioxus central nervous system lacks a MHB resembling the vertebrate isthmic region. Additional gene expression data for the developing ascidian and amphioxus nervous systems would help determine whether a MHB is a basal chordate character secondarily lost in amphioxus. The alternative is that the MHB is a vertebrate innovation.  (+info)

Angiotensin II type 1 receptor-mediated inhibition of K+ channel subunit kv2.2 in brain stem and hypothalamic neurons. (3/3138)

Angiotensin II (Ang II) has powerful modulatory actions on cardiovascular function that are mediated by specific receptors located on neurons within the hypothalamus and brain stem. Incubation of neuronal cocultures of rat hypothalamus and brain stem with Ang II elicits an Ang II type 1 (AT1) receptor-mediated inhibition of total outward K+ current that contributes to an increase in neuronal firing rate. However, the exact K+ conductance(s) that is inhibited by Ang II are not established. Pharmacological manipulation of total neuronal outward K+ current revealed a component of K+ current sensitive to quinine, tetraethylammonium, and 4-aminopyridine, with IC50 values of 21.7 micromol/L, 1.49 mmol/L, and 890 micromol/L, respectively, and insensitive to alpha-dendrotoxin (100 to 500 nmol/L), charybdotoxin (100 to 500 nmol/L), and mast cell degranulating peptide (1 micromol/L). Collectively, these data suggest the presence of Kv2.2 and Kv3.1b. Biophysical examination of the quinine-sensitive neuronal K+ current demonstrated a macroscopic conductance with similar biophysical properties to those of Kv2.2 and Kv3.1b. Ang II (100 nmol/L), in the presence of the AT2 receptor blocker PD123,319, elicited an inhibition of neuronal K+ current that was abolished by quinine (50 micromol/L). Reverse transcriptase-polymerase chain reaction analysis confirmed the presence of Kv2.2 and Kv3.1b mRNA in these neurons. However, Western blot analyses demonstrated that only Kv2.2 protein was present. Coexpression of Kv2.2 and the AT1 receptor in Xenopus oocytes demonstrated an Ang II-induced inhibition of Kv2.2 current. Therefore, these data suggest that inhibition of Kv2.2 contributes to the AT1 receptor-mediated reduction of neuronal K+ current and subsequently to the modulation of cardiovascular function.  (+info)

The superior olivary nucleus and its influence on nucleus laminaris: a source of inhibitory feedback for coincidence detection in the avian auditory brainstem. (4/3138)

Located in the ventrolateral region of the avian brainstem, the superior olivary nucleus (SON) receives inputs from nucleus angularis (NA) and nucleus laminaris (NL) and projects back to NA, NL, and nucleus magnocellularis (NM). The reciprocal connections between the SON and NL are of particular interest because they constitute a feedback circuit for coincidence detection. In the present study, the chick SON was investigated. In vivo tracing studies show that the SON projects predominantly to the ipsilateral NM, NL, and NA. In vitro whole-cell recording reveals single-cell morphology, firing properties, and postsynaptic responses. SON neurons are morphologically and physiologically suited for temporal integration; their firing patterns do not reflect the temporal structure of their excitatory inputs. Of most interest, direct stimulation of the SON evokes long-lasting inhibition in NL neurons. The inhibition blocks both intrinsic spike generation and orthodromically evoked activity in NL neurons and can be eliminated by bicuculline methiodide, a potent antagonist for GABAA receptor-mediated neurotransmission. These results strongly suggest that the SON provides GABAergic inhibitory feedback to laminaris neurons. We discuss a mechanism whereby SON-evoked GABAergic inhibition can influence the coding of interaural time differences for sound localization in the avian auditory brainstem.  (+info)

Concurrent inhibition and excitation of phrenic motoneurons during inspiration: phase-specific control of excitability. (5/3138)

The movements that define behavior are controlled by motoneuron output, which depends on the excitability of motoneurons and the synaptic inputs they receive. Modulation of motoneuron excitability takes place over many time scales. To determine whether motoneuron excitability is specifically modulated during the active versus the quiescent phase of rhythmic behavior, we compared the input-output properties of phrenic motoneurons (PMNs) during inspiratory and expiratory phases of respiration. In neonatal rat brainstem-spinal cord preparations that generate rhythmic respiratory motor outflow, we blocked excitatory inspiratory synaptic drive to PMNs and then examined their phase-dependent responses to superthreshold current pulses. Pulses during inspiration elicited fewer action potentials compared with identical pulses during expiration. This reduced excitability arose from an inspiratory-phase inhibitory input that hyperpolarized PMNs in the absence of excitatory inspiratory inputs. Local application of bicuculline blocked this inhibition as well as the difference between inspiratory and expiratory firing. Correspondingly, bicuculline locally applied to the midcervical spinal cord enhanced fourth cervical nerve (C4) inspiratory burst amplitude. Strychnine had no effect on C4 output. Nicotinic receptor antagonists neither potentiated C4 output nor blocked its potentiation by bicuculline, further indicating that the inhibition is not from recurrent inhibitory pathways. We conclude that it is bulbospinal in origin. These data demonstrate that rapid changes in motoneuron excitability occur during behavior and suggest that integration of overlapping, opposing synaptic inputs to motoneurons is important in controlling motor outflow. Modulation of phasic inhibition may represent a means for regulating the transfer function of PMNs to suit behavioral demands.  (+info)

A clinical study of motor evoked potentials using a triple stimulation technique. (6/3138)

Amplitudes of motor evoked potentials (MEPs) are usually much smaller than those of motor responses to maximal peripheral nerve stimulation, and show marked variation between normal subjects and from one stimulus to another. Consequently, amplitude measurements have low sensitivity to detect central motor conduction failures due to the broad range of normal values. Since these characteristics are mostly due to varying desynchronization of the descending action potentials, causing different degrees of phase cancellation, we applied the recently developed triple stimulation technique (TST) to study corticospinal conduction to 489 abductor digiti minimi muscles of 271 unselected patients referred for possible corticospinal dysfunction. The TST allows resynchronization of the MEP, and thereby a quantification of the proportion of motor units activated by the transcranial stimulus. TST results were compared with those of conventional MEPs. In 212 of 489 sides, abnormal TST responses suggested conduction failure of various degrees. By contrast, conventional MEPs detected conduction failures in only 77 of 489 sides. The TST was therefore 2.75 times more sensitive than conventional MEPs in disclosing corticospinal conduction failures. When the results of the TST and conventional MEPs were combined, 225 sides were abnormal: 145 sides showed central conduction failure, 13 sides central conduction slowing and 67 sides both conduction failure and slowing. It is concluded that the TST is a valuable addition to the study of MEPs, since it improves detection and gives quantitative information on central conduction failure, an abnormality which appears to be much more frequent than conduction slowing. This new technique will be useful in following the natural course and the benefit of treatments in disorders affecting central motor conduction.  (+info)

Infratentorial atrophy on magnetic resonance imaging and disability in multiple sclerosis. (7/3138)

Loss of tissue volume in the central nervous system may provide an index of fixed neurological dysfunction in multiple sclerosis. Recent magnetic resonance studies have shown a modest relationship between clinical disability rating scores and transverse sectional area of the cervical spinal cord. To explore further the relationship between atrophy and disability in multiple sclerosis, we estimated the volumes of infratentorial structures from MRIs in a cross-sectional study of 41 patients, 21 with relapsing-remitting multiple sclerosis and 20 with secondary progressive multiple sclerosis. We used the Cavalieri method of modern design stereology with point counting to estimate the volume of brainstem, cerebellum and upper cervical spinal cord from three-dimensional MRIs acquired with an MPRAGE (Magnetization-prepared Rapid Acquisition Gradient Echo) sequence. The volume of the upper (C1-C3) cervical spinal cord was significantly correlated with a composite spinal cord score derived from the appropriate Functional Scale scores of the Expanded Disability Status Scale (r = -0.50, P < 0.01). The cerebellar (r = 0.49, P < 0.01) and brainstem (r = 0.34, P < 0.05) volumes correlated with the Scripp's Neurological Disability Rating Scale scores. The upper cervical cord volumes (r = -0.39, P < 0.01), but not the brainstem or cerebellar volumes, were significantly associated with disease duration. MRI-estimated structural volumes may provide a simple index of axonal and/or myelin loss, the presumed pathological substrates of irreversible impairment and disability in multiple sclerosis.  (+info)

Tissue-specific changes of type 1 angiotensin II receptor and angiotensin-converting enzyme mRNA in angiotensinogen gene-knockout mice. (8/3138)

This study examined whether type 1 angiotensin II receptor (AT1) and angiotensin-converting enzyme (ACE) mRNAs are regulated during dietary salt loading in angiotensinogen gene-knockout (Atg-/-) mice which are genetically deficient in endogenous production of angiotensin II. Wild-type (Atg+/+) and Atg-/- mice were fed a normal-salt (0.3% NaCl) or a high-salt (4% NaCl) diet for 2 weeks. The mRNA levels were measured by Northern blot analysis. In Atg+/+ mice, concentrations of plasma angiotensin peptides were decreased by salt loading, whereas the treatment increased the brainstem, cardiac, pulmonary, renal cortex, gastric and intestinal AT1 mRNA levels. Salt loading also enhanced renal cortex ACE mRNA levels in Atg+/+ mice. Although plasma angiotensin peptides and urinary aldosterone excretion were not detected in Atg-/- mice, salt loading increased blood pressure in Atg-/- mice. In Atg-/- mice, pulmonary, renal cortex, gastric and intestinal AT1, and renal cortex and intestinal ACE mRNA levels were higher than those in Atg+/+ mice. However, salt loading upregulated AT1 mRNA expression only in the liver of Atg-/- mice, and the treatment did not affect ACE mRNA levels in Atg-/- mice. Furthermore, although the levels of ACE enzymatic activity showed the same trend with the ACE mRNA levels in the lung, renal cortex and intestine of both Atg-/- and Atg+/+ mice, the results of radioligand binding assay showed that cardiac expression of AT1 protein was regulated differently from AT1 mRNA expression both in Atg-/- and Atg+/+ mice. Thus, expression of AT1 and ACE is regulated by salt loading in a tissue-specific manner that appears to be mediated, at least partly, by a mechanism other than changes in the circulating or tissue levels of angiotensin peptides.  (+info)

The brainstem is the lower part of the brain that connects to the spinal cord. It consists of the midbrain, pons, and medulla oblongata. The brainstem controls many vital functions such as heart rate, breathing, and blood pressure. It also serves as a relay center for sensory and motor information between the cerebral cortex and the rest of the body. Additionally, several cranial nerves originate from the brainstem, including those that control eye movements, facial movements, and hearing.

According to the National Institutes of Health (NIH), stem cells are "initial cells" or "precursor cells" that have the ability to differentiate into many different cell types in the body. They can also divide without limit to replenish other cells for as long as the person or animal is still alive.

There are two main types of stem cells: embryonic stem cells, which come from human embryos, and adult stem cells, which are found in various tissues throughout the body. Embryonic stem cells have the ability to differentiate into all cell types in the body, while adult stem cells have more limited differentiation potential.

Stem cells play an essential role in the development and repair of various tissues and organs in the body. They are currently being studied for their potential use in the treatment of a wide range of diseases and conditions, including cancer, diabetes, heart disease, and neurological disorders. However, more research is needed to fully understand the properties and capabilities of these cells before they can be used safely and effectively in clinical settings.

Brain chemistry refers to the chemical processes that occur within the brain, particularly those involving neurotransmitters, neuromodulators, and neuropeptides. These chemicals are responsible for transmitting signals between neurons (nerve cells) in the brain, allowing for various cognitive, emotional, and physical functions.

Neurotransmitters are chemical messengers that transmit signals across the synapse (the tiny gap between two neurons). Examples of neurotransmitters include dopamine, serotonin, norepinephrine, GABA (gamma-aminobutyric acid), and glutamate. Each neurotransmitter has a specific role in brain function, such as regulating mood, motivation, attention, memory, and movement.

Neuromodulators are chemicals that modify the effects of neurotransmitters on neurons. They can enhance or inhibit the transmission of signals between neurons, thereby modulating brain activity. Examples of neuromodulators include acetylcholine, histamine, and substance P.

Neuropeptides are small protein-like molecules that act as neurotransmitters or neuromodulators. They play a role in various physiological functions, such as pain perception, stress response, and reward processing. Examples of neuropeptides include endorphins, enkephalins, and oxytocin.

Abnormalities in brain chemistry can lead to various neurological and psychiatric conditions, such as depression, anxiety disorders, schizophrenia, Parkinson's disease, and Alzheimer's disease. Understanding brain chemistry is crucial for developing effective treatments for these conditions.

A brain injury is defined as damage to the brain that occurs following an external force or trauma, such as a blow to the head, a fall, or a motor vehicle accident. Brain injuries can also result from internal conditions, such as lack of oxygen or a stroke. There are two main types of brain injuries: traumatic and acquired.

Traumatic brain injury (TBI) is caused by an external force that results in the brain moving within the skull or the skull being fractured. Mild TBIs may result in temporary symptoms such as headaches, confusion, and memory loss, while severe TBIs can cause long-term complications, including physical, cognitive, and emotional impairments.

Acquired brain injury (ABI) is any injury to the brain that occurs after birth and is not hereditary, congenital, or degenerative. ABIs are often caused by medical conditions such as strokes, tumors, anoxia (lack of oxygen), or infections.

Both TBIs and ABIs can range from mild to severe and may result in a variety of physical, cognitive, and emotional symptoms that can impact a person's ability to perform daily activities and function independently. Treatment for brain injuries typically involves a multidisciplinary approach, including medical management, rehabilitation, and supportive care.

Brain neoplasms, also known as brain tumors, are abnormal growths of cells within the brain. These growths can be benign (non-cancerous) or malignant (cancerous). Benign brain tumors typically grow slowly and do not spread to other parts of the body. However, they can still cause serious problems if they press on sensitive areas of the brain. Malignant brain tumors, on the other hand, are cancerous and can grow quickly, invading surrounding brain tissue and spreading to other parts of the brain or spinal cord.

Brain neoplasms can arise from various types of cells within the brain, including glial cells (which provide support and insulation for nerve cells), neurons (nerve cells that transmit signals in the brain), and meninges (the membranes that cover the brain and spinal cord). They can also result from the spread of cancer cells from other parts of the body, known as metastatic brain tumors.

Symptoms of brain neoplasms may vary depending on their size, location, and growth rate. Common symptoms include headaches, seizures, weakness or paralysis in the limbs, difficulty with balance and coordination, changes in speech or vision, confusion, memory loss, and changes in behavior or personality.

Treatment for brain neoplasms depends on several factors, including the type, size, location, and grade of the tumor, as well as the patient's age and overall health. Treatment options may include surgery, radiation therapy, chemotherapy, targeted therapy, or a combination of these approaches. Regular follow-up care is essential to monitor for recurrence and manage any long-term effects of treatment.

Brain stem neoplasms refer to tumors that originate in the brainstem, which is the lower part of the brain that connects to the spinal cord. These tumors can be benign or malignant and can arise from various types of cells within the brainstem, such as nerve cells, glial cells (which support and protect nerve cells), or cells that make up blood vessels.

Brain stem neoplasms are relatively rare, accounting for about 2% of all primary brain tumors. They can cause a variety of symptoms depending on their size and location, including headache, vomiting, double vision, difficulty swallowing, facial weakness, and problems with balance and coordination. Treatment options may include surgery, radiation therapy, and chemotherapy, depending on the type, location, and extent of the tumor.

Auditory brainstem evoked potentials (ABEPs or BAEPs) are medical tests that measure the electrical activity in the auditory pathway of the brain in response to sound stimulation. The test involves placing electrodes on the scalp and recording the tiny electrical signals generated by the nerve cells in the brainstem as they respond to clicks or tone bursts presented through earphones.

The resulting waveform is analyzed for latency (the time it takes for the signal to travel from the ear to the brain) and amplitude (the strength of the signal). Abnormalities in the waveform can indicate damage to the auditory nerve or brainstem, and are often used in the diagnosis of various neurological conditions such as multiple sclerosis, acoustic neuroma, and brainstem tumors.

The test is non-invasive, painless, and takes only a few minutes to perform. It provides valuable information about the functioning of the auditory pathway and can help guide treatment decisions for patients with hearing or balance disorders.

Brain mapping is a broad term that refers to the techniques used to understand the structure and function of the brain. It involves creating maps of the various cognitive, emotional, and behavioral processes in the brain by correlating these processes with physical locations or activities within the nervous system. Brain mapping can be accomplished through a variety of methods, including functional magnetic resonance imaging (fMRI), positron emission tomography (PET) scans, electroencephalography (EEG), and others. These techniques allow researchers to observe which areas of the brain are active during different tasks or thoughts, helping to shed light on how the brain processes information and contributes to our experiences and behaviors. Brain mapping is an important area of research in neuroscience, with potential applications in the diagnosis and treatment of neurological and psychiatric disorders.

Brainstem infarctions refer to the damage or death of brain tissue in the brainstem due to lack of blood supply, resulting in a localized injury known as an infarction. The brainstem is a critical region that controls essential functions such as breathing, heart rate, and consciousness. Infarctions in this area can result in various symptoms depending on the location and extent of damage, which may include:

1. Hemiparesis or paralysis on one side of the body
2. Cranial nerve dysfunction, leading to double vision, slurred speech, or facial weakness
3. Difficulty swallowing or speaking
4. Unstable blood pressure and heart rate
5. Altered level of consciousness, ranging from confusion to coma
6. Abnormal muscle tone and reflexes
7. Respiratory disturbances, such as irregular breathing patterns or apnea (cessation of breathing)

Brainstem infarctions can be caused by various conditions, including atherosclerosis, embolism, vasospasm, or small vessel disease. Prompt diagnosis and treatment are crucial to minimize the risk of long-term disability or death.

The brain is the central organ of the nervous system, responsible for receiving and processing sensory information, regulating vital functions, and controlling behavior, movement, and cognition. It is divided into several distinct regions, each with specific functions:

1. Cerebrum: The largest part of the brain, responsible for higher cognitive functions such as thinking, learning, memory, language, and perception. It is divided into two hemispheres, each controlling the opposite side of the body.
2. Cerebellum: Located at the back of the brain, it is responsible for coordinating muscle movements, maintaining balance, and fine-tuning motor skills.
3. Brainstem: Connects the cerebrum and cerebellum to the spinal cord, controlling vital functions such as breathing, heart rate, and blood pressure. It also serves as a relay center for sensory information and motor commands between the brain and the rest of the body.
4. Diencephalon: A region that includes the thalamus (a major sensory relay station) and hypothalamus (regulates hormones, temperature, hunger, thirst, and sleep).
5. Limbic system: A group of structures involved in emotional processing, memory formation, and motivation, including the hippocampus, amygdala, and cingulate gyrus.

The brain is composed of billions of interconnected neurons that communicate through electrical and chemical signals. It is protected by the skull and surrounded by three layers of membranes called meninges, as well as cerebrospinal fluid that provides cushioning and nutrients.

A plant stem is not typically defined in a medical context, but rather in the field of botany. However, I can certainly provide a general biological definition for you.

In plants, stems are organs that serve primarily as support structures, holding leaves, flowers, and fruits aloft where they can receive sunlight and exchange gases. They also act as conduits, transporting water, nutrients, and sugars made during photosynthesis between the roots and shoots of a plant.

The stem is usually composed of three main tissue systems: dermal, vascular, and ground. The dermal tissue system forms the outermost layer(s) of the stem, providing protection and sometimes participating in gas exchange. The vascular tissue system contains the xylem (which transports water and nutrients upward) and phloem (which transports sugars and other organic compounds downward). The ground tissue system, located between the dermal and vascular tissues, is responsible for food storage and support.

While not a direct medical definition, understanding the structure and function of plant stems can be relevant in fields such as nutrition, agriculture, and environmental science, which have implications for human health.

Hematopoietic stem cells (HSCs) are immature, self-renewing cells that give rise to all the mature blood and immune cells in the body. They are capable of both producing more hematopoietic stem cells (self-renewal) and differentiating into early progenitor cells that eventually develop into red blood cells, white blood cells, and platelets. HSCs are found in the bone marrow, umbilical cord blood, and peripheral blood. They have the ability to repair damaged tissues and offer significant therapeutic potential for treating various diseases, including hematological disorders, genetic diseases, and cancer.

Stem cell transplantation is a medical procedure where stem cells, which are immature and unspecialized cells with the ability to differentiate into various specialized cell types, are introduced into a patient. The main purpose of this procedure is to restore the function of damaged or destroyed tissues or organs, particularly in conditions that affect the blood and immune systems, such as leukemia, lymphoma, aplastic anemia, and inherited metabolic disorders.

There are two primary types of stem cell transplantation: autologous and allogeneic. In autologous transplantation, the patient's own stem cells are collected, stored, and then reinfused back into their body after high-dose chemotherapy or radiation therapy to destroy the diseased cells. In allogeneic transplantation, stem cells are obtained from a donor (related or unrelated) whose human leukocyte antigen (HLA) type closely matches that of the recipient.

The process involves several steps: first, the patient undergoes conditioning therapy to suppress their immune system and make space for the new stem cells. Then, the harvested stem cells are infused into the patient's bloodstream, where they migrate to the bone marrow and begin to differentiate and produce new blood cells. This procedure requires close monitoring and supportive care to manage potential complications such as infections, graft-versus-host disease, and organ damage.

Adult stem cells, also known as somatic stem cells, are undifferentiated cells found in specialized tissues or organs throughout the body of a developed organism. Unlike embryonic stem cells, which are derived from blastocysts and have the ability to differentiate into any cell type in the body (pluripotency), adult stem cells are typically more limited in their differentiation potential, meaning they can only give rise to specific types of cells within the tissue or organ where they reside.

Adult stem cells serve to maintain and repair tissues by replenishing dying or damaged cells. They can divide and self-renew over time, producing one daughter cell that remains a stem cell and another that differentiates into a mature, functional cell type. The most well-known adult stem cells are hematopoietic stem cells, which give rise to all types of blood cells, and mesenchymal stem cells, which can differentiate into various connective tissue cells such as bone, cartilage, fat, and muscle.

The potential therapeutic use of adult stem cells has been explored in various medical fields, including regenerative medicine and cancer therapy. However, their limited differentiation capacity and the challenges associated with isolating and expanding them in culture have hindered their widespread application. Recent advances in stem cell research, such as the development of techniques to reprogram adult cells into induced pluripotent stem cells (iPSCs), have opened new avenues for studying and harnessing the therapeutic potential of these cells.

Neoplastic stem cells, also known as cancer stem cells (CSCs), are a subpopulation of cells within a tumor that are capable of self-renewal and generating the heterogeneous lineages of cells that comprise the tumor. These cells are believed to be responsible for the initiation, maintenance, and progression of cancer, as well as its recurrence and resistance to therapy.

CSCs share some similarities with normal stem cells, such as their ability to divide asymmetrically and give rise to differentiated progeny. However, they also have distinct characteristics that distinguish them from their normal counterparts, including aberrant gene expression, altered signaling pathways, and increased resistance to apoptosis (programmed cell death).

The existence of CSCs has important implications for cancer diagnosis, treatment, and prevention. Targeting these cells specifically may be necessary to achieve durable remissions and prevent relapse, as they are thought to survive conventional therapies that target the bulk of the tumor. Further research is needed to better understand the biology of CSCs and develop effective strategies for their elimination.

Medical Definition:

Magnetic Resonance Imaging (MRI) is a non-invasive diagnostic imaging technique that uses a strong magnetic field and radio waves to create detailed cross-sectional or three-dimensional images of the internal structures of the body. The patient lies within a large, cylindrical magnet, and the scanner detects changes in the direction of the magnetic field caused by protons in the body. These changes are then converted into detailed images that help medical professionals to diagnose and monitor various medical conditions, such as tumors, injuries, or diseases affecting the brain, spinal cord, heart, blood vessels, joints, and other internal organs. MRI does not use radiation like computed tomography (CT) scans.

Neurons, also known as nerve cells or neurocytes, are specialized cells that constitute the basic unit of the nervous system. They are responsible for receiving, processing, and transmitting information and signals within the body. Neurons have three main parts: the dendrites, the cell body (soma), and the axon. The dendrites receive signals from other neurons or sensory receptors, while the axon transmits these signals to other neurons, muscles, or glands. The junction between two neurons is called a synapse, where neurotransmitters are released to transmit the signal across the gap (synaptic cleft) to the next neuron. Neurons vary in size, shape, and structure depending on their function and location within the nervous system.

Brain edema is a medical condition characterized by the abnormal accumulation of fluid in the brain, leading to an increase in intracranial pressure. This can result from various causes, such as traumatic brain injury, stroke, infection, brain tumors, or inflammation. The swelling of the brain can compress vital structures, impair blood flow, and cause neurological symptoms, which may range from mild headaches to severe cognitive impairment, seizures, coma, or even death if not treated promptly and effectively.

Pluripotent stem cells are a type of undifferentiated stem cell that have the ability to differentiate into any cell type of the three germ layers (endoderm, mesoderm, and ectoderm) of a developing embryo. These cells can give rise to all the cell types that make up the human body, with the exception of those that form the extra-embryonic tissues such as the placenta.

Pluripotent stem cells are characterized by their ability to self-renew, which means they can divide and produce more pluripotent stem cells, and differentiate, which means they can give rise to specialized cell types with specific functions. Pluripotent stem cells can be derived from embryos at the blastocyst stage of development or generated in the lab through a process called induced pluripotency, where adult cells are reprogrammed to have the properties of embryonic stem cells.

Pluripotent stem cells hold great promise for regenerative medicine and tissue engineering because they can be used to generate large numbers of specific cell types that can potentially replace or repair damaged or diseased tissues in the body. However, their use is still a subject of ethical debate due to concerns about the source of embryonic stem cells and the potential risks associated with their use in clinical applications.

The pons is a part of the brainstem that lies between the medulla oblongata and the midbrain. Its name comes from the Latin word "ponte" which means "bridge," as it serves to connect these two regions of the brainstem. The pons contains several important structures, including nerve fibers that carry signals between the cerebellum (the part of the brain responsible for coordinating muscle movements) and the rest of the nervous system. It also contains nuclei (clusters of neurons) that help regulate various functions such as respiration, sleep, and facial movements.

The medulla oblongata is a part of the brainstem that is located in the posterior portion of the brainstem and continues with the spinal cord. It plays a vital role in controlling several critical bodily functions, such as breathing, heart rate, and blood pressure. The medulla oblongata also contains nerve pathways that transmit sensory information from the body to the brain and motor commands from the brain to the muscles. Additionally, it is responsible for reflexes such as vomiting, swallowing, coughing, and sneezing.

Brain ischemia is the medical term used to describe a reduction or interruption of blood flow to the brain, leading to a lack of oxygen and glucose delivery to brain tissue. This can result in brain damage or death of brain cells, known as infarction. Brain ischemia can be caused by various conditions such as thrombosis (blood clot formation), embolism (obstruction of a blood vessel by a foreign material), or hypoperfusion (reduced blood flow). The severity and duration of the ischemia determine the extent of brain damage. Symptoms can range from mild, such as transient ischemic attacks (TIAs or "mini-strokes"), to severe, including paralysis, speech difficulties, loss of consciousness, and even death. Immediate medical attention is required for proper diagnosis and treatment to prevent further damage and potential long-term complications.

A stem cell niche is a specific microenvironment in which stem cells reside, interact with surrounding cells and receive molecular signals that regulate their self-renewal, proliferation, differentiation, and survival. This specialized niche provides the necessary conditions for maintaining the undifferentiated state of stem cells and controlling their fate decisions. The components of a stem cell niche typically include various cell types (such as supporting cells, immune cells, and blood vessels), extracellular matrix proteins, signaling molecules, and physical factors like oxygen tension and mechanical stress. Together, these elements create a unique microenvironment that helps to preserve the functional integrity and potential of stem cells for tissue repair, regeneration, and homeostasis.

Neural stem cells (NSCs) are a type of undifferentiated cells found in the central nervous system, including the brain and spinal cord. They have the ability to self-renew and generate the main types of cells found in the nervous system, such as neurons, astrocytes, and oligodendrocytes. NSCs are capable of dividing symmetrically to increase their own population or asymmetrically to produce one stem cell and one differentiated cell. They play a crucial role in the development and maintenance of the nervous system, and have the potential to be used in regenerative medicine and therapies for neurological disorders and injuries.

Brain death is a legal and medical determination that an individual has died because their brain has irreversibly lost all functions necessary for life. It is characterized by the absence of brainstem reflexes, unresponsiveness to stimuli, and the inability to breathe without mechanical support. Brain death is different from a vegetative state or coma, where there may still be some brain activity.

The determination of brain death involves a series of tests and examinations to confirm the absence of brain function. These tests are typically performed by trained medical professionals and may include clinical assessments, imaging studies, and electroencephalograms (EEGs) to confirm the absence of electrical activity in the brain.

Brain death is an important concept in medicine because it allows for the organ donation process to proceed, potentially saving the lives of others. In many jurisdictions, brain death is legally equivalent to cardiopulmonary death, which means that once a person has been declared brain dead, they are considered deceased and their organs can be removed for transplantation.

Hematopoietic Stem Cell Transplantation (HSCT) is a medical procedure where hematopoietic stem cells (immature cells that give rise to all blood cell types) are transplanted into a patient. This procedure is often used to treat various malignant and non-malignant disorders affecting the hematopoietic system, such as leukemias, lymphomas, multiple myeloma, aplastic anemia, inherited immune deficiency diseases, and certain genetic metabolic disorders.

The transplantation can be autologous (using the patient's own stem cells), allogeneic (using stem cells from a genetically matched donor, usually a sibling or unrelated volunteer), or syngeneic (using stem cells from an identical twin).

The process involves collecting hematopoietic stem cells, most commonly from the peripheral blood or bone marrow. The collected cells are then infused into the patient after the recipient's own hematopoietic system has been ablated (or destroyed) using high-dose chemotherapy and/or radiation therapy. This allows the donor's stem cells to engraft, reconstitute, and restore the patient's hematopoietic system.

HSCT is a complex and potentially risky procedure with various complications, including graft-versus-host disease, infections, and organ damage. However, it offers the potential for cure or long-term remission in many patients with otherwise fatal diseases.

Induced Pluripotent Stem Cells (iPSCs) are a type of pluripotent stem cells that are generated from somatic cells, such as skin or blood cells, through the introduction of specific genes encoding transcription factors. These reprogrammed cells exhibit similar characteristics to embryonic stem cells, including the ability to differentiate into any cell type of the three germ layers (endoderm, mesoderm, and ectoderm). The discovery and development of iPSCs have opened up new possibilities in regenerative medicine, drug testing and development, and disease modeling, while avoiding ethical concerns associated with embryonic stem cells.

The solitary nucleus, also known as the nucleus solitarius, is a collection of neurons located in the medulla oblongata region of the brainstem. It plays a crucial role in the processing and integration of sensory information, particularly taste and visceral afferent fibers from internal organs. The solitary nucleus receives inputs from various cranial nerves, including the glossopharyngeal (cranial nerve IX) and vagus nerves (cranial nerve X), and is involved in reflex responses related to swallowing, vomiting, and cardiovascular regulation.

The cerebral cortex is the outermost layer of the brain, characterized by its intricate folded structure and wrinkled appearance. It is a region of great importance as it plays a key role in higher cognitive functions such as perception, consciousness, thought, memory, language, and attention. The cerebral cortex is divided into two hemispheres, each containing four lobes: the frontal, parietal, temporal, and occipital lobes. These areas are responsible for different functions, with some regions specializing in sensory processing while others are involved in motor control or associative functions. The cerebral cortex is composed of gray matter, which contains neuronal cell bodies, and is covered by a layer of white matter that consists mainly of myelinated nerve fibers.

Multipotent stem cells are a type of stem cell that have the ability to differentiate into multiple cell types, but are more limited than pluripotent stem cells. These stem cells are found in various tissues and organs throughout the body, including bone marrow, adipose tissue, and dental pulp. They can give rise to a number of different cell types within their own germ layer (endoderm, mesoderm, or ectoderm), but cannot cross germ layer boundaries. For example, multipotent stem cells found in bone marrow can differentiate into various blood cells such as red and white blood cells, but they cannot differentiate into nerve cells or liver cells. These stem cells play important roles in tissue repair and regeneration, and have potential therapeutic applications in regenerative medicine.

The cerebellum is a part of the brain that lies behind the brainstem and is involved in the regulation of motor movements, balance, and coordination. It contains two hemispheres and a central portion called the vermis. The cerebellum receives input from sensory systems and other areas of the brain and spinal cord and sends output to motor areas of the brain. Damage to the cerebellum can result in problems with movement, balance, and coordination.

A brain abscess is a localized collection of pus in the brain that is caused by an infection. It can develop as a result of a bacterial, fungal, or parasitic infection that spreads to the brain from another part of the body or from an infection that starts in the brain itself (such as from a head injury or surgery).

The symptoms of a brain abscess may include headache, fever, confusion, seizures, weakness or numbness on one side of the body, and changes in vision, speech, or behavior. Treatment typically involves antibiotics to treat the infection, as well as surgical drainage of the abscess to relieve pressure on the brain.

It is a serious medical condition that requires prompt diagnosis and treatment to prevent potentially life-threatening complications such as brain herniation or permanent neurological damage.

Mesenchymal Stem Cell Transplantation (MSCT) is a medical procedure that involves the transplantation of mesenchymal stem cells (MSCs), which are multipotent stromal cells that can differentiate into a variety of cell types, including bone, cartilage, fat, and muscle. These cells can be obtained from various sources, such as bone marrow, adipose tissue, umbilical cord blood, or dental pulp.

In MSCT, MSCs are typically harvested from the patient themselves (autologous transplantation) or from a donor (allogeneic transplantation). The cells are then processed and expanded in a laboratory setting before being injected into the patient's body, usually through an intravenous infusion.

MSCT is being investigated as a potential treatment for a wide range of medical conditions, including degenerative diseases, autoimmune disorders, and tissue injuries. The rationale behind this approach is that MSCs have the ability to migrate to sites of injury or inflammation, where they can help to modulate the immune response, reduce inflammation, and promote tissue repair and regeneration.

However, it's important to note that while MSCT holds promise as a therapeutic option, more research is needed to establish its safety and efficacy for specific medical conditions.

In the field of medicine, "time factors" refer to the duration of symptoms or time elapsed since the onset of a medical condition, which can have significant implications for diagnosis and treatment. Understanding time factors is crucial in determining the progression of a disease, evaluating the effectiveness of treatments, and making critical decisions regarding patient care.

For example, in stroke management, "time is brain," meaning that rapid intervention within a specific time frame (usually within 4.5 hours) is essential to administering tissue plasminogen activator (tPA), a clot-busting drug that can minimize brain damage and improve patient outcomes. Similarly, in trauma care, the "golden hour" concept emphasizes the importance of providing definitive care within the first 60 minutes after injury to increase survival rates and reduce morbidity.

Time factors also play a role in monitoring the progression of chronic conditions like diabetes or heart disease, where regular follow-ups and assessments help determine appropriate treatment adjustments and prevent complications. In infectious diseases, time factors are crucial for initiating antibiotic therapy and identifying potential outbreaks to control their spread.

Overall, "time factors" encompass the significance of recognizing and acting promptly in various medical scenarios to optimize patient outcomes and provide effective care.

The Respiratory Center is a group of neurons located in the medulla oblongata and pons within the brainstem that are responsible for controlling and regulating breathing. It receives inputs from various sources, including chemoreceptors that detect changes in oxygen and carbon dioxide levels in the blood, as well as mechanoreceptors that provide information about the status of the lungs and airways. Based on these inputs, the respiratory center generates signals that are sent to the diaphragm and intercostal muscles to control the rate and depth of breathing, ensuring adequate gas exchange in the lungs.

Damage to the respiratory center can result in abnormal breathing patterns or even respiratory failure, highlighting its critical role in maintaining proper respiratory function.

"Newborn animals" refers to the very young offspring of animals that have recently been born. In medical terminology, newborns are often referred to as "neonates," and they are classified as such from birth until about 28 days of age. During this time period, newborn animals are particularly vulnerable and require close monitoring and care to ensure their survival and healthy development.

The specific needs of newborn animals can vary widely depending on the species, but generally, they require warmth, nutrition, hydration, and protection from harm. In many cases, newborns are unable to regulate their own body temperature or feed themselves, so they rely heavily on their mothers for care and support.

In medical settings, newborn animals may be examined and treated by veterinarians to ensure that they are healthy and receiving the care they need. This can include providing medical interventions such as feeding tubes, antibiotics, or other treatments as needed to address any health issues that arise. Overall, the care and support of newborn animals is an important aspect of animal medicine and conservation efforts.

Brain hypoxia is a medical condition characterized by a reduced supply of oxygen to the brain. The brain requires a continuous supply of oxygen to function properly, and even a brief period of hypoxia can cause significant damage to brain cells.

Hypoxia can result from various conditions, such as cardiac arrest, respiratory failure, carbon monoxide poisoning, or high altitude exposure. When the brain is deprived of oxygen, it can lead to a range of symptoms, including confusion, disorientation, seizures, loss of consciousness, and ultimately, brain death.

Brain hypoxia is a medical emergency that requires immediate treatment to prevent long-term neurological damage or death. Treatment typically involves addressing the underlying cause of hypoxia, such as administering oxygen therapy, resuscitating the heart, or treating respiratory failure. In some cases, more invasive treatments, such as therapeutic hypothermia or mechanical ventilation, may be necessary to prevent further brain damage.

Neural pathways, also known as nerve tracts or fasciculi, refer to the highly organized and specialized routes through which nerve impulses travel within the nervous system. These pathways are formed by groups of neurons (nerve cells) that are connected in a series, creating a continuous communication network for electrical signals to transmit information between different regions of the brain, spinal cord, and peripheral nerves.

Neural pathways can be classified into two main types: sensory (afferent) and motor (efferent). Sensory neural pathways carry sensory information from various receptors in the body (such as those for touch, temperature, pain, and vision) to the brain for processing. Motor neural pathways, on the other hand, transmit signals from the brain to the muscles and glands, controlling movements and other effector functions.

The formation of these neural pathways is crucial for normal nervous system function, as it enables efficient communication between different parts of the body and allows for complex behaviors, cognitive processes, and adaptive responses to internal and external stimuli.

The hypoglossal nerve, also known as the 12th cranial nerve (CN XII), is primarily responsible for innervating the muscles of the tongue, allowing for its movement and function. These muscles include the intrinsic muscles that alter the shape of the tongue and the extrinsic muscles that position it in the oral cavity. The hypoglossal nerve also has some minor contributions to the innervation of two muscles in the neck: the sternocleidomastoid and the trapezius. These functions are related to head turning and maintaining head position. Any damage to this nerve can lead to weakness or paralysis of the tongue, causing difficulty with speech, swallowing, and tongue movements.

Stem Cell Factor (SCF), also known as Kit Ligand or Steel Factor, is a growth factor that plays a crucial role in the regulation of hematopoiesis, which is the process of producing various blood cells. It is a glycoprotein that binds to the c-Kit receptor found on hematopoietic stem cells and progenitor cells, promoting their survival, proliferation, and differentiation into mature blood cells.

SCF is involved in the development and function of several types of blood cells, including red blood cells, white blood cells, and platelets. It also plays a role in the maintenance and self-renewal of hematopoietic stem cells, which are essential for the continuous production of new blood cells throughout an individual's lifetime.

In addition to its role in hematopoiesis, SCF has been implicated in various other biological processes, such as melanogenesis, gametogenesis, and tissue repair and regeneration. Dysregulation of SCF signaling has been associated with several diseases, including certain types of cancer, bone marrow failure disorders, and autoimmune diseases.

The spinal cord is a major part of the nervous system, extending from the brainstem and continuing down to the lower back. It is a slender, tubular bundle of nerve fibers (axons) and support cells (glial cells) that carries signals between the brain and the rest of the body. The spinal cord primarily serves as a conduit for motor information, which travels from the brain to the muscles, and sensory information, which travels from the body to the brain. It also contains neurons that can independently process and respond to information within the spinal cord without direct input from the brain.

The spinal cord is protected by the bony vertebral column (spine) and is divided into 31 segments: 8 cervical, 12 thoracic, 5 lumbar, 5 sacral, and 1 coccygeal. Each segment corresponds to a specific region of the body and gives rise to pairs of spinal nerves that exit through the intervertebral foramina at each level.

The spinal cord is responsible for several vital functions, including:

1. Reflexes: Simple reflex actions, such as the withdrawal reflex when touching a hot surface, are mediated by the spinal cord without involving the brain.
2. Muscle control: The spinal cord carries motor signals from the brain to the muscles, enabling voluntary movement and muscle tone regulation.
3. Sensory perception: The spinal cord transmits sensory information, such as touch, temperature, pain, and vibration, from the body to the brain for processing and awareness.
4. Autonomic functions: The sympathetic and parasympathetic divisions of the autonomic nervous system originate in the thoracolumbar and sacral regions of the spinal cord, respectively, controlling involuntary physiological responses like heart rate, blood pressure, digestion, and respiration.

Damage to the spinal cord can result in various degrees of paralysis or loss of sensation below the level of injury, depending on the severity and location of the damage.

"Cells, cultured" is a medical term that refers to cells that have been removed from an organism and grown in controlled laboratory conditions outside of the body. This process is called cell culture and it allows scientists to study cells in a more controlled and accessible environment than they would have inside the body. Cultured cells can be derived from a variety of sources, including tissues, organs, or fluids from humans, animals, or cell lines that have been previously established in the laboratory.

Cell culture involves several steps, including isolation of the cells from the tissue, purification and characterization of the cells, and maintenance of the cells in appropriate growth conditions. The cells are typically grown in specialized media that contain nutrients, growth factors, and other components necessary for their survival and proliferation. Cultured cells can be used for a variety of purposes, including basic research, drug development and testing, and production of biological products such as vaccines and gene therapies.

It is important to note that cultured cells may behave differently than they do in the body, and results obtained from cell culture studies may not always translate directly to human physiology or disease. Therefore, it is essential to validate findings from cell culture experiments using additional models and ultimately in clinical trials involving human subjects.

Mesenchymal Stromal Cells (MSCs) are a type of adult stem cells found in various tissues, including bone marrow, adipose tissue, and umbilical cord blood. They have the ability to differentiate into multiple cell types, such as osteoblasts, chondrocytes, and adipocytes, under specific conditions. MSCs also possess immunomodulatory properties, making them a promising tool in regenerative medicine and therapeutic strategies for various diseases, including autoimmune disorders and tissue injuries. It is important to note that the term "Mesenchymal Stem Cells" has been replaced by "Mesenchymal Stromal Cells" in the scientific community to better reflect their biological characteristics and potential functions.

The reticular formation is not a single structure but rather a complex network of interconnected neurons located in the brainstem, extending from the medulla oblongata through the pons and mesencephalon (midbrain) up to the diencephalon (thalamus and hypothalamus). It forms part of the reticular activating system, which is involved in regulating arousal, awareness, and sleep-wake cycles.

The reticular formation plays a crucial role in various functions such as:

1. Modulation of sensory input: The neurons in the reticular formation receive inputs from all senses (visual, auditory, tactile, etc.) and help filter and prioritize this information before it reaches higher cognitive areas.

2. Control of motor function: The reticular formation contributes to the regulation of muscle tone, posture, and locomotion by modulating the activity of motor neurons in the spinal cord.

3. Regulation of autonomic functions: The reticular formation is involved in controlling heart rate, blood pressure, respiration, and other visceral functions through its connections with the autonomic nervous system.

4. Consciousness and arousal: The ascending reticular activating system (ARAS) originates from the reticular formation and projects to the thalamus and cerebral cortex, where it helps maintain wakefulness and arousal. Damage to the ARAS can lead to coma or other states of altered consciousness.

5. Sleep-wake cycle regulation: The reticular formation contains cells that release neurotransmitters like histamine, serotonin, and orexin/hypocretin, which are essential for sleep-wake regulation. Dysfunction in these circuits has been implicated in various sleep disorders, such as narcolepsy and insomnia.

An auditory brainstem implant (ABI) is a surgically placed device that provides a sense of sound to individuals who have severe hearing loss and cannot benefit from cochlear implants. Unlike cochlear implants, which stimulate the auditory nerve directly, ABIs transmit electrical signals directly to the brainstem, bypassing the inner ear entirely.

The ABI consists of a microphone, processor, and a series of electrodes that are surgically placed on the surface of the brainstem. The microphone picks up sounds from the environment, and the processor converts them into electrical signals. These signals are then sent to the electrodes, which stimulate the nearby nerve cells in the brainstem.

The brain interprets these stimuli as sound, allowing the individual to perceive some level of hearing. While ABIs do not provide the same level of hearing as cochlear implants, they can help individuals with profound hearing loss to communicate more effectively and improve their quality of life.

It's important to note that ABIs are typically reserved for individuals who have severe hearing loss due to damage to the inner ear or auditory nerve, and who are not candidates for cochlear implants. The procedure is complex and carries risks, so it is only recommended in cases where the potential benefits outweigh the risks.

Chronic brain damage is a condition characterized by long-term, persistent injury to the brain that results in cognitive, physical, and behavioral impairments. It can be caused by various factors such as trauma, hypoxia (lack of oxygen), infection, toxic exposure, or degenerative diseases. The effects of chronic brain damage may not be immediately apparent and can worsen over time, leading to significant disability and reduced quality of life.

The symptoms of chronic brain damage can vary widely depending on the severity and location of the injury. They may include:

* Cognitive impairments such as memory loss, difficulty concentrating, trouble with problem-solving and decision-making, and decreased learning ability
* Motor impairments such as weakness, tremors, poor coordination, and balance problems
* Sensory impairments such as hearing or vision loss, numbness, tingling, or altered sense of touch
* Speech and language difficulties such as aphasia (problems with understanding or producing speech) or dysarthria (slurred or slow speech)
* Behavioral changes such as irritability, mood swings, depression, anxiety, and personality changes

Chronic brain damage can be diagnosed through a combination of medical history, physical examination, neurological evaluation, and imaging studies such as MRI or CT scans. Treatment typically focuses on managing symptoms and maximizing function through rehabilitation therapies such as occupational therapy, speech therapy, and physical therapy. In some cases, medication or surgery may be necessary to address specific symptoms or underlying causes of the brain damage.

C57BL/6 (C57 Black 6) is an inbred strain of laboratory mouse that is widely used in biomedical research. The term "inbred" refers to a strain of animals where matings have been carried out between siblings or other closely related individuals for many generations, resulting in a population that is highly homozygous at most genetic loci.

The C57BL/6 strain was established in 1920 by crossing a female mouse from the dilute brown (DBA) strain with a male mouse from the black strain. The resulting offspring were then interbred for many generations to create the inbred C57BL/6 strain.

C57BL/6 mice are known for their robust health, longevity, and ease of handling, making them a popular choice for researchers. They have been used in a wide range of biomedical research areas, including studies of cancer, immunology, neuroscience, cardiovascular disease, and metabolism.

One of the most notable features of the C57BL/6 strain is its sensitivity to certain genetic modifications, such as the introduction of mutations that lead to obesity or impaired glucose tolerance. This has made it a valuable tool for studying the genetic basis of complex diseases and traits.

Overall, the C57BL/6 inbred mouse strain is an important model organism in biomedical research, providing a valuable resource for understanding the genetic and molecular mechanisms underlying human health and disease.

Immunohistochemistry (IHC) is a technique used in pathology and laboratory medicine to identify specific proteins or antigens in tissue sections. It combines the principles of immunology and histology to detect the presence and location of these target molecules within cells and tissues. This technique utilizes antibodies that are specific to the protein or antigen of interest, which are then tagged with a detection system such as a chromogen or fluorophore. The stained tissue sections can be examined under a microscope, allowing for the visualization and analysis of the distribution and expression patterns of the target molecule in the context of the tissue architecture. Immunohistochemistry is widely used in diagnostic pathology to help identify various diseases, including cancer, infectious diseases, and immune-mediated disorders.

Nerve tissue proteins are specialized proteins found in the nervous system that provide structural and functional support to nerve cells, also known as neurons. These proteins include:

1. Neurofilaments: These are type IV intermediate filaments that provide structural support to neurons and help maintain their shape and size. They are composed of three subunits - NFL (light), NFM (medium), and NFH (heavy).

2. Neuronal Cytoskeletal Proteins: These include tubulins, actins, and spectrins that provide structural support to the neuronal cytoskeleton and help maintain its integrity.

3. Neurotransmitter Receptors: These are specialized proteins located on the postsynaptic membrane of neurons that bind neurotransmitters released by presynaptic neurons, triggering a response in the target cell.

4. Ion Channels: These are transmembrane proteins that regulate the flow of ions across the neuronal membrane and play a crucial role in generating and transmitting electrical signals in neurons.

5. Signaling Proteins: These include enzymes, receptors, and adaptor proteins that mediate intracellular signaling pathways involved in neuronal development, differentiation, survival, and death.

6. Adhesion Proteins: These are cell surface proteins that mediate cell-cell and cell-matrix interactions, playing a crucial role in the formation and maintenance of neural circuits.

7. Extracellular Matrix Proteins: These include proteoglycans, laminins, and collagens that provide structural support to nerve tissue and regulate neuronal migration, differentiation, and survival.

The trigeminal nuclei are a collection of sensory nerve cell bodies (nuclei) located in the brainstem that receive and process sensory information from the face and head, including pain, temperature, touch, and proprioception. There are four main trigeminal nuclei: the ophthalmic, maxillary, mandibular, and mesencephalic nuclei. Each nucleus is responsible for processing sensory information from specific areas of the face and head. The trigeminal nerve (cranial nerve V) carries these sensory signals to the brainstem, where they synapse with neurons in the trigeminal nuclei before being relayed to higher brain centers for further processing.

The Blood-Brain Barrier (BBB) is a highly specialized, selective interface between the central nervous system (CNS) and the circulating blood. It is formed by unique endothelial cells that line the brain's capillaries, along with tight junctions, astrocytic foot processes, and pericytes, which together restrict the passage of substances from the bloodstream into the CNS. This barrier serves to protect the brain from harmful agents and maintain a stable environment for proper neural function. However, it also poses a challenge in delivering therapeutics to the CNS, as most large and hydrophilic molecules cannot cross the BBB.

Animal disease models are specialized animals, typically rodents such as mice or rats, that have been genetically engineered or exposed to certain conditions to develop symptoms and physiological changes similar to those seen in human diseases. These models are used in medical research to study the pathophysiology of diseases, identify potential therapeutic targets, test drug efficacy and safety, and understand disease mechanisms.

The genetic modifications can include knockout or knock-in mutations, transgenic expression of specific genes, or RNA interference techniques. The animals may also be exposed to environmental factors such as chemicals, radiation, or infectious agents to induce the disease state.

Examples of animal disease models include:

1. Mouse models of cancer: Genetically engineered mice that develop various types of tumors, allowing researchers to study cancer initiation, progression, and metastasis.
2. Alzheimer's disease models: Transgenic mice expressing mutant human genes associated with Alzheimer's disease, which exhibit amyloid plaque formation and cognitive decline.
3. Diabetes models: Obese and diabetic mouse strains like the NOD (non-obese diabetic) or db/db mice, used to study the development of type 1 and type 2 diabetes, respectively.
4. Cardiovascular disease models: Atherosclerosis-prone mice, such as ApoE-deficient or LDLR-deficient mice, that develop plaque buildup in their arteries when fed a high-fat diet.
5. Inflammatory bowel disease models: Mice with genetic mutations affecting intestinal barrier function and immune response, such as IL-10 knockout or SAMP1/YitFc mice, which develop colitis.

Animal disease models are essential tools in preclinical research, but it is important to recognize their limitations. Differences between species can affect the translatability of results from animal studies to human patients. Therefore, researchers must carefully consider the choice of model and interpret findings cautiously when applying them to human diseases.

The cerebral ventricles are a system of interconnected fluid-filled cavities within the brain. They are located in the center of the brain and are filled with cerebrospinal fluid (CSF), which provides protection to the brain by cushioning it from impacts and helping to maintain its stability within the skull.

There are four ventricles in total: two lateral ventricles, one third ventricle, and one fourth ventricle. The lateral ventricles are located in each cerebral hemisphere, while the third ventricle is located between the thalami of the two hemispheres. The fourth ventricle is located at the base of the brain, above the spinal cord.

CSF flows from the lateral ventricles into the third ventricle through narrow passageways called the interventricular foramen. From there, it flows into the fourth ventricle through another narrow passageway called the cerebral aqueduct. CSF then leaves the fourth ventricle and enters the subarachnoid space surrounding the brain and spinal cord, where it can be absorbed into the bloodstream.

Abnormalities in the size or shape of the cerebral ventricles can indicate underlying neurological conditions, such as hydrocephalus (excessive accumulation of CSF) or atrophy (shrinkage) of brain tissue. Imaging techniques, such as computed tomography (CT) or magnetic resonance imaging (MRI), are often used to assess the size and shape of the cerebral ventricles in clinical settings.

"Cat" is a common name that refers to various species of small carnivorous mammals that belong to the family Felidae. The domestic cat, also known as Felis catus or Felis silvestris catus, is a popular pet and companion animal. It is a subspecies of the wildcat, which is found in Europe, Africa, and Asia.

Domestic cats are often kept as pets because of their companionship, playful behavior, and ability to hunt vermin. They are also valued for their ability to provide emotional support and therapy to people. Cats are obligate carnivores, which means that they require a diet that consists mainly of meat to meet their nutritional needs.

Cats are known for their agility, sharp senses, and predatory instincts. They have retractable claws, which they use for hunting and self-defense. Cats also have a keen sense of smell, hearing, and vision, which allow them to detect prey and navigate their environment.

In medical terms, cats can be hosts to various parasites and diseases that can affect humans and other animals. Some common feline diseases include rabies, feline leukemia virus (FeLV), feline immunodeficiency virus (FIV), and toxoplasmosis. It is important for cat owners to keep their pets healthy and up-to-date on vaccinations and preventative treatments to protect both the cats and their human companions.

Electric stimulation, also known as electrical nerve stimulation or neuromuscular electrical stimulation, is a therapeutic treatment that uses low-voltage electrical currents to stimulate nerves and muscles. It is often used to help manage pain, promote healing, and improve muscle strength and mobility. The electrical impulses can be delivered through electrodes placed on the skin or directly implanted into the body.

In a medical context, electric stimulation may be used for various purposes such as:

1. Pain management: Electric stimulation can help to block pain signals from reaching the brain and promote the release of endorphins, which are natural painkillers produced by the body.
2. Muscle rehabilitation: Electric stimulation can help to strengthen muscles that have become weak due to injury, illness, or surgery. It can also help to prevent muscle atrophy and improve range of motion.
3. Wound healing: Electric stimulation can promote tissue growth and help to speed up the healing process in wounds, ulcers, and other types of injuries.
4. Urinary incontinence: Electric stimulation can be used to strengthen the muscles that control urination and reduce symptoms of urinary incontinence.
5. Migraine prevention: Electric stimulation can be used as a preventive treatment for migraines by applying electrical impulses to specific nerves in the head and neck.

It is important to note that electric stimulation should only be administered under the guidance of a qualified healthcare professional, as improper use can cause harm or discomfort.

'Cell lineage' is a term used in biology and medicine to describe the developmental history or relationship of a cell or group of cells to other cells, tracing back to the original progenitor or stem cell. It refers to the series of cell divisions and differentiation events that give rise to specific types of cells in an organism over time.

In simpler terms, cell lineage is like a family tree for cells, showing how they are related to each other through a chain of cell division and specialization events. This concept is important in understanding the development, growth, and maintenance of tissues and organs in living beings.

Tissue distribution, in the context of pharmacology and toxicology, refers to the way that a drug or xenobiotic (a chemical substance found within an organism that is not naturally produced by or expected to be present within that organism) is distributed throughout the body's tissues after administration. It describes how much of the drug or xenobiotic can be found in various tissues and organs, and is influenced by factors such as blood flow, lipid solubility, protein binding, and the permeability of cell membranes. Understanding tissue distribution is important for predicting the potential effects of a drug or toxin on different parts of the body, and for designing drugs with improved safety and efficacy profiles.

Fetal stem cells are a type of stem cell that are derived from fetal tissue, which is tissue obtained from an elective abortion or a spontaneous miscarriage. These stem cells have the ability to differentiate into various cell types, including neurons, cardiac muscle cells, and hepatocytes (liver cells). Fetal stem cells are unique in that they have a greater capacity for self-renewal and can generate a larger number of differentiated cells compared to adult stem cells. They also have the potential to be less immunogenic than other types of stem cells, making them a promising candidate for cell-based therapies and regenerative medicine. However, the use of fetal stem cells is a subject of ethical debate due to their source.

Sprague-Dawley rats are a strain of albino laboratory rats that are widely used in scientific research. They were first developed by researchers H.H. Sprague and R.C. Dawley in the early 20th century, and have since become one of the most commonly used rat strains in biomedical research due to their relatively large size, ease of handling, and consistent genetic background.

Sprague-Dawley rats are outbred, which means that they are genetically diverse and do not suffer from the same limitations as inbred strains, which can have reduced fertility and increased susceptibility to certain diseases. They are also characterized by their docile nature and low levels of aggression, making them easier to handle and study than some other rat strains.

These rats are used in a wide variety of research areas, including toxicology, pharmacology, nutrition, cancer, and behavioral studies. Because they are genetically diverse, Sprague-Dawley rats can be used to model a range of human diseases and conditions, making them an important tool in the development of new drugs and therapies.

A decerebrate state is a medical condition that results from severe damage to the brainstem, specifically to the midbrain and above. This type of injury can cause motor responses characterized by rigid extension of the arms and legs, with the arms rotated outward and the wrists and fingers extended. The legs are also extended and the toes pointed downward. These postures are often referred to as "decerebrate rigidity" or "posturing."

The decerebrate state is typically seen in patients who have experienced severe trauma, such as a car accident or gunshot wound, or who have suffered from a large stroke or other type of brain hemorrhage. It can also occur in some cases of severe hypoxia (lack of oxygen) to the brain, such as during cardiac arrest or drowning.

The decerebrate state is a serious medical emergency that requires immediate treatment. If left untreated, it can lead to further brain damage and even death. Treatment typically involves providing supportive care, such as mechanical ventilation to help with breathing, medications to control blood pressure and prevent seizures, and surgery to repair any underlying injuries or bleeding. In some cases, patients may require long-term rehabilitation to regain lost function and improve their quality of life.

The vagus nerve, also known as the 10th cranial nerve (CN X), is the longest of the cranial nerves and extends from the brainstem to the abdomen. It has both sensory and motor functions and plays a crucial role in regulating various bodily functions such as heart rate, digestion, respiratory rate, speech, and sweating, among others.

The vagus nerve is responsible for carrying sensory information from the internal organs to the brain, and it also sends motor signals from the brain to the muscles of the throat and voice box, as well as to the heart, lungs, and digestive tract. The vagus nerve helps regulate the body's involuntary responses, such as controlling heart rate and blood pressure, promoting relaxation, and reducing inflammation.

Dysfunction in the vagus nerve can lead to various medical conditions, including gastroparesis, chronic pain, and autonomic nervous system disorders. Vagus nerve stimulation (VNS) is a therapeutic intervention that involves delivering electrical impulses to the vagus nerve to treat conditions such as epilepsy, depression, and migraine headaches.

Cerebrovascular circulation refers to the network of blood vessels that supply oxygenated blood and nutrients to the brain tissue, and remove waste products. It includes the internal carotid arteries, vertebral arteries, circle of Willis, and the intracranial arteries that branch off from them.

The internal carotid arteries and vertebral arteries merge to form the circle of Willis, a polygonal network of vessels located at the base of the brain. The anterior cerebral artery, middle cerebral artery, posterior cerebral artery, and communicating arteries are the major vessels that branch off from the circle of Willis and supply blood to different regions of the brain.

Interruptions or abnormalities in the cerebrovascular circulation can lead to various neurological conditions such as stroke, transient ischemic attack (TIA), and vascular dementia.

Computer-assisted image processing is a medical term that refers to the use of computer systems and specialized software to improve, analyze, and interpret medical images obtained through various imaging techniques such as X-ray, CT (computed tomography), MRI (magnetic resonance imaging), ultrasound, and others.

The process typically involves several steps, including image acquisition, enhancement, segmentation, restoration, and analysis. Image processing algorithms can be used to enhance the quality of medical images by adjusting contrast, brightness, and sharpness, as well as removing noise and artifacts that may interfere with accurate diagnosis. Segmentation techniques can be used to isolate specific regions or structures of interest within an image, allowing for more detailed analysis.

Computer-assisted image processing has numerous applications in medical imaging, including detection and characterization of lesions, tumors, and other abnormalities; assessment of organ function and morphology; and guidance of interventional procedures such as biopsies and surgeries. By automating and standardizing image analysis tasks, computer-assisted image processing can help to improve diagnostic accuracy, efficiency, and consistency, while reducing the potential for human error.

Stem cell research is a branch of medical science that focuses on the study and application of stem cells, which are undifferentiated or unspecialized cells with the ability to differentiate into various specialized cell types in the body. These cells have the potential to regenerate and repair damaged tissues and organs, making them a promising area of research for the development of new treatments for a wide range of diseases and conditions, including cancer, neurodegenerative disorders, diabetes, heart disease, and more.

Stem cell research involves several key areas, such as:

1. Isolation and culture: Scientists isolate stem cells from various sources, such as embryos, umbilical cord blood, or adult tissues, and grow them in a lab to study their properties and behaviors.
2. Differentiation: Researchers induce stem cells to differentiate into specific cell types, such as heart cells, brain cells, or pancreatic cells, by exposing them to various growth factors and other chemical signals.
3. Genetic modification: Scientists may modify the genes of stem cells to enhance their therapeutic potential or to study the effects of genetic mutations on cell behavior and development.
4. Transplantation: In some cases, researchers transplant stem cells into animal models or human patients to investigate their ability to repair damaged tissues and organs.
5. Ethical considerations: Stem cell research raises several ethical concerns related to the use of embryonic stem cells, which are derived from human embryos. These concerns have led to ongoing debates about the limits and regulations surrounding this area of research.

Overall, stem cell research holds great promise for the development of new medical treatments and therapies, but it also requires careful consideration of ethical issues and rigorous scientific investigation to ensure its safety and effectiveness.

The hypothalamus is a small, vital region of the brain that lies just below the thalamus and forms part of the limbic system. It plays a crucial role in many important functions including:

1. Regulation of body temperature, hunger, thirst, fatigue, sleep, and circadian rhythms.
2. Production and regulation of hormones through its connection with the pituitary gland (the hypophysis). It controls the release of various hormones by producing releasing and inhibiting factors that regulate the anterior pituitary's function.
3. Emotional responses, behavior, and memory formation through its connections with the limbic system structures like the amygdala and hippocampus.
4. Autonomic nervous system regulation, which controls involuntary physiological functions such as heart rate, blood pressure, and digestion.
5. Regulation of the immune system by interacting with the autonomic nervous system.

Damage to the hypothalamus can lead to various disorders like diabetes insipidus, growth hormone deficiency, altered temperature regulation, sleep disturbances, and emotional or behavioral changes.

"Wistar rats" are a strain of albino rats that are widely used in laboratory research. They were developed at the Wistar Institute in Philadelphia, USA, and were first introduced in 1906. Wistar rats are outbred, which means that they are genetically diverse and do not have a fixed set of genetic characteristics like inbred strains.

Wistar rats are commonly used as animal models in biomedical research because of their size, ease of handling, and relatively low cost. They are used in a wide range of research areas, including toxicology, pharmacology, nutrition, cancer, cardiovascular disease, and behavioral studies. Wistar rats are also used in safety testing of drugs, medical devices, and other products.

Wistar rats are typically larger than many other rat strains, with males weighing between 500-700 grams and females weighing between 250-350 grams. They have a lifespan of approximately 2-3 years. Wistar rats are also known for their docile and friendly nature, making them easy to handle and work with in the laboratory setting.

Messenger RNA (mRNA) is a type of RNA (ribonucleic acid) that carries genetic information copied from DNA in the form of a series of three-base code "words," each of which specifies a particular amino acid. This information is used by the cell's machinery to construct proteins, a process known as translation. After being transcribed from DNA, mRNA travels out of the nucleus to the ribosomes in the cytoplasm where protein synthesis occurs. Once the protein has been synthesized, the mRNA may be degraded and recycled. Post-transcriptional modifications can also occur to mRNA, such as alternative splicing and addition of a 5' cap and a poly(A) tail, which can affect its stability, localization, and translation efficiency.

The basilar artery is a major blood vessel that supplies oxygenated blood to the brainstem and cerebellum. It is formed by the union of two vertebral arteries at the lower part of the brainstem, near the junction of the medulla oblongata and pons.

The basilar artery runs upward through the center of the brainstem and divides into two posterior cerebral arteries at the upper part of the brainstem, near the midbrain. The basilar artery gives off several branches that supply blood to various parts of the brainstem, including the pons, medulla oblongata, and midbrain, as well as to the cerebellum.

The basilar artery is an important part of the circle of Willis, a network of arteries at the base of the brain that ensures continuous blood flow to the brain even if one of the arteries becomes blocked or narrowed.

Cell proliferation is the process by which cells increase in number, typically through the process of cell division. In the context of biology and medicine, it refers to the reproduction of cells that makes up living tissue, allowing growth, maintenance, and repair. It involves several stages including the transition from a phase of quiescence (G0 phase) to an active phase (G1 phase), DNA replication in the S phase, and mitosis or M phase, where the cell divides into two daughter cells.

Abnormal or uncontrolled cell proliferation is a characteristic feature of many diseases, including cancer, where deregulated cell cycle control leads to excessive and unregulated growth of cells, forming tumors that can invade surrounding tissues and metastasize to distant sites in the body.

The "tectum mesencephali" is a term used in anatomy to refer to the roof or dorsal portion of the midbrain, which is a part of the brainstem. It plays a crucial role in visual and auditory processing, as well as motor coordination. The tectum mesencephali contains several important structures, including the superior colliculi and the inferior colliculi, which are involved in the reflexive responses to visual and auditory stimuli, respectively. Additionally, the tectum mesencephali is connected to various other regions of the brain, allowing for the integration of sensory information and the coordination of motor responses.

The mesencephalon, also known as the midbrain, is the middle portion of the brainstem that connects the hindbrain (rhombencephalon) and the forebrain (prosencephalon). It plays a crucial role in several important functions including motor control, vision, hearing, and the regulation of consciousness and sleep-wake cycles. The mesencephalon contains several important structures such as the cerebral aqueduct, tectum, tegmentum, cerebral peduncles, and several cranial nerve nuclei (III and IV).

Brain infarction, also known as cerebral infarction, is a type of stroke that occurs when blood flow to a part of the brain is blocked, often by a blood clot. This results in oxygen and nutrient deprivation to the brain tissue, causing it to become damaged or die. The effects of a brain infarction depend on the location and extent of the damage, but can include weakness, numbness, paralysis, speech difficulties, memory loss, and other neurological symptoms.

Brain infarctions are often caused by underlying medical conditions such as atherosclerosis, atrial fibrillation, or high blood pressure. Treatment typically involves addressing the underlying cause of the blockage, administering medications to dissolve clots or prevent further clotting, and providing supportive care to manage symptoms and prevent complications.

Efferent pathways refer to the neural connections that carry signals from the central nervous system (CNS), which includes the brain and spinal cord, to the peripheral effectors such as muscles and glands. These pathways are responsible for the initiation and control of motor responses, as well as regulating various autonomic functions.

Efferent pathways can be divided into two main types:

1. Somatic efferent pathways: These pathways carry signals from the CNS to the skeletal muscles, enabling voluntary movements and postural control. The final common pathway for somatic motor innervation is the alpha-motor neuron, which synapses directly onto skeletal muscle fibers.
2. Autonomic efferent pathways: These pathways regulate the function of internal organs, smooth muscles, and glands. They are further divided into two subtypes: sympathetic and parasympathetic. The sympathetic system is responsible for the 'fight or flight' response, while the parasympathetic system promotes rest and digestion. Both systems use a two-neuron chain to transmit signals from the CNS to the effector organs. The preganglionic neuron has its cell body in the CNS and synapses with the postganglionic neuron in an autonomic ganglion located near the effector organ. The postganglionic neuron then innervates the target organ or tissue.

In summary, efferent pathways are the neural connections that carry signals from the CNS to peripheral effectors, enabling motor responses and regulating various autonomic functions. They can be divided into somatic and autonomic efferent pathways, with further subdivisions within the autonomic system.

The hippocampus is a complex, curved formation in the brain that resembles a seahorse (hence its name, from the Greek word "hippos" meaning horse and "kampos" meaning sea monster). It's part of the limbic system and plays crucial roles in the formation of memories, particularly long-term ones.

This region is involved in spatial navigation and cognitive maps, allowing us to recognize locations and remember how to get to them. Additionally, it's one of the first areas affected by Alzheimer's disease, which often results in memory loss as an early symptom.

Anatomically, it consists of two main parts: the Ammon's horn (or cornu ammonis) and the dentate gyrus. These structures are made up of distinct types of neurons that contribute to different aspects of learning and memory.

The Central Nervous System (CNS) is the part of the nervous system that consists of the brain and spinal cord. It is called the "central" system because it receives information from, and sends information to, the rest of the body through peripheral nerves, which make up the Peripheral Nervous System (PNS).

The CNS is responsible for processing sensory information, controlling motor functions, and regulating various autonomic processes like heart rate, respiration, and digestion. The brain, as the command center of the CNS, interprets sensory stimuli, formulates thoughts, and initiates actions. The spinal cord serves as a conduit for nerve impulses traveling to and from the brain and the rest of the body.

The CNS is protected by several structures, including the skull (which houses the brain) and the vertebral column (which surrounds and protects the spinal cord). Despite these protective measures, the CNS remains vulnerable to injury and disease, which can have severe consequences due to its crucial role in controlling essential bodily functions.

The tegmentum mesencephali, also known as the mesencephalic tegmentum, is a region in the midbrain (mesencephalon) of the brainstem. It contains several important structures including the periaqueductal gray matter, the nucleus raphe, the reticular formation, and various cranial nerve nuclei. The tegmentum mesencephali plays a crucial role in various functions such as pain modulation, sleep-wake regulation, eye movement control, and cardiovascular regulation.

Molecular sequence data refers to the specific arrangement of molecules, most commonly nucleotides in DNA or RNA, or amino acids in proteins, that make up a biological macromolecule. This data is generated through laboratory techniques such as sequencing, and provides information about the exact order of the constituent molecules. This data is crucial in various fields of biology, including genetics, evolution, and molecular biology, allowing for comparisons between different organisms, identification of genetic variations, and studies of gene function and regulation.

Transgenic mice are genetically modified rodents that have incorporated foreign DNA (exogenous DNA) into their own genome. This is typically done through the use of recombinant DNA technology, where a specific gene or genetic sequence of interest is isolated and then introduced into the mouse embryo. The resulting transgenic mice can then express the protein encoded by the foreign gene, allowing researchers to study its function in a living organism.

The process of creating transgenic mice usually involves microinjecting the exogenous DNA into the pronucleus of a fertilized egg, which is then implanted into a surrogate mother. The offspring that result from this procedure are screened for the presence of the foreign DNA, and those that carry the desired genetic modification are used to establish a transgenic mouse line.

Transgenic mice have been widely used in biomedical research to model human diseases, study gene function, and test new therapies. They provide a valuable tool for understanding complex biological processes and developing new treatments for a variety of medical conditions.

Aging is a complex, progressive and inevitable process of bodily changes over time, characterized by the accumulation of cellular damage and degenerative changes that eventually lead to increased vulnerability to disease and death. It involves various biological, genetic, environmental, and lifestyle factors that contribute to the decline in physical and mental functions. The medical field studies aging through the discipline of gerontology, which aims to understand the underlying mechanisms of aging and develop interventions to promote healthy aging and extend the human healthspan.

A traumatic brain stem hemorrhage is a type of bleeding that occurs in the brainstem as a result of trauma or injury to the head. The brainstem is a critical region of the brain that controls essential functions such as breathing, heart rate, and consciousness. A hemorrhage in this area can cause severe neurological deficits and may be life-threatening.

Traumatic brain stem hemorrhages are typically caused by high-impact trauma, such as motor vehicle accidents or falls from significant heights. The force of the impact can cause the blood vessels in the brainstem to rupture, leading to bleeding in the surrounding tissue. In some cases, the bleeding may be severe enough to compress nearby structures and cause further damage to the brain.

Symptoms of a traumatic brain stem hemorrhage may include altered level of consciousness, difficulty breathing, irregular heart rate, weakness or paralysis on one side of the body, and impaired speech or swallowing. Immediate medical attention is required to prevent further neurological damage and reduce the risk of long-term disability or death. Treatment typically involves surgical intervention to relieve pressure on the brainstem and stop the bleeding, followed by rehabilitation to help the patient recover from any resulting neurological deficits.

Afferent pathways, also known as sensory pathways, refer to the neural connections that transmit sensory information from the peripheral nervous system to the central nervous system (CNS), specifically to the brain and spinal cord. These pathways are responsible for carrying various types of sensory information, such as touch, temperature, pain, pressure, vibration, hearing, vision, and taste, to the CNS for processing and interpretation.

The afferent pathways begin with sensory receptors located throughout the body, which detect changes in the environment and convert them into electrical signals. These signals are then transmitted via afferent neurons, also known as sensory neurons, to the spinal cord or brainstem. Within the CNS, the information is further processed and integrated with other neural inputs before being relayed to higher cognitive centers for conscious awareness and response.

Understanding the anatomy and physiology of afferent pathways is essential for diagnosing and treating various neurological conditions that affect sensory function, such as neuropathies, spinal cord injuries, and brain disorders.

The spinal trigeminal nucleus is a component of the trigeminal nerve sensory nuclear complex located in the brainstem. It is responsible for receiving and processing pain, temperature, and tactile discrimination sensations from the face and head, particularly from the areas of the face that are more sensitive to pain and temperature (the forehead, eyes, nose, and mouth). The spinal trigeminal nucleus is divided into three subnuclei: pars oralis, pars interpolaris, and pars caudalis. These subnuclei extend from the pons to the upper part of the medulla oblongata.

Reaction time, in the context of medicine and physiology, refers to the time period between the presentation of a stimulus and the subsequent initiation of a response. This complex process involves the central nervous system, particularly the brain, which perceives the stimulus, processes it, and then sends signals to the appropriate muscles or glands to react.

There are different types of reaction times, including simple reaction time (responding to a single, expected stimulus) and choice reaction time (choosing an appropriate response from multiple possibilities). These measures can be used in clinical settings to assess various aspects of neurological function, such as cognitive processing speed, motor control, and alertness.

However, it is important to note that reaction times can be influenced by several factors, including age, fatigue, attention, and the use of certain medications or substances.

Signal transduction is the process by which a cell converts an extracellular signal, such as a hormone or neurotransmitter, into an intracellular response. This involves a series of molecular events that transmit the signal from the cell surface to the interior of the cell, ultimately resulting in changes in gene expression, protein activity, or metabolism.

The process typically begins with the binding of the extracellular signal to a receptor located on the cell membrane. This binding event activates the receptor, which then triggers a cascade of intracellular signaling molecules, such as second messengers, protein kinases, and ion channels. These molecules amplify and propagate the signal, ultimately leading to the activation or inhibition of specific cellular responses.

Signal transduction pathways are highly regulated and can be modulated by various factors, including other signaling molecules, post-translational modifications, and feedback mechanisms. Dysregulation of these pathways has been implicated in a variety of diseases, including cancer, diabetes, and neurological disorders.

Neurological models are simplified representations or simulations of various aspects of the nervous system, including its structure, function, and processes. These models can be theoretical, computational, or physical and are used to understand, explain, and predict neurological phenomena. They may focus on specific neurological diseases, disorders, or functions, such as memory, learning, or movement. The goal of these models is to provide insights into the complex workings of the nervous system that cannot be easily observed or understood through direct examination alone.

Auditory evoked potentials (AEP) are medical tests that measure the electrical activity in the brain in response to sound stimuli. These tests are often used to assess hearing function and neural processing in individuals, particularly those who cannot perform traditional behavioral hearing tests.

There are several types of AEP tests, including:

1. Brainstem Auditory Evoked Response (BAER) or Brainstem Auditory Evoked Potentials (BAEP): This test measures the electrical activity generated by the brainstem in response to a click or tone stimulus. It is often used to assess the integrity of the auditory nerve and brainstem pathways, and can help diagnose conditions such as auditory neuropathy and retrocochlear lesions.
2. Middle Latency Auditory Evoked Potentials (MLAEP): This test measures the electrical activity generated by the cortical auditory areas of the brain in response to a click or tone stimulus. It is often used to assess higher-level auditory processing, and can help diagnose conditions such as auditory processing disorders and central auditory dysfunction.
3. Long Latency Auditory Evoked Potentials (LLAEP): This test measures the electrical activity generated by the cortical auditory areas of the brain in response to a complex stimulus, such as speech. It is often used to assess language processing and cognitive function, and can help diagnose conditions such as learning disabilities and dementia.

Overall, AEP tests are valuable tools for assessing hearing and neural function in individuals who cannot perform traditional behavioral hearing tests or who have complex neurological conditions.

A nerve net, also known as a neural net or neuronal network, is not a medical term per se, but rather a concept in neuroscience and artificial intelligence (AI). It refers to a complex network of interconnected neurons that process and transmit information. In the context of the human body, the nervous system can be thought of as a type of nerve net, with the brain and spinal cord serving as the central processing unit and peripheral nerves carrying signals to and from various parts of the body.

In the field of AI, artificial neural networks are computational models inspired by the structure and function of biological nerve nets. These models consist of interconnected nodes or "neurons" that process information and learn patterns through a process of training and adaptation. They have been used in a variety of applications, including image recognition, natural language processing, and machine learning.

The thalamus is a large, paired structure in the brain that serves as a relay station for sensory and motor signals to the cerebral cortex. It is located in the dorsal part of the diencephalon and is made up of two symmetrical halves, each connected to the corresponding cerebral hemisphere.

The thalamus receives inputs from almost all senses, except for the olfactory system, and processes them before sending them to specific areas in the cortex. It also plays a role in regulating consciousness, sleep, and alertness. Additionally, the thalamus is involved in motor control by relaying information between the cerebellum and the motor cortex.

The thalamus is divided into several nuclei, each with distinct connections and functions. Some of these nuclei are involved in sensory processing, while others are involved in motor function or regulation of emotions and cognition. Overall, the thalamus plays a critical role in integrating information from various brain regions and modulating cognitive and emotional processes.

A human body is a complex structure made up of many different types of cells, tissues, and organs that work together to maintain life. It is composed of head, neck, trunk, arms and legs. The human body is divided into several organ systems that perform specific functions necessary for survival. These include the cardiovascular system (heart and blood vessels), respiratory system (lungs and airways), digestive system (stomach, intestines, liver, pancreas), nervous system (brain, spinal cord, nerves), endocrine system (glands and hormones), musculoskeletal system (bones, muscles, joints), immune system (white blood cells, lymphatic system) and reproductive system. Each of these systems is made up of specialized cells and tissues that work together to perform specific functions that are essential for the overall health and well-being of the individual.

Functional laterality, in a medical context, refers to the preferential use or performance of one side of the body over the other for specific functions. This is often demonstrated in hand dominance, where an individual may be right-handed or left-handed, meaning they primarily use their right or left hand for tasks such as writing, eating, or throwing.

However, functional laterality can also apply to other bodily functions and structures, including the eyes (ocular dominance), ears (auditory dominance), or legs. It's important to note that functional laterality is not a strict binary concept; some individuals may exhibit mixed dominance or no strong preference for one side over the other.

In clinical settings, assessing functional laterality can be useful in diagnosing and treating various neurological conditions, such as stroke or traumatic brain injury, where understanding any resulting lateralized impairments can inform rehabilitation strategies.

Cell differentiation is the process by which a less specialized cell, or stem cell, becomes a more specialized cell type with specific functions and structures. This process involves changes in gene expression, which are regulated by various intracellular signaling pathways and transcription factors. Differentiation results in the development of distinct cell types that make up tissues and organs in multicellular organisms. It is a crucial aspect of embryonic development, tissue repair, and maintenance of homeostasis in the body.

Astrocytes are a type of star-shaped glial cell found in the central nervous system (CNS), including the brain and spinal cord. They play crucial roles in supporting and maintaining the health and function of neurons, which are the primary cells responsible for transmitting information in the CNS.

Some of the essential functions of astrocytes include:

1. Supporting neuronal structure and function: Astrocytes provide structural support to neurons by ensheathing them and maintaining the integrity of the blood-brain barrier, which helps regulate the entry and exit of substances into the CNS.
2. Regulating neurotransmitter levels: Astrocytes help control the levels of neurotransmitters in the synaptic cleft (the space between two neurons) by taking up excess neurotransmitters and breaking them down, thus preventing excessive or prolonged activation of neuronal receptors.
3. Providing nutrients to neurons: Astrocytes help supply energy metabolites, such as lactate, to neurons, which are essential for their survival and function.
4. Modulating synaptic activity: Through the release of various signaling molecules, astrocytes can modulate synaptic strength and plasticity, contributing to learning and memory processes.
5. Participating in immune responses: Astrocytes can respond to CNS injuries or infections by releasing pro-inflammatory cytokines and chemokines, which help recruit immune cells to the site of injury or infection.
6. Promoting neuronal survival and repair: In response to injury or disease, astrocytes can become reactive and undergo morphological changes that aid in forming a glial scar, which helps contain damage and promote tissue repair. Additionally, they release growth factors and other molecules that support the survival and regeneration of injured neurons.

Dysfunction or damage to astrocytes has been implicated in several neurological disorders, including Alzheimer's disease, Parkinson's disease, amyotrophic lateral sclerosis (ALS), and multiple sclerosis (MS).

Deep brain stimulation (DBS) is a surgical procedure that involves the implantation of a medical device called a neurostimulator, which sends electrical impulses to specific targets in the brain. The impulses help to regulate abnormal brain activity, and can be used to treat a variety of neurological conditions, including Parkinson's disease, essential tremor, dystonia, and obsessive-compulsive disorder.

During the procedure, electrodes are implanted into the brain and connected to the neurostimulator, which is typically implanted in the chest. The neurostimulator can be programmed to deliver electrical impulses at varying frequencies, amplitudes, and pulse widths, depending on the specific needs of the patient.

DBS is generally considered a safe and effective treatment option for many patients with neurological conditions, although it does carry some risks, such as infection, bleeding, and hardware complications. It is typically reserved for patients who have not responded well to other forms of treatment, or who experience significant side effects from medication.

Serotonin, also known as 5-hydroxytryptamine (5-HT), is a monoamine neurotransmitter that is found primarily in the gastrointestinal (GI) tract, blood platelets, and the central nervous system (CNS) of humans and other animals. It is produced by the conversion of the amino acid tryptophan to 5-hydroxytryptophan (5-HTP), and then to serotonin.

In the CNS, serotonin plays a role in regulating mood, appetite, sleep, memory, learning, and behavior, among other functions. It also acts as a vasoconstrictor, helping to regulate blood flow and blood pressure. In the GI tract, it is involved in peristalsis, the contraction and relaxation of muscles that moves food through the digestive system.

Serotonin is synthesized and stored in serotonergic neurons, which are nerve cells that use serotonin as their primary neurotransmitter. These neurons are found throughout the brain and spinal cord, and they communicate with other neurons by releasing serotonin into the synapse, the small gap between two neurons.

Abnormal levels of serotonin have been linked to a variety of disorders, including depression, anxiety, schizophrenia, and migraines. Medications that affect serotonin levels, such as selective serotonin reuptake inhibitors (SSRIs), are commonly used to treat these conditions.

A glioma is a type of tumor that originates from the glial cells in the brain. Glial cells are non-neuronal cells that provide support and protection for nerve cells (neurons) within the central nervous system, including providing nutrients, maintaining homeostasis, and insulating neurons.

Gliomas can be classified into several types based on the specific type of glial cell from which they originate. The most common types include:

1. Astrocytoma: Arises from astrocytes, a type of star-shaped glial cells that provide structural support to neurons.
2. Oligodendroglioma: Develops from oligodendrocytes, which produce the myelin sheath that insulates nerve fibers.
3. Ependymoma: Originate from ependymal cells, which line the ventricles (fluid-filled spaces) in the brain and spinal cord.
4. Glioblastoma multiforme (GBM): A highly aggressive and malignant type of astrocytoma that tends to spread quickly within the brain.

Gliomas can be further classified based on their grade, which indicates how aggressive and fast-growing they are. Lower-grade gliomas tend to grow more slowly and may be less aggressive, while higher-grade gliomas are more likely to be aggressive and rapidly growing.

Symptoms of gliomas depend on the location and size of the tumor but can include headaches, seizures, cognitive changes, and neurological deficits such as weakness or paralysis in certain parts of the body. Treatment options for gliomas may include surgery, radiation therapy, chemotherapy, or a combination of these approaches.

"Inbred strains of rats" are genetically identical rodents that have been produced through many generations of brother-sister mating. This results in a high degree of homozygosity, where the genes at any particular locus in the genome are identical in all members of the strain.

Inbred strains of rats are widely used in biomedical research because they provide a consistent and reproducible genetic background for studying various biological phenomena, including the effects of drugs, environmental factors, and genetic mutations on health and disease. Additionally, inbred strains can be used to create genetically modified models of human diseases by introducing specific mutations into their genomes.

Some commonly used inbred strains of rats include the Wistar Kyoto (WKY), Sprague-Dawley (SD), and Fischer 344 (F344) rat strains. Each strain has its own unique genetic characteristics, making them suitable for different types of research.

The term "cisterna magna" is derived from Latin, where "cisterna" means "reservoir" or "receptacle," and "magna" means "large." In medical anatomy, the cisterna magna refers to a large, sac-like space located near the lower part of the brainstem. It is a subarachnoid cistern, which means it is a space that contains cerebrospinal fluid (CSF) between the arachnoid and pia mater membranes covering the brain and spinal cord.

More specifically, the cisterna magna is situated between the cerebellum (the lower part of the brain responsible for coordinating muscle movements and maintaining balance) and the occipital bone (the bone at the back of the skull). This space contains a significant amount of CSF, which serves as a protective cushion for the brain and spinal cord, helps regulate intracranial pressure, and facilitates the circulation of nutrients and waste products.

The cisterna magna is an essential structure in neurosurgical procedures and diagnostic imaging techniques like lumbar puncture (spinal tap) or myelograms, where contrast agents are introduced into the CSF to visualize the spinal cord and surrounding structures. Additionally, it serves as a crucial landmark for various surgical approaches to the posterior fossa (the lower part of the skull that houses the cerebellum and brainstem).

Organ specificity, in the context of immunology and toxicology, refers to the phenomenon where a substance (such as a drug or toxin) or an immune response primarily affects certain organs or tissues in the body. This can occur due to various reasons such as:

1. The presence of specific targets (like antigens in the case of an immune response or receptors in the case of drugs) that are more abundant in these organs.
2. The unique properties of certain cells or tissues that make them more susceptible to damage.
3. The way a substance is metabolized or cleared from the body, which can concentrate it in specific organs.

For example, in autoimmune diseases, organ specificity describes immune responses that are directed against antigens found only in certain organs, such as the thyroid gland in Hashimoto's disease. Similarly, some toxins or drugs may have a particular affinity for liver cells, leading to liver damage or specific drug interactions.

Atrophy is a medical term that refers to the decrease in size and wasting of an organ or tissue due to the disappearance of cells, shrinkage of cells, or decreased number of cells. This process can be caused by various factors such as disuse, aging, degeneration, injury, or disease.

For example, if a muscle is immobilized for an extended period, it may undergo atrophy due to lack of use. Similarly, certain medical conditions like diabetes, cancer, and heart failure can lead to the wasting away of various tissues and organs in the body.

Atrophy can also occur as a result of natural aging processes, leading to decreased muscle mass and strength in older adults. In general, atrophy is characterized by a decrease in the volume or weight of an organ or tissue, which can have significant impacts on its function and overall health.

Hematopoietic Stem Cell Mobilization is the process of mobilizing hematopoietic stem cells (HSCs) from the bone marrow into the peripheral blood. HSCs are immature cells that have the ability to differentiate into all types of blood cells, including red and white blood cells and platelets.

Mobilization is often achieved through the use of medications such as granulocyte-colony stimulating factor (G-CSF) or plerixafor, which stimulate the release of HSCs from the bone marrow into the peripheral blood. This allows for the collection of HSCs from the peripheral blood through a procedure called apheresis.

Mobilized HSCs can be used in stem cell transplantation procedures to reconstitute a patient's hematopoietic system after high-dose chemotherapy or radiation therapy. It is an important process in the field of regenerative medicine and has been used to treat various diseases such as leukemia, lymphoma, and sickle cell disease.

Encephalitis is defined as inflammation of the brain parenchyma, which is often caused by viral infections but can also be due to bacterial, fungal, or parasitic infections, autoimmune disorders, or exposure to toxins. The infection or inflammation can cause various symptoms such as headache, fever, confusion, seizures, and altered consciousness, ranging from mild symptoms to severe cases that can lead to brain damage, long-term disabilities, or even death.

The diagnosis of encephalitis typically involves a combination of clinical evaluation, imaging studies (such as MRI or CT scans), and laboratory tests (such as cerebrospinal fluid analysis). Treatment may include antiviral medications, corticosteroids, immunoglobulins, and supportive care to manage symptoms and prevent complications.

The abducens nerve, also known as the sixth cranial nerve (CN VI), is a motor nerve that controls the lateral rectus muscle of the eye. This muscle is responsible for moving the eye away from the midline (towards the temple) and enables the eyes to look towards the side while keeping them aligned. Any damage or dysfunction of the abducens nerve can result in strabismus, where the eyes are misaligned and point in different directions, specifically an adduction deficit, also known as abducens palsy or sixth nerve palsy.

Cerebellar diseases refer to a group of medical conditions that affect the cerebellum, which is the part of the brain located at the back of the head, below the occipital lobe and above the brainstem. The cerebellum plays a crucial role in motor control, coordination, balance, and some cognitive functions.

Cerebellar diseases can be caused by various factors, including genetics, infections, tumors, stroke, trauma, or degenerative processes. These conditions can result in a wide range of symptoms, such as:

1. Ataxia: Loss of coordination and unsteady gait
2. Dysmetria: Inability to judge distance and force while performing movements
3. Intention tremors: Shaking or trembling that worsens during purposeful movements
4. Nystagmus: Rapid, involuntary eye movement
5. Dysarthria: Speech difficulty due to muscle weakness or incoordination
6. Hypotonia: Decreased muscle tone
7. Titubation: Rhythmic, involuntary oscillations of the head and neck
8. Cognitive impairment: Problems with memory, attention, and executive functions

Some examples of cerebellar diseases include:

1. Ataxia-telangiectasia
2. Friedrich's ataxia
3. Multiple system atrophy (MSA)
4. Spinocerebellar ataxias (SCAs)
5. Cerebellar tumors, such as medulloblastomas or astrocytomas
6. Infarctions or hemorrhages in the cerebellum due to stroke or trauma
7. Infections, such as viral encephalitis or bacterial meningitis
8. Autoimmune disorders, like multiple sclerosis (MS) or paraneoplastic syndromes
9. Metabolic disorders, such as Wilson's disease or phenylketonuria (PKU)
10. Chronic alcoholism and withdrawal

Treatment for cerebellar diseases depends on the underlying cause and may involve medications, physical therapy, surgery, or supportive care to manage symptoms and improve quality of life.

Auditory pathways refer to the series of structures and nerves in the body that are involved in processing sound and transmitting it to the brain for interpretation. The process begins when sound waves enter the ear and cause vibrations in the eardrum, which then move the bones in the middle ear. These movements stimulate hair cells in the cochlea, a spiral-shaped structure in the inner ear, causing them to release neurotransmitters that activate auditory nerve fibers.

The auditory nerve carries these signals to the brainstem, where they are relayed through several additional structures before reaching the auditory cortex in the temporal lobe of the brain. Here, the signals are processed and interpreted as sounds, allowing us to hear and understand speech, music, and other environmental noises.

Damage or dysfunction at any point along the auditory pathway can lead to hearing loss or impairment.

Electroencephalography (EEG) is a medical procedure that records electrical activity in the brain. It uses small, metal discs called electrodes, which are attached to the scalp with paste or a specialized cap. These electrodes detect tiny electrical charges that result from the activity of brain cells, and the EEG machine then amplifies and records these signals.

EEG is used to diagnose various conditions related to the brain, such as seizures, sleep disorders, head injuries, infections, and degenerative diseases like Alzheimer's or Parkinson's. It can also be used during surgery to monitor brain activity and ensure that surgical procedures do not interfere with vital functions.

EEG is a safe and non-invasive procedure that typically takes about 30 minutes to an hour to complete, although longer recordings may be necessary in some cases. Patients are usually asked to relax and remain still during the test, as movement can affect the quality of the recording.

A dose-response relationship in the context of drugs refers to the changes in the effects or symptoms that occur as the dose of a drug is increased or decreased. Generally, as the dose of a drug is increased, the severity or intensity of its effects also increases. Conversely, as the dose is decreased, the effects of the drug become less severe or may disappear altogether.

The dose-response relationship is an important concept in pharmacology and toxicology because it helps to establish the safe and effective dosage range for a drug. By understanding how changes in the dose of a drug affect its therapeutic and adverse effects, healthcare providers can optimize treatment plans for their patients while minimizing the risk of harm.

The dose-response relationship is typically depicted as a curve that shows the relationship between the dose of a drug and its effect. The shape of the curve may vary depending on the drug and the specific effect being measured. Some drugs may have a steep dose-response curve, meaning that small changes in the dose can result in large differences in the effect. Other drugs may have a more gradual dose-response curve, where larger changes in the dose are needed to produce significant effects.

In addition to helping establish safe and effective dosages, the dose-response relationship is also used to evaluate the potential therapeutic benefits and risks of new drugs during clinical trials. By systematically testing different doses of a drug in controlled studies, researchers can identify the optimal dosage range for the drug and assess its safety and efficacy.

The trigeminal nerve, also known as the fifth cranial nerve or CNV, is a paired nerve that carries both sensory and motor information. It has three major branches: ophthalmic (V1), maxillary (V2), and mandibular (V3). The ophthalmic branch provides sensation to the forehead, eyes, and upper portion of the nose; the maxillary branch supplies sensation to the lower eyelid, cheek, nasal cavity, and upper lip; and the mandibular branch is responsible for sensation in the lower lip, chin, and parts of the oral cavity, as well as motor function to the muscles involved in chewing. The trigeminal nerve plays a crucial role in sensations of touch, pain, temperature, and pressure in the face and mouth, and it also contributes to biting, chewing, and swallowing functions.

A "knockout" mouse is a genetically engineered mouse in which one or more genes have been deleted or "knocked out" using molecular biology techniques. This allows researchers to study the function of specific genes and their role in various biological processes, as well as potential associations with human diseases. The mice are generated by introducing targeted DNA modifications into embryonic stem cells, which are then used to create a live animal. Knockout mice have been widely used in biomedical research to investigate gene function, disease mechanisms, and potential therapeutic targets.

Synaptic transmission is the process by which a neuron communicates with another cell, such as another neuron or a muscle cell, across a junction called a synapse. It involves the release of neurotransmitters from the presynaptic terminal of the neuron, which then cross the synaptic cleft and bind to receptors on the postsynaptic cell, leading to changes in the electrical or chemical properties of the target cell. This process is critical for the transmission of signals within the nervous system and for controlling various physiological functions in the body.

'Animal behavior' refers to the actions or responses of animals to various stimuli, including their interactions with the environment and other individuals. It is the study of the actions of animals, whether they are instinctual, learned, or a combination of both. Animal behavior includes communication, mating, foraging, predator avoidance, and social organization, among other things. The scientific study of animal behavior is called ethology. This field seeks to understand the evolutionary basis for behaviors as well as their physiological and psychological mechanisms.

'Gene expression regulation' refers to the processes that control whether, when, and where a particular gene is expressed, meaning the production of a specific protein or functional RNA encoded by that gene. This complex mechanism can be influenced by various factors such as transcription factors, chromatin remodeling, DNA methylation, non-coding RNAs, and post-transcriptional modifications, among others. Proper regulation of gene expression is crucial for normal cellular function, development, and maintaining homeostasis in living organisms. Dysregulation of gene expression can lead to various diseases, including cancer and genetic disorders.

Motor neurons are specialized nerve cells in the brain and spinal cord that play a crucial role in controlling voluntary muscle movements. They transmit electrical signals from the brain to the muscles, enabling us to perform actions such as walking, talking, and swallowing. There are two types of motor neurons: upper motor neurons, which originate in the brain's motor cortex and travel down to the brainstem and spinal cord; and lower motor neurons, which extend from the brainstem and spinal cord to the muscles. Damage or degeneration of these motor neurons can lead to various neurological disorders, such as amyotrophic lateral sclerosis (ALS) and spinal muscular atrophy (SMA).

Electrophysiology is a branch of medicine that deals with the electrical activities of the body, particularly the heart. In a medical context, electrophysiology studies (EPS) are performed to assess abnormal heart rhythms (arrhythmias) and to evaluate the effectiveness of certain treatments, such as medication or pacemakers.

During an EPS, electrode catheters are inserted into the heart through blood vessels in the groin or neck. These catheters can record the electrical activity of the heart and stimulate it to help identify the source of the arrhythmia. The information gathered during the study can help doctors determine the best course of treatment for each patient.

In addition to cardiac electrophysiology, there are also other subspecialties within electrophysiology, such as neuromuscular electrophysiology, which deals with the electrical activity of the nervous system and muscles.

Analysis of Variance (ANOVA) is a statistical technique used to compare the means of two or more groups and determine whether there are any significant differences between them. It is a way to analyze the variance in a dataset to determine whether the variability between groups is greater than the variability within groups, which can indicate that the groups are significantly different from one another.

ANOVA is based on the concept of partitioning the total variance in a dataset into two components: variance due to differences between group means (also known as "between-group variance") and variance due to differences within each group (also known as "within-group variance"). By comparing these two sources of variance, ANOVA can help researchers determine whether any observed differences between groups are statistically significant, or whether they could have occurred by chance.

ANOVA is a widely used technique in many areas of research, including biology, psychology, engineering, and business. It is often used to compare the means of two or more experimental groups, such as a treatment group and a control group, to determine whether the treatment had a significant effect. ANOVA can also be used to compare the means of different populations or subgroups within a population, to identify any differences that may exist between them.

Gene expression is the process by which the information encoded in a gene is used to synthesize a functional gene product, such as a protein or RNA molecule. This process involves several steps: transcription, RNA processing, and translation. During transcription, the genetic information in DNA is copied into a complementary RNA molecule, known as messenger RNA (mRNA). The mRNA then undergoes RNA processing, which includes adding a cap and tail to the mRNA and splicing out non-coding regions called introns. The resulting mature mRNA is then translated into a protein on ribosomes in the cytoplasm through the process of translation.

The regulation of gene expression is a complex and highly controlled process that allows cells to respond to changes in their environment, such as growth factors, hormones, and stress signals. This regulation can occur at various stages of gene expression, including transcriptional activation or repression, RNA processing, mRNA stability, and translation. Dysregulation of gene expression has been implicated in many diseases, including cancer, genetic disorders, and neurological conditions.

Cranial nerves are a set of twelve pairs of nerves that originate from the brainstem and skull, rather than the spinal cord. These nerves are responsible for transmitting sensory information (such as sight, smell, hearing, and taste) to the brain, as well as controlling various muscles in the head and neck (including those involved in chewing, swallowing, and eye movement). Each cranial nerve has a specific function and is named accordingly. For example, the optic nerve (cranial nerve II) transmits visual information from the eyes to the brain, while the vagus nerve (cranial nerve X) controls parasympathetic functions in the body such as heart rate and digestion.

Brain diseases, also known as neurological disorders, refer to a wide range of conditions that affect the brain and nervous system. These diseases can be caused by various factors such as genetics, infections, injuries, degeneration, or structural abnormalities. They can affect different parts of the brain, leading to a variety of symptoms and complications.

Some examples of brain diseases include:

1. Alzheimer's disease - a progressive degenerative disorder that affects memory and cognitive function.
2. Parkinson's disease - a movement disorder characterized by tremors, stiffness, and difficulty with coordination and balance.
3. Multiple sclerosis - a chronic autoimmune disease that affects the nervous system and can cause a range of symptoms such as vision loss, muscle weakness, and cognitive impairment.
4. Epilepsy - a neurological disorder characterized by recurrent seizures.
5. Brain tumors - abnormal growths in the brain that can be benign or malignant.
6. Stroke - a sudden interruption of blood flow to the brain, which can cause paralysis, speech difficulties, and other neurological symptoms.
7. Meningitis - an infection of the membranes surrounding the brain and spinal cord.
8. Encephalitis - an inflammation of the brain that can be caused by viruses, bacteria, or autoimmune disorders.
9. Huntington's disease - a genetic disorder that affects muscle coordination, cognitive function, and mental health.
10. Migraine - a neurological condition characterized by severe headaches, often accompanied by nausea, vomiting, and sensitivity to light and sound.

Brain diseases can range from mild to severe and may be treatable or incurable. They can affect people of all ages and backgrounds, and early diagnosis and treatment are essential for improving outcomes and quality of life.

A base sequence in the context of molecular biology refers to the specific order of nucleotides in a DNA or RNA molecule. In DNA, these nucleotides are adenine (A), guanine (G), cytosine (C), and thymine (T). In RNA, uracil (U) takes the place of thymine. The base sequence contains genetic information that is transcribed into RNA and ultimately translated into proteins. It is the exact order of these bases that determines the genetic code and thus the function of the DNA or RNA molecule.

Developmental gene expression regulation refers to the processes that control the activation or repression of specific genes during embryonic and fetal development. These regulatory mechanisms ensure that genes are expressed at the right time, in the right cells, and at appropriate levels to guide proper growth, differentiation, and morphogenesis of an organism.

Developmental gene expression regulation is a complex and dynamic process involving various molecular players, such as transcription factors, chromatin modifiers, non-coding RNAs, and signaling molecules. These regulators can interact with cis-regulatory elements, like enhancers and promoters, to fine-tune the spatiotemporal patterns of gene expression during development.

Dysregulation of developmental gene expression can lead to various congenital disorders and developmental abnormalities. Therefore, understanding the principles and mechanisms governing developmental gene expression regulation is crucial for uncovering the etiology of developmental diseases and devising potential therapeutic strategies.

Microinjection is a medical technique that involves the use of a fine, precise needle to inject small amounts of liquid or chemicals into microscopic structures, cells, or tissues. This procedure is often used in research settings to introduce specific substances into individual cells for study purposes, such as introducing DNA or RNA into cell nuclei to manipulate gene expression.

In clinical settings, microinjections may be used in various medical and cosmetic procedures, including:

1. Intracytoplasmic Sperm Injection (ICSI): A type of assisted reproductive technology where a single sperm is injected directly into an egg to increase the chances of fertilization during in vitro fertilization (IVF) treatments.
2. Botulinum Toxin Injections: Microinjections of botulinum toxin (Botox, Dysport, or Xeomin) are used for cosmetic purposes to reduce wrinkles and fine lines by temporarily paralyzing the muscles responsible for their formation. They can also be used medically to treat various neuromuscular disorders, such as migraines, muscle spasticity, and excessive sweating (hyperhidrosis).
3. Drug Delivery: Microinjections may be used to deliver drugs directly into specific tissues or organs, bypassing the systemic circulation and potentially reducing side effects. This technique can be particularly useful in treating localized pain, delivering growth factors for tissue regeneration, or administering chemotherapy agents directly into tumors.
4. Gene Therapy: Microinjections of genetic material (DNA or RNA) can be used to introduce therapeutic genes into cells to treat various genetic disorders or diseases, such as cystic fibrosis, hemophilia, or cancer.

Overall, microinjection is a highly specialized and precise technique that allows for the targeted delivery of substances into small structures, cells, or tissues, with potential applications in research, medical diagnostics, and therapeutic interventions.

An action potential is a brief electrical signal that travels along the membrane of a nerve cell (neuron) or muscle cell. It is initiated by a rapid, localized change in the permeability of the cell membrane to specific ions, such as sodium and potassium, resulting in a rapid influx of sodium ions and a subsequent efflux of potassium ions. This ion movement causes a brief reversal of the electrical potential across the membrane, which is known as depolarization. The action potential then propagates along the cell membrane as a wave, allowing the electrical signal to be transmitted over long distances within the body. Action potentials play a crucial role in the communication and functioning of the nervous system and muscle tissue.

Acute disseminated encephalomyelitis (ADEM) is a rare inflammatory demyelinating disease of the central nervous system, characterized by a sudden onset of widespread inflammation and damage to the brain and spinal cord. It typically follows a viral infection or, less commonly, vaccination and is more prevalent in children than adults.

The condition involves the rapid development of multiple inflammatory lesions throughout the white matter of the brain and spinal cord. These lesions lead to demyelination, which means the loss of the protective myelin sheath surrounding nerve fibers, disrupting communication between neurons. This results in various neurological symptoms such as:

1. Encephalopathy (changes in consciousness, behavior, or mental status)
2. Weakness or paralysis of limbs
3. Visual disturbances
4. Speech and language problems
5. Seizures
6. Ataxia (loss of coordination and balance)
7. Sensory changes
8. Autonomic nervous system dysfunction (e.g., temperature regulation, blood pressure, heart rate)

The diagnosis of ADEM is based on clinical presentation, radiological findings, and laboratory tests to exclude other possible causes. Magnetic resonance imaging (MRI) typically shows multiple, large, bilateral lesions in the white matter of the brain and spinal cord. Cerebrospinal fluid analysis may reveal an elevated white blood cell count and increased protein levels.

Treatment for ADEM generally includes high-dose corticosteroids to reduce inflammation and improve outcomes. Intravenous immunoglobulin (IVIG) or plasma exchange (plasmapheresis) may be used if there is no response to steroid therapy. Most patients with ADEM recover completely or have significant improvement within several months, although some may experience residual neurological deficits.

I'm sorry for any confusion, but "lampreys" is not a medical term. It refers to a type of jawless aquatic vertebrate that are eel-like in appearance. They are parasitic creatures, with a suction cup-like mouth and circular rows of teeth, which they use to attach to fish and suck their body fluids. If you have any questions about medical terminology or concepts, I'd be happy to help with those!

Neuroglia, also known as glial cells or simply glia, are non-neuronal cells that provide support and protection for neurons in the nervous system. They maintain homeostasis, form myelin sheaths around nerve fibers, and provide structural support. They also play a role in the immune response of the central nervous system. Some types of neuroglia include astrocytes, oligodendrocytes, microglia, and ependymal cells.

Biological models, also known as physiological models or organismal models, are simplified representations of biological systems, processes, or mechanisms that are used to understand and explain the underlying principles and relationships. These models can be theoretical (conceptual or mathematical) or physical (such as anatomical models, cell cultures, or animal models). They are widely used in biomedical research to study various phenomena, including disease pathophysiology, drug action, and therapeutic interventions.

Examples of biological models include:

1. Mathematical models: These use mathematical equations and formulas to describe complex biological systems or processes, such as population dynamics, metabolic pathways, or gene regulation networks. They can help predict the behavior of these systems under different conditions and test hypotheses about their underlying mechanisms.
2. Cell cultures: These are collections of cells grown in a controlled environment, typically in a laboratory dish or flask. They can be used to study cellular processes, such as signal transduction, gene expression, or metabolism, and to test the effects of drugs or other treatments on these processes.
3. Animal models: These are living organisms, usually vertebrates like mice, rats, or non-human primates, that are used to study various aspects of human biology and disease. They can provide valuable insights into the pathophysiology of diseases, the mechanisms of drug action, and the safety and efficacy of new therapies.
4. Anatomical models: These are physical representations of biological structures or systems, such as plastic models of organs or tissues, that can be used for educational purposes or to plan surgical procedures. They can also serve as a basis for developing more sophisticated models, such as computer simulations or 3D-printed replicas.

Overall, biological models play a crucial role in advancing our understanding of biology and medicine, helping to identify new targets for therapeutic intervention, develop novel drugs and treatments, and improve human health.

Audiometry, evoked response is a hearing test that measures the brain's response to sound. It is often used to detect hearing loss in infants and young children, as well as in people who are unable to cooperate or communicate during traditional hearing tests.

During the test, electrodes are placed on the scalp to measure the electrical activity produced by the brain in response to sounds presented through earphones. The responses are recorded and analyzed to determine the quietest sounds that can be heard at different frequencies. This information is used to help diagnose and manage hearing disorders.

There are several types of evoked response audiometry, including:

* Auditory Brainstem Response (ABR): measures the electrical activity from the brainstem in response to sound.
* Auditory Steady-State Response (ASSR): measures the brain's response to continuous sounds at different frequencies and loudness levels.
* Auditory Middle Latency Response (AMLR): measures the electrical activity from the auditory cortex in response to sound.

These tests are usually performed in a quiet, sound-treated room and can take several hours to complete.

The olivary nucleus is a structure located in the medulla oblongata, which is a part of the brainstem. It consists of two main parts: the inferior olive and the accessory olive. The inferior olive is further divided into several subnuclei.

The olivary nucleus plays an important role in the coordination of movements, particularly in the regulation of fine motor control and rhythmic movements. It receives input from various sources, including the cerebellum, spinal cord, and other brainstem nuclei, and sends output to the cerebellum via the climbing fibers.

Damage to the olivary nucleus can result in a variety of neurological symptoms, including ataxia (loss of coordination), tremors, and dysarthria (speech difficulties). Certain neurodegenerative disorders, such as multiple system atrophy, may also affect the olivary nucleus and contribute to its degeneration.

Cerebral infarction, also known as a "stroke" or "brain attack," is the sudden death of brain cells caused by the interruption of their blood supply. It is most commonly caused by a blockage in one of the blood vessels supplying the brain (an ischemic stroke), but can also result from a hemorrhage in or around the brain (a hemorrhagic stroke).

Ischemic strokes occur when a blood clot or other particle blocks a cerebral artery, cutting off blood flow to a part of the brain. The lack of oxygen and nutrients causes nearby brain cells to die. Hemorrhagic strokes occur when a weakened blood vessel ruptures, causing bleeding within or around the brain. This bleeding can put pressure on surrounding brain tissues, leading to cell death.

Symptoms of cerebral infarction depend on the location and extent of the affected brain tissue but may include sudden weakness or numbness in the face, arm, or leg; difficulty speaking or understanding speech; vision problems; loss of balance or coordination; and severe headache with no known cause. Immediate medical attention is crucial for proper diagnosis and treatment to minimize potential long-term damage or disability.

Stereotaxic techniques are minimally invasive surgical procedures used in neuroscience and neurology that allow for precise targeting and manipulation of structures within the brain. These methods use a stereotactic frame, which is attached to the skull and provides a three-dimensional coordinate system to guide the placement of instruments such as electrodes, cannulas, or radiation sources. The main goal is to reach specific brain areas with high precision and accuracy, minimizing damage to surrounding tissues. Stereotaxic techniques are widely used in research, diagnosis, and treatment of various neurological disorders, including movement disorders, pain management, epilepsy, and psychiatric conditions.

X-ray computed tomography (CT or CAT scan) is a medical imaging method that uses computer-processed combinations of many X-ray images taken from different angles to produce cross-sectional (tomographic) images (virtual "slices") of the body. These cross-sectional images can then be used to display detailed internal views of organs, bones, and soft tissues in the body.

The term "computed tomography" is used instead of "CT scan" or "CAT scan" because the machines take a series of X-ray measurements from different angles around the body and then use a computer to process these data to create detailed images of internal structures within the body.

CT scanning is a noninvasive, painless medical test that helps physicians diagnose and treat medical conditions. CT imaging provides detailed information about many types of tissue including lung, bone, soft tissue and blood vessels. CT examinations can be performed on every part of the body for a variety of reasons including diagnosis, surgical planning, and monitoring of therapeutic responses.

In computed tomography (CT), an X-ray source and detector rotate around the patient, measuring the X-ray attenuation at many different angles. A computer uses this data to construct a cross-sectional image by the process of reconstruction. This technique is called "tomography". The term "computed" refers to the use of a computer to reconstruct the images.

CT has become an important tool in medical imaging and diagnosis, allowing radiologists and other physicians to view detailed internal images of the body. It can help identify many different medical conditions including cancer, heart disease, lung nodules, liver tumors, and internal injuries from trauma. CT is also commonly used for guiding biopsies and other minimally invasive procedures.

In summary, X-ray computed tomography (CT or CAT scan) is a medical imaging technique that uses computer-processed combinations of many X-ray images taken from different angles to produce cross-sectional images of the body. It provides detailed internal views of organs, bones, and soft tissues in the body, allowing physicians to diagnose and treat medical conditions.

Bone marrow cells are the types of cells found within the bone marrow, which is the spongy tissue inside certain bones in the body. The main function of bone marrow is to produce blood cells. There are two types of bone marrow: red and yellow. Red bone marrow is where most blood cell production takes place, while yellow bone marrow serves as a fat storage site.

The three main types of bone marrow cells are:

1. Hematopoietic stem cells (HSCs): These are immature cells that can differentiate into any type of blood cell, including red blood cells, white blood cells, and platelets. They have the ability to self-renew, meaning they can divide and create more hematopoietic stem cells.
2. Red blood cell progenitors: These are immature cells that will develop into mature red blood cells, also known as erythrocytes. Red blood cells carry oxygen from the lungs to the body's tissues and carbon dioxide back to the lungs.
3. Myeloid and lymphoid white blood cell progenitors: These are immature cells that will develop into various types of white blood cells, which play a crucial role in the body's immune system by fighting infections and diseases. Myeloid progenitors give rise to granulocytes (neutrophils, eosinophils, and basophils), monocytes, and megakaryocytes (which eventually become platelets). Lymphoid progenitors differentiate into B cells, T cells, and natural killer (NK) cells.

Bone marrow cells are essential for maintaining a healthy blood cell count and immune system function. Abnormalities in bone marrow cells can lead to various medical conditions, such as anemia, leukopenia, leukocytosis, thrombocytopenia, or thrombocytosis, depending on the specific type of blood cell affected. Additionally, bone marrow cells are often used in transplantation procedures to treat patients with certain types of cancer, such as leukemia and lymphoma, or other hematologic disorders.

Oxygen is a colorless, odorless, tasteless gas that constitutes about 21% of the earth's atmosphere. It is a crucial element for human and most living organisms as it is vital for respiration. Inhaled oxygen enters the lungs and binds to hemoglobin in red blood cells, which carries it to tissues throughout the body where it is used to convert nutrients into energy and carbon dioxide, a waste product that is exhaled.

Medically, supplemental oxygen therapy may be provided to patients with conditions such as chronic obstructive pulmonary disease (COPD), pneumonia, heart failure, or other medical conditions that impair the body's ability to extract sufficient oxygen from the air. Oxygen can be administered through various devices, including nasal cannulas, face masks, and ventilators.

A neurological examination is a series of tests used to evaluate the functioning of the nervous system, including both the central nervous system (the brain and spinal cord) and peripheral nervous system (the nerves that extend from the brain and spinal cord to the rest of the body). It is typically performed by a healthcare professional such as a neurologist or a primary care physician with specialized training in neurology.

During a neurological examination, the healthcare provider will assess various aspects of neurological function, including:

1. Mental status: This involves evaluating a person's level of consciousness, orientation, memory, and cognitive abilities.
2. Cranial nerves: There are 12 cranial nerves that control functions such as vision, hearing, smell, taste, and movement of the face and neck. The healthcare provider will test each of these nerves to ensure they are functioning properly.
3. Motor function: This involves assessing muscle strength, tone, coordination, and reflexes. The healthcare provider may ask the person to perform certain movements or tasks to evaluate these functions.
4. Sensory function: The healthcare provider will test a person's ability to feel different types of sensations, such as touch, pain, temperature, vibration, and proprioception (the sense of where your body is in space).
5. Coordination and balance: The healthcare provider may assess a person's ability to perform coordinated movements, such as touching their finger to their nose or walking heel-to-toe.
6. Reflexes: The healthcare provider will test various reflexes throughout the body using a reflex hammer.

The results of a neurological examination can help healthcare providers diagnose and monitor conditions that affect the nervous system, such as stroke, multiple sclerosis, Parkinson's disease, or peripheral neuropathy.

Medical Definition of Respiration:

Respiration, in physiology, is the process by which an organism takes in oxygen and gives out carbon dioxide. It's also known as breathing. This process is essential for most forms of life because it provides the necessary oxygen for cellular respiration, where the cells convert biochemical energy from nutrients into adenosine triphosphate (ATP), and releases waste products, primarily carbon dioxide.

In humans and other mammals, respiration is a two-stage process:

1. Breathing (or external respiration): This involves the exchange of gases with the environment. Air enters the lungs through the mouth or nose, then passes through the pharynx, larynx, trachea, and bronchi, finally reaching the alveoli where the actual gas exchange occurs. Oxygen from the inhaled air diffuses into the blood, while carbon dioxide, a waste product of metabolism, diffuses from the blood into the alveoli to be exhaled.

2. Cellular respiration (or internal respiration): This is the process by which cells convert glucose and other nutrients into ATP, water, and carbon dioxide in the presence of oxygen. The carbon dioxide produced during this process then diffuses out of the cells and into the bloodstream to be exhaled during breathing.

In summary, respiration is a vital physiological function that enables organisms to obtain the necessary oxygen for cellular metabolism while eliminating waste products like carbon dioxide.

A mammalian embryo is the developing offspring of a mammal, from the time of implantation of the fertilized egg (blastocyst) in the uterus until the end of the eighth week of gestation. During this period, the embryo undergoes rapid cell division and organ differentiation to form a complex structure with all the major organs and systems in place. This stage is followed by fetal development, which continues until birth. The study of mammalian embryos is important for understanding human development, evolution, and reproductive biology.

A coma is a deep state of unconsciousness in which an individual cannot be awakened, cannot respond to stimuli, and does not exhibit any sleep-wake cycles. It is typically caused by severe brain injury, illness, or toxic exposure that impairs the function of the brainstem and cerebral cortex.

In a coma, the person may appear to be asleep, but they are not aware of their surroundings or able to communicate or respond to stimuli. Comas can last for varying lengths of time, from days to weeks or even months, and some people may emerge from a coma with varying degrees of brain function and disability.

Medical professionals use various diagnostic tools and assessments to evaluate the level of consciousness and brain function in individuals who are in a coma, including the Glasgow Coma Scale (GCS), which measures eye opening, verbal response, and motor response. Treatment for coma typically involves supportive care to maintain vital functions, manage any underlying medical conditions, and prevent further complications.

Neurogenesis is the process by which new neurons (nerve cells) are generated in the brain. It occurs throughout life in certain areas of the brain, such as the hippocampus and subventricular zone, although the rate of neurogenesis decreases with age. Neurogenesis involves the proliferation, differentiation, and integration of new neurons into existing neural circuits. This process plays a crucial role in learning, memory, and recovery from brain injury or disease.

Diffusion Magnetic Resonance Imaging (MRI) is a non-invasive medical imaging technique that uses magnetic fields and radio waves to produce detailed images of the body's internal structures, particularly the brain and nervous system. In diffusion MRI, the movement of water molecules in biological tissues is measured and analyzed to generate contrast in the images based on the microstructural properties of the tissue.

Diffusion MRI is unique because it allows for the measurement of water diffusion in various directions, which can reveal important information about the organization and integrity of nerve fibers in the brain. This technique has been widely used in research and clinical settings to study a variety of neurological conditions, including stroke, traumatic brain injury, multiple sclerosis, and neurodegenerative diseases such as Alzheimer's disease.

In summary, diffusion MRI is a specialized type of MRI that measures the movement of water molecules in biological tissues to generate detailed images of the body's internal structures, particularly the brain and nervous system. It provides valuable information about the microstructural properties of tissues and has important applications in both research and clinical settings.

Regeneration in a medical context refers to the process of renewal, restoration, and growth that replaces damaged or missing cells, tissues, organs, or even whole limbs in some organisms. This complex biological process involves various cellular and molecular mechanisms, such as cell proliferation, differentiation, and migration, which work together to restore the structural and functional integrity of the affected area.

In human medicine, regeneration has attracted significant interest due to its potential therapeutic applications in treating various conditions, including degenerative diseases, trauma, and congenital disorders. Researchers are actively studying the underlying mechanisms of regeneration in various model organisms to develop novel strategies for promoting tissue repair and regeneration in humans.

Examples of regeneration in human medicine include liver regeneration after partial hepatectomy, where the remaining liver lobes can grow back to their original size within weeks, and skin wound healing, where keratinocytes migrate and proliferate to close the wound and restore the epidermal layer. However, the regenerative capacity of humans is limited compared to some other organisms, such as planarians and axolotls, which can regenerate entire body parts or even their central nervous system.

A fetus is the developing offspring in a mammal, from the end of the embryonic period (approximately 8 weeks after fertilization in humans) until birth. In humans, the fetal stage of development starts from the eleventh week of pregnancy and continues until childbirth, which is termed as full-term pregnancy at around 37 to 40 weeks of gestation. During this time, the organ systems become fully developed and the body grows in size. The fetus is surrounded by the amniotic fluid within the amniotic sac and is connected to the placenta via the umbilical cord, through which it receives nutrients and oxygen from the mother. Regular prenatal care is essential during this period to monitor the growth and development of the fetus and ensure a healthy pregnancy and delivery.

Respiratory mechanics refers to the biomechanical properties and processes that involve the movement of air through the respiratory system during breathing. It encompasses the mechanical behavior of the lungs, chest wall, and the muscles of respiration, including the diaphragm and intercostal muscles.

Respiratory mechanics includes several key components:

1. **Compliance**: The ability of the lungs and chest wall to expand and recoil during breathing. High compliance means that the structures can easily expand and recoil, while low compliance indicates greater resistance to expansion and recoil.
2. **Resistance**: The opposition to airflow within the respiratory system, primarily due to the friction between the air and the airway walls. Airway resistance is influenced by factors such as airway diameter, length, and the viscosity of the air.
3. **Lung volumes and capacities**: These are the amounts of air present in the lungs during different phases of the breathing cycle. They include tidal volume (the amount of air inspired or expired during normal breathing), inspiratory reserve volume (additional air that can be inspired beyond the tidal volume), expiratory reserve volume (additional air that can be exhaled beyond the tidal volume), and residual volume (the air remaining in the lungs after a forced maximum exhalation).
4. **Work of breathing**: The energy required to overcome the resistance and elastic forces during breathing. This work is primarily performed by the respiratory muscles, which contract to generate negative intrathoracic pressure and expand the chest wall, allowing air to flow into the lungs.
5. **Pressure-volume relationships**: These describe how changes in lung volume are associated with changes in pressure within the respiratory system. Important pressure components include alveolar pressure (the pressure inside the alveoli), pleural pressure (the pressure between the lungs and the chest wall), and transpulmonary pressure (the difference between alveolar and pleural pressures).

Understanding respiratory mechanics is crucial for diagnosing and managing various respiratory disorders, such as chronic obstructive pulmonary disease (COPD), asthma, and restrictive lung diseases.

An auditory brainstem implant (ABI) is a surgically placed device that provides a sense of sound to individuals who have severe hearing loss and are unable to benefit from cochlear implants. Unlike cochlear implants, which stimulate the auditory nerve directly, ABIs stimulate the cochlear nucleus, a region in the brainstem responsible for processing sound.

During the ABI procedure, an electrode array is placed on the surface of the cochlear nucleus, and electrical signals are used to bypass damaged structures in the inner ear and auditory nerve. These signals are then transmitted to the brain, where they are interpreted as sound. The success of ABIs varies from person to person, but many individuals report improved ability to understand speech and recognize environmental sounds.

ABIs are typically recommended for people with hearing loss caused by damage to the auditory nerve or inner ear, such as those with neurofibromatosis type 2 (NF2), a genetic disorder that causes tumors to grow on the nerves responsible for hearing and balance. ABIs may also be considered for individuals who have had unsuccessful cochlear implantation due to damaged or absent auditory nerves.

The subarachnoid space is the area between the arachnoid mater and pia mater, which are two of the three membranes covering the brain and spinal cord (the third one being the dura mater). This space is filled with cerebrospinal fluid (CSF), which provides protection and cushioning to the central nervous system. The subarachnoid space also contains blood vessels that supply the brain and spinal cord with oxygen and nutrients. It's important to note that subarachnoid hemorrhage, a type of stroke, can occur when there is bleeding into this space.

A phenotype is the physical or biochemical expression of an organism's genes, or the observable traits and characteristics resulting from the interaction of its genetic constitution (genotype) with environmental factors. These characteristics can include appearance, development, behavior, and resistance to disease, among others. Phenotypes can vary widely, even among individuals with identical genotypes, due to differences in environmental influences, gene expression, and genetic interactions.

Alzheimer's disease is a progressive disorder that causes brain cells to waste away (degenerate) and die. It's the most common cause of dementia — a continuous decline in thinking, behavioral and social skills that disrupts a person's ability to function independently.

The early signs of the disease include forgetting recent events or conversations. As the disease progresses, a person with Alzheimer's disease will develop severe memory impairment and lose the ability to carry out everyday tasks.

Currently, there's no cure for Alzheimer's disease. However, treatments can temporarily slow the worsening of dementia symptoms and improve quality of life.

Vertebrobasilar insufficiency (VBI) is a medical condition characterized by inadequate blood flow to the vertebral and basilar arteries, which supply oxygenated blood to the brainstem and cerebellum. These arteries arise from the subclavian arteries and merge to form the basilar artery, which supplies critical structures in the posterior circulation of the brain.

VBI is often caused by atherosclerosis, or the buildup of plaque in the arterial walls, leading to narrowing (stenosis) or occlusion of these vessels. Other causes include embolism, arterial dissection, and vasculitis. The decreased blood flow can result in various neurological symptoms, such as dizziness, vertigo, imbalance, difficulty swallowing, slurred speech, visual disturbances, and even transient ischemic attacks (TIAs) or strokes.

Diagnosis of VBI typically involves a combination of clinical evaluation, imaging studies like MRA or CTA, and sometimes cerebral angiography to assess the extent and location of vascular narrowing or occlusion. Treatment options may include lifestyle modifications, medications to manage risk factors (such as hypertension, diabetes, or high cholesterol), antiplatelet therapy, or surgical interventions like endarterectomy or stenting in severe cases.

The Raphe Nuclei are clusters of neurons located in the brainstem, specifically in the midline of the pons, medulla oblongata, and mesencephalon (midbrain). These neurons are characterized by their ability to synthesize and release serotonin, a neurotransmitter that plays a crucial role in regulating various functions such as mood, appetite, sleep, and pain perception.

The Raphe Nuclei project axons widely throughout the central nervous system, allowing serotonin to modulate the activity of other neurons. There are several subdivisions within the Raphe Nuclei, each with distinct connections and functions. Dysfunction in the Raphe Nuclei has been implicated in several neurological and psychiatric disorders, including depression, anxiety, and chronic pain.

A cell line is a culture of cells that are grown in a laboratory for use in research. These cells are usually taken from a single cell or group of cells, and they are able to divide and grow continuously in the lab. Cell lines can come from many different sources, including animals, plants, and humans. They are often used in scientific research to study cellular processes, disease mechanisms, and to test new drugs or treatments. Some common types of human cell lines include HeLa cells (which come from a cancer patient named Henrietta Lacks), HEK293 cells (which come from embryonic kidney cells), and HUVEC cells (which come from umbilical vein endothelial cells). It is important to note that cell lines are not the same as primary cells, which are cells that are taken directly from a living organism and have not been grown in the lab.

An amino acid sequence is the specific order of amino acids in a protein or peptide molecule, formed by the linking of the amino group (-NH2) of one amino acid to the carboxyl group (-COOH) of another amino acid through a peptide bond. The sequence is determined by the genetic code and is unique to each type of protein or peptide. It plays a crucial role in determining the three-dimensional structure and function of proteins.

Western blotting is a laboratory technique used in molecular biology to detect and quantify specific proteins in a mixture of many different proteins. This technique is commonly used to confirm the expression of a protein of interest, determine its size, and investigate its post-translational modifications. The name "Western" blotting distinguishes this technique from Southern blotting (for DNA) and Northern blotting (for RNA).

The Western blotting procedure involves several steps:

1. Protein extraction: The sample containing the proteins of interest is first extracted, often by breaking open cells or tissues and using a buffer to extract the proteins.
2. Separation of proteins by electrophoresis: The extracted proteins are then separated based on their size by loading them onto a polyacrylamide gel and running an electric current through the gel (a process called sodium dodecyl sulfate-polyacrylamide gel electrophoresis or SDS-PAGE). This separates the proteins according to their molecular weight, with smaller proteins migrating faster than larger ones.
3. Transfer of proteins to a membrane: After separation, the proteins are transferred from the gel onto a nitrocellulose or polyvinylidene fluoride (PVDF) membrane using an electric current in a process called blotting. This creates a replica of the protein pattern on the gel but now immobilized on the membrane for further analysis.
4. Blocking: The membrane is then blocked with a blocking agent, such as non-fat dry milk or bovine serum albumin (BSA), to prevent non-specific binding of antibodies in subsequent steps.
5. Primary antibody incubation: A primary antibody that specifically recognizes the protein of interest is added and allowed to bind to its target protein on the membrane. This step may be performed at room temperature or 4°C overnight, depending on the antibody's properties.
6. Washing: The membrane is washed with a buffer to remove unbound primary antibodies.
7. Secondary antibody incubation: A secondary antibody that recognizes the primary antibody (often coupled to an enzyme or fluorophore) is added and allowed to bind to the primary antibody. This step may involve using a horseradish peroxidase (HRP)-conjugated or alkaline phosphatase (AP)-conjugated secondary antibody, depending on the detection method used later.
8. Washing: The membrane is washed again to remove unbound secondary antibodies.
9. Detection: A detection reagent is added to visualize the protein of interest by detecting the signal generated from the enzyme-conjugated or fluorophore-conjugated secondary antibody. This can be done using chemiluminescent, colorimetric, or fluorescent methods.
10. Analysis: The resulting image is analyzed to determine the presence and quantity of the protein of interest in the sample.

Western blotting is a powerful technique for identifying and quantifying specific proteins within complex mixtures. It can be used to study protein expression, post-translational modifications, protein-protein interactions, and more. However, it requires careful optimization and validation to ensure accurate and reproducible results.

Brain waves, also known as electroencephalography (EEG) waves, are the rhythmic electrical activity produced by the brain's neurons. These waves are detected by placing electrodes on the scalp and can be visualized using an EEG machine. Brain waves are typically categorized into different frequency bands, including:

1. Delta waves (0.5-4 Hz): Slow waves that are typically seen during deep sleep or in pathological states such as coma.
2. Theta waves (4-8 Hz): Slower waves that are associated with drowsiness, meditation, and creative thinking.
3. Alpha waves (8-13 Hz): These waves are present during relaxed wakefulness and can be seen during eyes-closed rest.
4. Beta waves (13-30 Hz): Faster waves that are associated with active thinking, focus, and alertness.
5. Gamma waves (30-100 Hz): The fastest waves, which are associated with higher cognitive functions such as attention, perception, and problem-solving.

Abnormalities in brain wave patterns can be indicative of various neurological conditions, including epilepsy, sleep disorders, brain injuries, and neurodegenerative diseases.

The meninges are the protective membranes that cover the brain and spinal cord. They consist of three layers: the dura mater (the outermost, toughest layer), the arachnoid mater (middle layer), and the pia mater (the innermost, delicate layer). These membranes provide protection and support to the central nervous system, and contain blood vessels that supply nutrients and remove waste products. Inflammation or infection of the meninges is called meningitis, which can be a serious medical condition requiring prompt treatment.

The telencephalon is the most anterior (front) region of the embryonic brain, which eventually develops into the largest portion of the adult human brain, including the cerebral cortex, basal ganglia, and olfactory bulbs. It is derived from the prosencephalon (forebrain) during embryonic development and is responsible for higher cognitive functions such as thinking, perception, and language. The telencephalon can be further divided into two hemispheres, each containing regions associated with different functions.

Octamer Transcription Factor-3 (OTF-3 or Oct3) is a specific protein that belongs to the class of POU domain transcription factors. These proteins play crucial roles in the regulation of gene expression during cell growth, development, and differentiation. The "POU" name refers to the presence of two conserved domains - a POU-specific domain and a POU homeodomain - that recognize and bind to specific DNA sequences called octamer motifs, which are involved in controlling the transcription of target genes.

Oct3, encoded by the Pou2f1 gene, is widely expressed in various tissues, including lymphoid cells, neurons, and embryonic stem cells. It has been shown to regulate the expression of several genes that are essential for cell survival, proliferation, and differentiation. Dysregulation of Oct3 has been implicated in several diseases, such as cancers and neurological disorders.

In summary, Octamer Transcription Factor-3 (Oct3) is a POU domain transcription factor that binds to octamer motifs in DNA and regulates the expression of target genes involved in cell growth, development, and differentiation.

Autoradiography is a medical imaging technique used to visualize and localize the distribution of radioactively labeled compounds within tissues or organisms. In this process, the subject is first exposed to a radioactive tracer that binds to specific molecules or structures of interest. The tissue is then placed in close contact with a radiation-sensitive film or detector, such as X-ray film or an imaging plate.

As the radioactive atoms decay, they emit particles (such as beta particles) that interact with the film or detector, causing chemical changes and leaving behind a visible image of the distribution of the labeled compound. The resulting autoradiogram provides information about the location, quantity, and sometimes even the identity of the molecules or structures that have taken up the radioactive tracer.

Autoradiography has been widely used in various fields of biology and medical research, including pharmacology, neuroscience, genetics, and cell biology, to study processes such as protein-DNA interactions, gene expression, drug metabolism, and neuronal connectivity. However, due to the use of radioactive materials and potential hazards associated with them, this technique has been gradually replaced by non-radioactive alternatives like fluorescence in situ hybridization (FISH) or immunofluorescence techniques.

A synapse is a structure in the nervous system that allows for the transmission of signals from one neuron (nerve cell) to another. It is the point where the axon terminal of one neuron meets the dendrite or cell body of another, and it is here that neurotransmitters are released and received. The synapse includes both the presynaptic and postsynaptic elements, as well as the cleft between them.

At the presynaptic side, an action potential travels down the axon and triggers the release of neurotransmitters into the synaptic cleft through exocytosis. These neurotransmitters then bind to receptors on the postsynaptic side, which can either excite or inhibit the receiving neuron. The strength of the signal between two neurons is determined by the number and efficiency of these synapses.

Synapses play a crucial role in the functioning of the nervous system, allowing for the integration and processing of information from various sources. They are also dynamic structures that can undergo changes in response to experience or injury, which has important implications for learning, memory, and recovery from neurological disorders.

Chemoreceptor cells are specialized sensory neurons that detect and respond to chemical changes in the internal or external environment. They play a crucial role in maintaining homeostasis within the body by converting chemical signals into electrical impulses, which are then transmitted to the central nervous system for further processing and response.

There are two main types of chemoreceptor cells:

1. Oxygen Chemoreceptors: These cells are located in the carotid bodies near the bifurcation of the common carotid artery and in the aortic bodies close to the aortic arch. They monitor the levels of oxygen, carbon dioxide, and pH in the blood and respond to decreases in oxygen concentration or increases in carbon dioxide and hydrogen ions (indicating acidity) by increasing their firing rate. This signals the brain to increase respiratory rate and depth, thereby restoring normal oxygen levels.

2. Taste Cells: These chemoreceptor cells are found within the taste buds of the tongue and other areas of the oral cavity. They detect specific tastes (salty, sour, sweet, bitter, and umami) by interacting with molecules from food. When a tastant binds to receptors on the surface of a taste cell, it triggers a series of intracellular signaling events that ultimately lead to the generation of an action potential. This information is then relayed to the brain, where it is interpreted as taste sensation.

In summary, chemoreceptor cells are essential for maintaining physiological balance by detecting and responding to chemical stimuli in the body. They play a critical role in regulating vital functions such as respiration and digestion.

Somatosensory evoked potentials (SEPs) are electrical signals generated in the brain and spinal cord in response to the stimulation of peripheral nerves. These responses are recorded and measured to assess the functioning of the somatosensory system, which is responsible for processing sensations such as touch, temperature, vibration, and proprioception (the sense of the position and movement of body parts).

SEPs are typically elicited by applying electrical stimuli to peripheral nerves in the arms or legs. The resulting neural responses are then recorded using electrodes placed on the scalp or other locations on the body. These recordings can provide valuable information about the integrity and function of the nervous system, and are often used in clinical settings to diagnose and monitor conditions such as nerve damage, spinal cord injury, multiple sclerosis, and other neurological disorders.

SEPs can be further categorized based on the specific type of stimulus used and the location of the recording electrodes. For example, short-latency SEPs (SLSEPs) are those that occur within the first 50 milliseconds after stimulation, and are typically recorded from the scalp over the primary sensory cortex. These responses reflect the earliest stages of sensory processing and can be used to assess the integrity of the peripheral nerves and the ascending sensory pathways in the spinal cord.

In contrast, long-latency SEPs (LLSEPs) occur after 50 milliseconds and are typically recorded from more posterior regions of the scalp over the parietal cortex. These responses reflect later stages of sensory processing and can be used to assess higher-level cognitive functions such as attention, memory, and perception.

Overall, SEPs provide a valuable tool for clinicians and researchers seeking to understand the functioning of the somatosensory system and diagnose or monitor neurological disorders.

Strychnine is a highly toxic, colorless, bitter-tasting crystalline alkaloid that is derived from the seeds of the Strychnos nux-vomica tree, native to India and Southeast Asia. It is primarily used in the manufacture of pesticides and rodenticides due to its high toxicity to insects and mammals.

Medically, strychnine has been used in the past as a stimulant and a treatment for various conditions such as asthma, heart failure, and neurological disorders. However, its use in modern medicine is extremely rare due to its narrow therapeutic index and high toxicity.

Strychnine works by blocking inhibitory neurotransmitters in the central nervous system, leading to increased muscle contractions, stiffness, and convulsions. Ingestion of even small amounts can cause severe symptoms such as muscle spasms, rigidity, seizures, and respiratory failure, which can be fatal if left untreated.

It is important to note that strychnine has no legitimate medical use in humans and its possession and use are highly regulated due to its high toxicity and potential for abuse.

Gamma-Aminobutyric Acid (GABA) is a major inhibitory neurotransmitter in the mammalian central nervous system. It plays a crucial role in regulating neuronal excitability and preventing excessive neuronal firing, which helps to maintain neural homeostasis and reduce the risk of seizures. GABA functions by binding to specific receptors (GABA-A, GABA-B, and GABA-C) on the postsynaptic membrane, leading to hyperpolarization of the neuronal membrane and reduced neurotransmitter release from presynaptic terminals.

In addition to its role in the central nervous system, GABA has also been identified as a neurotransmitter in the peripheral nervous system, where it is involved in regulating various physiological processes such as muscle relaxation, hormone secretion, and immune function.

GABA can be synthesized in neurons from glutamate, an excitatory neurotransmitter, through the action of the enzyme glutamic acid decarboxylase (GAD). Once synthesized, GABA is stored in synaptic vesicles and released into the synapse upon neuronal activation. After release, GABA can be taken up by surrounding glial cells or degraded by the enzyme GABA transaminase (GABA-T) into succinic semialdehyde, which is further metabolized to form succinate and enter the Krebs cycle for energy production.

Dysregulation of GABAergic neurotransmission has been implicated in various neurological and psychiatric disorders, including epilepsy, anxiety, depression, and sleep disturbances. Therefore, modulating GABAergic signaling through pharmacological interventions or other therapeutic approaches may offer potential benefits for the treatment of these conditions.

In situ hybridization (ISH) is a molecular biology technique used to detect and localize specific nucleic acid sequences, such as DNA or RNA, within cells or tissues. This technique involves the use of a labeled probe that is complementary to the target nucleic acid sequence. The probe can be labeled with various types of markers, including radioisotopes, fluorescent dyes, or enzymes.

During the ISH procedure, the labeled probe is hybridized to the target nucleic acid sequence in situ, meaning that the hybridization occurs within the intact cells or tissues. After washing away unbound probe, the location of the labeled probe can be visualized using various methods depending on the type of label used.

In situ hybridization has a wide range of applications in both research and diagnostic settings, including the detection of gene expression patterns, identification of viral infections, and diagnosis of genetic disorders.

The prosencephalon is a term used in the field of neuroembryology, which refers to the developmental stage of the forebrain in the embryonic nervous system. It is one of the three primary vesicles that form during the initial stages of neurulation, along with the mesencephalon (midbrain) and rhombencephalon (hindbrain).

The prosencephalon further differentiates into two secondary vesicles: the telencephalon and diencephalon. The telencephalon gives rise to structures such as the cerebral cortex, basal ganglia, and olfactory bulbs, while the diencephalon develops into structures like the thalamus, hypothalamus, and epithalamus.

It is important to note that 'prosencephalon' itself is not used as a medical term in adult neuroanatomy, but it is crucial for understanding the development of the human brain during embryogenesis.

The frontal lobe is the largest lobes of the human brain, located at the front part of each cerebral hemisphere and situated in front of the parietal and temporal lobes. It plays a crucial role in higher cognitive functions such as decision making, problem solving, planning, parts of social behavior, emotional expressions, physical reactions, and motor function. The frontal lobe is also responsible for what's known as "executive functions," which include the ability to focus attention, understand rules, switch focus, plan actions, and inhibit inappropriate behaviors. It is divided into five areas, each with its own specific functions: the primary motor cortex, premotor cortex, Broca's area, prefrontal cortex, and orbitofrontal cortex. Damage to the frontal lobe can result in a wide range of impairments, depending on the location and extent of the injury.

The posterior cranial fossa is a term used in anatomy to refer to the portion of the skull that forms the lower, back part of the cranial cavity. It is located between the occipital bone and the temporal bones, and it contains several important structures including the cerebellum, pons, medulla oblongata, and the lower cranial nerves (IX-XII). The posterior fossa also contains the foramen magnum, which is a large opening through which the spinal cord connects to the brainstem. This region of the skull is protected by the occipital bone, which forms the base of the skull and provides attachment for several neck muscles.

A cerebral hemorrhage, also known as an intracranial hemorrhage or intracerebral hemorrhage, is a type of stroke that results from bleeding within the brain tissue. It occurs when a weakened blood vessel bursts and causes localized bleeding in the brain. This bleeding can increase pressure in the skull, damage nearby brain cells, and release toxic substances that further harm brain tissues.

Cerebral hemorrhages are often caused by chronic conditions like hypertension (high blood pressure) or cerebral amyloid angiopathy, which weakens the walls of blood vessels over time. Other potential causes include trauma, aneurysms, arteriovenous malformations, illicit drug use, and brain tumors. Symptoms may include sudden headache, weakness, numbness, difficulty speaking or understanding speech, vision problems, loss of balance, and altered level of consciousness. Immediate medical attention is required to diagnose and manage cerebral hemorrhage through imaging techniques, supportive care, and possible surgical interventions.

The cochlear nerve, also known as the auditory nerve, is the sensory nerve that transmits sound signals from the inner ear to the brain. It consists of two parts: the outer spiral ganglion and the inner vestibular portion. The spiral ganglion contains the cell bodies of the bipolar neurons that receive input from hair cells in the cochlea, which is the snail-shaped organ in the inner ear responsible for hearing. These neurons then send their axons to form the cochlear nerve, which travels through the internal auditory meatus and synapses with neurons in the cochlear nuclei located in the brainstem.

Damage to the cochlear nerve can result in hearing loss or deafness, depending on the severity of the injury. Common causes of cochlear nerve damage include acoustic trauma, such as exposure to loud noises, viral infections, meningitis, and tumors affecting the nerve or surrounding structures. In some cases, cochlear nerve damage may be treated with hearing aids, cochlear implants, or other assistive devices to help restore or improve hearing function.

The vestibular nuclei are clusters of neurons located in the brainstem that receive and process information from the vestibular system, which is responsible for maintaining balance and spatial orientation. The vestibular nuclei help to coordinate movements of the eyes, head, and body in response to changes in position or movement. They also play a role in reflexes that help to maintain posture and stabilize vision during head movement. There are four main vestibular nuclei: the medial, lateral, superior, and inferior vestibular nuclei.

Glial Fibrillary Acidic Protein (GFAP) is a type of intermediate filament protein that is primarily found in astrocytes, which are a type of star-shaped glial cells in the central nervous system (CNS). These proteins play an essential role in maintaining the structural integrity and stability of astrocytes. They also participate in various cellular processes such as responding to injury, providing support to neurons, and regulating the extracellular environment.

GFAP is often used as a marker for astrocytic activation or reactivity, which can occur in response to CNS injuries, neuroinflammation, or neurodegenerative diseases. Elevated GFAP levels in cerebrospinal fluid (CSF) or blood can indicate astrocyte damage or dysfunction and are associated with several neurological conditions, including traumatic brain injury, stroke, multiple sclerosis, Alzheimer's disease, and Alexander's disease.

Neuronal plasticity, also known as neuroplasticity or neural plasticity, refers to the ability of the brain and nervous system to change and adapt as a result of experience, learning, injury, or disease. This can involve changes in the structure, organization, and function of neurons (nerve cells) and their connections (synapses) in the central and peripheral nervous systems.

Neuronal plasticity can take many forms, including:

* Synaptic plasticity: Changes in the strength or efficiency of synaptic connections between neurons. This can involve the formation, elimination, or modification of synapses.
* Neural circuit plasticity: Changes in the organization and connectivity of neural circuits, which are networks of interconnected neurons that process information.
* Structural plasticity: Changes in the physical structure of neurons, such as the growth or retraction of dendrites (branches that receive input from other neurons) or axons (projections that transmit signals to other neurons).
* Functional plasticity: Changes in the physiological properties of neurons, such as their excitability, responsiveness, or sensitivity to stimuli.

Neuronal plasticity is a fundamental property of the nervous system and plays a crucial role in many aspects of brain function, including learning, memory, perception, and cognition. It also contributes to the brain's ability to recover from injury or disease, such as stroke or traumatic brain injury.

Astrocytoma is a type of brain tumor that arises from astrocytes, which are star-shaped glial cells in the brain. These tumors can occur in various parts of the brain and can have different grades of malignancy, ranging from low-grade (I or II) to high-grade (III or IV). Low-grade astrocytomas tend to grow slowly and may not cause any symptoms for a long time, while high-grade astrocytomas are more aggressive and can grow quickly, causing neurological problems.

Symptoms of astrocytoma depend on the location and size of the tumor but may include headaches, seizures, weakness or numbness in the limbs, difficulty speaking or swallowing, changes in vision or behavior, and memory loss. Treatment options for astrocytomas include surgery, radiation therapy, chemotherapy, or a combination of these approaches. The prognosis for astrocytoma varies widely depending on the grade and location of the tumor, as well as the age and overall health of the patient.

The vestibulocochlear nerve, also known as the auditory-vestibular nerve or cranial nerve VIII, is a paired peripheral nerve that transmits sensory information from the inner ear to the brain. It has two distinct parts: the cochlear part and the vestibular part.

The cochlear part is responsible for hearing and transmits sound signals from the cochlea to the brain. The vestibular part, on the other hand, is responsible for maintaining balance and spatial orientation by transmitting information about head movement and position from the vestibular apparatus (utricle, saccule, and semicircular canals) in the inner ear to the brain.

Together, these two parts of the vestibulocochlear nerve play a crucial role in our ability to hear and maintain balance. Damage to this nerve can result in hearing loss, tinnitus (ringing in the ears), vertigo (dizziness), or balance problems.

Cell separation is a process used to separate and isolate specific cell types from a heterogeneous mixture of cells. This can be accomplished through various physical or biological methods, depending on the characteristics of the cells of interest. Some common techniques for cell separation include:

1. Density gradient centrifugation: In this method, a sample containing a mixture of cells is layered onto a density gradient medium and then centrifuged. The cells are separated based on their size, density, and sedimentation rate, with denser cells settling closer to the bottom of the tube and less dense cells remaining near the top.

2. Magnetic-activated cell sorting (MACS): This technique uses magnetic beads coated with antibodies that bind to specific cell surface markers. The labeled cells are then passed through a column placed in a magnetic field, which retains the magnetically labeled cells while allowing unlabeled cells to flow through.

3. Fluorescence-activated cell sorting (FACS): In this method, cells are stained with fluorochrome-conjugated antibodies that recognize specific cell surface or intracellular markers. The stained cells are then passed through a laser beam, which excites the fluorophores and allows for the detection and sorting of individual cells based on their fluorescence profile.

4. Filtration: This simple method relies on the physical size differences between cells to separate them. Cells can be passed through filters with pore sizes that allow smaller cells to pass through while retaining larger cells.

5. Enzymatic digestion: In some cases, cells can be separated by enzymatically dissociating tissues into single-cell suspensions and then using various separation techniques to isolate specific cell types.

These methods are widely used in research and clinical settings for applications such as isolating immune cells, stem cells, or tumor cells from biological samples.

Glutamic acid is an alpha-amino acid, which is one of the 20 standard amino acids in the genetic code. The systematic name for this amino acid is (2S)-2-Aminopentanedioic acid. Its chemical formula is HO2CCH(NH2)CH2CH2CO2H.

Glutamic acid is a crucial excitatory neurotransmitter in the human brain, and it plays an essential role in learning and memory. It's also involved in the metabolism of sugars and amino acids, the synthesis of proteins, and the removal of waste nitrogen from the body.

Glutamic acid can be found in various foods such as meat, fish, beans, eggs, dairy products, and vegetables. In the human body, glutamic acid can be converted into gamma-aminobutyric acid (GABA), another important neurotransmitter that has a calming effect on the nervous system.

A reflex is an automatic, involuntary and rapid response to a stimulus that occurs without conscious intention. In the context of physiology and neurology, it's a basic mechanism that involves the transmission of nerve impulses between neurons, resulting in a muscle contraction or glandular secretion.

Reflexes are important for maintaining homeostasis, protecting the body from harm, and coordinating movements. They can be tested clinically to assess the integrity of the nervous system, such as the knee-j jerk reflex, which tests the function of the L3-L4 spinal nerve roots and the sensitivity of the stretch reflex arc.

Apnea is a medical condition defined as the cessation of breathing for 10 seconds or more. It can occur during sleep (sleep apnea) or while awake (wakeful apnea). There are different types of sleep apnea, including obstructive sleep apnea, central sleep apnea, and complex sleep apnea syndrome. Obstructive sleep apnea occurs when the airway becomes blocked during sleep, while central sleep apnea occurs when the brain fails to signal the muscles to breathe. Complex sleep apnea syndrome, also known as treatment-emergent central sleep apnea, is a combination of obstructive and central sleep apneas. Sleep apnea can lead to various complications, such as fatigue, difficulty concentrating, high blood pressure, heart disease, and stroke.

Flow cytometry is a medical and research technique used to measure physical and chemical characteristics of cells or particles, one cell at a time, as they flow in a fluid stream through a beam of light. The properties measured include:

* Cell size (light scatter)
* Cell internal complexity (granularity, also light scatter)
* Presence or absence of specific proteins or other molecules on the cell surface or inside the cell (using fluorescent antibodies or other fluorescent probes)

The technique is widely used in cell counting, cell sorting, protein engineering, biomarker discovery and monitoring disease progression, particularly in hematology, immunology, and cancer research.

Gene expression profiling is a laboratory technique used to measure the activity (expression) of thousands of genes at once. This technique allows researchers and clinicians to identify which genes are turned on or off in a particular cell, tissue, or organism under specific conditions, such as during health, disease, development, or in response to various treatments.

The process typically involves isolating RNA from the cells or tissues of interest, converting it into complementary DNA (cDNA), and then using microarray or high-throughput sequencing technologies to determine which genes are expressed and at what levels. The resulting data can be used to identify patterns of gene expression that are associated with specific biological states or processes, providing valuable insights into the underlying molecular mechanisms of diseases and potential targets for therapeutic intervention.

In recent years, gene expression profiling has become an essential tool in various fields, including cancer research, drug discovery, and personalized medicine, where it is used to identify biomarkers of disease, predict patient outcomes, and guide treatment decisions.

The cochlear nucleus is the first relay station in the auditory pathway within the central nervous system. It is a structure located in the lower pons region of the brainstem and receives sensory information from the cochlea, which is the spiral-shaped organ of hearing in the inner ear.

The cochlear nucleus consists of several subdivisions, each with distinct neuronal populations that process different aspects of auditory information. These subdivisions include the anteroventral cochlear nucleus (AVCN), posteroventral cochlear nucleus (PVCN), dorsal cochlear nucleus (DCN), and the granule cell domain.

Neurons in these subdivisions perform various computations on the incoming auditory signals, such as frequency analysis, intensity coding, and sound localization. The output of the cochlear nucleus is then sent via several pathways to higher brain regions for further processing and interpretation, including the inferior colliculus, medial geniculate body, and eventually the auditory cortex.

Damage or dysfunction in the cochlear nucleus can lead to hearing impairments and other auditory processing disorders.

A craniotomy is a surgical procedure where a bone flap is temporarily removed from the skull to access the brain. This procedure is typically performed to treat various neurological conditions, such as brain tumors, aneurysms, arteriovenous malformations, or traumatic brain injuries. After the underlying brain condition is addressed, the bone flap is usually replaced and secured back in place with plates and screws. The purpose of a craniotomy is to provide access to the brain for diagnostic or therapeutic interventions while minimizing potential damage to surrounding tissues.

Anoxia is a medical condition that refers to the absence or complete lack of oxygen supply in the body or a specific organ, tissue, or cell. This can lead to serious health consequences, including damage or death of cells and tissues, due to the vital role that oxygen plays in supporting cellular metabolism and energy production.

Anoxia can occur due to various reasons, such as respiratory failure, cardiac arrest, severe blood loss, carbon monoxide poisoning, or high altitude exposure. Prolonged anoxia can result in hypoxic-ischemic encephalopathy, a serious condition that can cause brain damage and long-term neurological impairments.

Medical professionals use various diagnostic tests, such as blood gas analysis, pulse oximetry, and electroencephalography (EEG), to assess oxygen levels in the body and diagnose anoxia. Treatment for anoxia typically involves addressing the underlying cause, providing supplemental oxygen, and supporting vital functions, such as breathing and circulation, to prevent further damage.

Pregnancy is a physiological state or condition where a fertilized egg (zygote) successfully implants and grows in the uterus of a woman, leading to the development of an embryo and finally a fetus. This process typically spans approximately 40 weeks, divided into three trimesters, and culminates in childbirth. Throughout this period, numerous hormonal and physical changes occur to support the growing offspring, including uterine enlargement, breast development, and various maternal adaptations to ensure the fetus's optimal growth and well-being.

Totipotent stem cells are a type of stem cell that have the greatest developmental potential and can differentiate into any cell type in the body, including extra-embryonic tissues such as the placenta. These stem cells are derived from the fertilized egg (zygote) and are capable of forming a complete organism. As development progresses, totipotent stem cells become more restricted in their differentiation potential, giving rise to pluripotent stem cells, which can differentiate into any cell type in the body but not extra-embryonic tissues. Totipotent stem cells are rarely found in adults and are primarily studied in the context of embryonic development and regenerative medicine.

Rhodanine is not a medical term itself, but it is a chemical compound with the formula R-SC(=S)NH-C(=O)NH-R', where R and R' are organic groups. It is used in the synthesis of certain types of chelating agents, which are compounds that can form stable complexes with metal ions.

In a medical context, rhodanine derivatives have been studied for their potential therapeutic applications, particularly as antimicrobial and anti-inflammatory agents. For example, some rhodanine derivatives have shown activity against bacteria, fungi, and parasites, including those that are resistant to other antibiotics.

However, it is important to note that while rhodanine itself has potential therapeutic applications, most of the research in this area focuses on its derivatives rather than the compound itself. Therefore, any medical definition would more accurately refer to specific rhodanine derivatives and their uses, rather than the compound itself.

Reproducibility of results in a medical context refers to the ability to obtain consistent and comparable findings when a particular experiment or study is repeated, either by the same researcher or by different researchers, following the same experimental protocol. It is an essential principle in scientific research that helps to ensure the validity and reliability of research findings.

In medical research, reproducibility of results is crucial for establishing the effectiveness and safety of new treatments, interventions, or diagnostic tools. It involves conducting well-designed studies with adequate sample sizes, appropriate statistical analyses, and transparent reporting of methods and findings to allow other researchers to replicate the study and confirm or refute the results.

The lack of reproducibility in medical research has become a significant concern in recent years, as several high-profile studies have failed to produce consistent findings when replicated by other researchers. This has led to increased scrutiny of research practices and a call for greater transparency, rigor, and standardization in the conduct and reporting of medical research.

"Cell count" is a medical term that refers to the process of determining the number of cells present in a given volume or sample of fluid or tissue. This can be done through various laboratory methods, such as counting individual cells under a microscope using a specialized grid called a hemocytometer, or using automated cell counters that use light scattering and electrical impedance techniques to count and classify different types of cells.

Cell counts are used in a variety of medical contexts, including hematology (the study of blood and blood-forming tissues), microbiology (the study of microscopic organisms), and pathology (the study of diseases and their causes). For example, a complete blood count (CBC) is a routine laboratory test that includes a white blood cell (WBC) count, red blood cell (RBC) count, hemoglobin level, hematocrit value, and platelet count. Abnormal cell counts can indicate the presence of various medical conditions, such as infections, anemia, or leukemia.

Dopamine is a type of neurotransmitter, which is a chemical messenger that transmits signals in the brain and nervous system. It plays several important roles in the body, including:

* Regulation of movement and coordination
* Modulation of mood and motivation
* Control of the reward and pleasure centers of the brain
* Regulation of muscle tone
* Involvement in memory and attention

Dopamine is produced in several areas of the brain, including the substantia nigra and the ventral tegmental area. It is released by neurons (nerve cells) and binds to specific receptors on other neurons, where it can either excite or inhibit their activity.

Abnormalities in dopamine signaling have been implicated in several neurological and psychiatric conditions, including Parkinson's disease, schizophrenia, and addiction.

Cortical Spreading Depression (CSD) is a wave of neuronal and glial depolarization that spreads across the cerebral cortex, characterized by the near-complete suppression of neural activity, followed by a period of depressed excitability. It is often accompanied by profound changes in blood flow and metabolism.

CSD is associated with several neurological conditions, including migraine with aura, traumatic brain injury, and subarachnoid hemorrhage. In migraine, it is believed to underlie the visual aura that precedes the headache phase of the attack. CSD can also have harmful effects on the brain, contributing to the development of secondary injuries after trauma or stroke.

The underlying mechanisms of CSD involve the activation of various ion channels and neurotransmitter receptors, leading to a massive efflux of potassium ions (K+) from neurons and glial cells. This K+ efflux triggers a cascade of events that result in the depolarization of surrounding neurons and glia, ultimately leading to the suppression of neural activity and the characteristic hemodynamic and metabolic changes associated with CSD.

A biological marker, often referred to as a biomarker, is a measurable indicator that reflects the presence or severity of a disease state, or a response to a therapeutic intervention. Biomarkers can be found in various materials such as blood, tissues, or bodily fluids, and they can take many forms, including molecular, histologic, radiographic, or physiological measurements.

In the context of medical research and clinical practice, biomarkers are used for a variety of purposes, such as:

1. Diagnosis: Biomarkers can help diagnose a disease by indicating the presence or absence of a particular condition. For example, prostate-specific antigen (PSA) is a biomarker used to detect prostate cancer.
2. Monitoring: Biomarkers can be used to monitor the progression or regression of a disease over time. For instance, hemoglobin A1c (HbA1c) levels are monitored in diabetes patients to assess long-term blood glucose control.
3. Predicting: Biomarkers can help predict the likelihood of developing a particular disease or the risk of a negative outcome. For example, the presence of certain genetic mutations can indicate an increased risk for breast cancer.
4. Response to treatment: Biomarkers can be used to evaluate the effectiveness of a specific treatment by measuring changes in the biomarker levels before and after the intervention. This is particularly useful in personalized medicine, where treatments are tailored to individual patients based on their unique biomarker profiles.

It's important to note that for a biomarker to be considered clinically valid and useful, it must undergo rigorous validation through well-designed studies, including demonstrating sensitivity, specificity, reproducibility, and clinical relevance.

Excitatory postsynaptic potentials (EPSPs) are electrical signals that occur in the dendrites and cell body of a neuron, or nerve cell. They are caused by the activation of excitatory synapses, which are connections between neurons that allow for the transmission of information.

When an action potential, or electrical impulse, reaches the end of an axon, it triggers the release of neurotransmitters into the synaptic cleft, the small gap between the presynaptic and postsynaptic membranes. The excitatory neurotransmitters then bind to receptors on the postsynaptic membrane, causing a local depolarization of the membrane potential. This depolarization is known as an EPSP.

EPSPs are responsible for increasing the likelihood that an action potential will be generated in the postsynaptic neuron. When multiple EPSPs occur simultaneously or in close succession, they can summate and cause a large enough depolarization to trigger an action potential. This allows for the transmission of information from one neuron to another.

It's important to note that there are also inhibitory postsynaptic potentials (IPSPs) which decrease the likelihood that an action potential will be generated in the postsynaptic neuron, by causing a local hyperpolarization of the membrane potential.

The fourth ventricle is a part of the cerebrospinal fluid-filled system in the brain, located in the posterior cranial fossa and continuous with the central canal of the medulla oblongata and the cerebral aqueduct. It is shaped like a cavity with a roof, floor, and lateral walls, and it communicates rostrally with the third ventricle through the cerebral aqueduct and caudally with the subarachnoid space through the median and lateral apertures (foramina of Luschka and Magendie). The fourth ventricle contains choroid plexus tissue, which produces cerebrospinal fluid. Its roof is formed by the cerebellar vermis and the superior medullary velum, while its floor is composed of the rhomboid fossa, which includes several important structures such as the vagal trigone, hypoglossal trigone, and striae medullares.

Leukoencephalopathies are a group of medical conditions that primarily affect the white matter of the brain, which consists mainly of nerve fibers covered by myelin sheaths. These conditions are characterized by abnormalities in the structure and function of the white matter, leading to various neurological symptoms such as cognitive decline, motor impairment, seizures, and behavioral changes.

The term "leukoencephalopathy" is derived from two Greek words: "leukos," meaning white, and "enkephalos," meaning brain. The suffix "-pathy" refers to a disease or suffering. Therefore, leukoencephalopathies refer specifically to diseases that affect the white matter of the brain.

There are various types of leukoencephalopathies, including genetic, metabolic, infectious, toxic, and immune-mediated forms. Some examples include multiple sclerosis, adrenoleukodystrophy, Alexander disease, Canavan disease, and Marchiafava-Bignami disease. The diagnosis of leukoencephalopathies typically involves a combination of clinical evaluation, imaging studies such as MRI, and sometimes genetic or laboratory testing to identify the underlying cause. Treatment depends on the specific type and severity of the condition and may include medications, dietary modifications, physical therapy, or supportive care.

Cordotomy is a surgical procedure that involves selectively cutting the spinothalamic tract, which carries pain and temperature signals from the body to the brain. This procedure is typically performed in the cervical (neck) region of the spinal cord and is used to treat chronic, severe pain that has not responded to other forms of treatment.

During a cordotomy, a neurosurgeon uses a specialized needle or electrode to locate and destroy the specific nerve fibers responsible for transmitting painful sensations from a particular part of the body. The procedure can be performed under local anesthesia with sedation or general anesthesia, depending on the patient's preferences and medical condition.

While cordotomy can provide significant pain relief in the short term, it is not a permanent solution, as the nerve fibers may eventually regenerate over time. Additionally, there are risks associated with the procedure, including weakness or numbness in the affected limbs, difficulty swallowing, and in rare cases, respiratory failure. Therefore, cordotomy is typically reserved for patients with severe pain who have exhausted other treatment options and have a limited life expectancy due to their underlying medical condition.

Norepinephrine, also known as noradrenaline, is a neurotransmitter and a hormone that is primarily produced in the adrenal glands and is released into the bloodstream in response to stress or physical activity. It plays a crucial role in the "fight-or-flight" response by preparing the body for action through increasing heart rate, blood pressure, respiratory rate, and glucose availability.

As a neurotransmitter, norepinephrine is involved in regulating various functions of the nervous system, including attention, perception, motivation, and arousal. It also plays a role in modulating pain perception and responding to stressful or emotional situations.

In medical settings, norepinephrine is used as a vasopressor medication to treat hypotension (low blood pressure) that can occur during septic shock, anesthesia, or other critical illnesses. It works by constricting blood vessels and increasing heart rate, which helps to improve blood pressure and perfusion of vital organs.

Hematopoiesis is the process of forming and developing blood cells. It occurs in the bone marrow and includes the production of red blood cells (erythropoiesis), white blood cells (leukopoiesis), and platelets (thrombopoiesis). This process is regulated by various growth factors, hormones, and cytokines. Hematopoiesis begins early in fetal development and continues throughout a person's life. Disorders of hematopoiesis can result in conditions such as anemia, leukopenia, leukocytosis, thrombocytopenia, or thrombocytosis.

Three-dimensional (3D) imaging in medicine refers to the use of technologies and techniques that generate a 3D representation of internal body structures, organs, or tissues. This is achieved by acquiring and processing data from various imaging modalities such as X-ray computed tomography (CT), magnetic resonance imaging (MRI), ultrasound, or confocal microscopy. The resulting 3D images offer a more detailed visualization of the anatomy and pathology compared to traditional 2D imaging techniques, allowing for improved diagnostic accuracy, surgical planning, and minimally invasive interventions.

In 3D imaging, specialized software is used to reconstruct the acquired data into a volumetric model, which can be manipulated and viewed from different angles and perspectives. This enables healthcare professionals to better understand complex anatomical relationships, detect abnormalities, assess disease progression, and monitor treatment response. Common applications of 3D imaging include neuroimaging, orthopedic surgery planning, cancer staging, dental and maxillofacial reconstruction, and interventional radiology procedures.

Regenerative medicine is a branch of medicine that deals with the repair or replacement of damaged or diseased cells, tissues, and organs using various strategies, including the use of stem cells, tissue engineering, gene therapy, and biomaterials. The goal of regenerative medicine is to restore normal function and structure to tissues and organs, thereby improving the patient's quality of life and potentially curing diseases that were previously considered incurable.

Regenerative medicine has shown promise in a variety of clinical applications, such as the treatment of degenerative diseases like osteoarthritis, spinal cord injuries, heart disease, diabetes, and liver failure. It also holds great potential for use in regenerative therapies for wound healing, tissue reconstruction, and cosmetic surgery.

The field of regenerative medicine is rapidly evolving, with new discoveries and advances being made regularly. As our understanding of the underlying biological mechanisms that drive tissue repair and regeneration continues to grow, so too will the potential clinical applications of this exciting and promising field.

Treatment outcome is a term used to describe the result or effect of medical treatment on a patient's health status. It can be measured in various ways, such as through symptoms improvement, disease remission, reduced disability, improved quality of life, or survival rates. The treatment outcome helps healthcare providers evaluate the effectiveness of a particular treatment plan and make informed decisions about future care. It is also used in clinical research to compare the efficacy of different treatments and improve patient care.

Nestin is a type of class VI intermediate filament protein that is primarily expressed in various types of undifferentiated or progenitor cells in the nervous system, including neural stem cells and progenitor cells. It is often used as a marker for these cells due to its expression during stages of active cell division and migration. Nestin is also expressed in some other tissues undergoing regeneration or injury.

Blood pressure is the force exerted by circulating blood on the walls of the blood vessels. It is measured in millimeters of mercury (mmHg) and is given as two figures:

1. Systolic pressure: This is the pressure when the heart pushes blood out into the arteries.
2. Diastolic pressure: This is the pressure when the heart rests between beats, allowing it to fill with blood.

Normal blood pressure for adults is typically around 120/80 mmHg, although this can vary slightly depending on age, sex, and other factors. High blood pressure (hypertension) is generally considered to be a reading of 130/80 mmHg or higher, while low blood pressure (hypotension) is usually defined as a reading below 90/60 mmHg. It's important to note that blood pressure can fluctuate throughout the day and may be affected by factors such as stress, physical activity, and medication use.

Proto-oncogene proteins, such as c-Fos, are normal cellular proteins that play crucial roles in various biological processes including cell growth, differentiation, and survival. They can be activated or overexpressed due to genetic alterations, leading to the formation of cancerous cells. The c-Fos protein is a nuclear phosphoprotein involved in signal transduction pathways and forms a heterodimer with c-Jun to create the activator protein-1 (AP-1) transcription factor complex. This complex binds to specific DNA sequences, thereby regulating the expression of target genes that contribute to various cellular responses, including proliferation, differentiation, and apoptosis. Dysregulation of c-Fos can result in uncontrolled cell growth and malignant transformation, contributing to tumor development and progression.

Nervous system diseases, also known as neurological disorders, refer to a group of conditions that affect the nervous system, which includes the brain, spinal cord, nerves, and muscles. These diseases can affect various functions of the body, such as movement, sensation, cognition, and behavior. They can be caused by genetics, infections, injuries, degeneration, or tumors. Examples of nervous system diseases include Alzheimer's disease, Parkinson's disease, multiple sclerosis, epilepsy, migraine, stroke, and neuroinfections like meningitis and encephalitis. The symptoms and severity of these disorders can vary widely, ranging from mild to severe and debilitating.

A chronic brain injury, also known as a traumatic brain injury (TBI), is an injury to the brain that results in long-term or permanent impairment. It is caused by a significant blow to the head or body, or by a penetrating head injury that disrupts the normal functioning of the brain.

Chronic brain injuries can result in a wide range of physical, cognitive, and emotional symptoms, including:

* Persistent headaches or migraines
* Difficulty with memory, concentration, and decision-making
* Changes in mood, such as depression, anxiety, or irritability
* Difficulty with communication, including speaking and understanding language
* Sensory problems, such as vision or hearing loss
* Seizures
* Balance and coordination problems
* Weakness or paralysis on one side of the body

These symptoms can vary in severity and may not be immediately apparent following the initial injury. In some cases, they may not become apparent until days, weeks, or even months after the injury.

Chronic brain injuries are often classified as mild, moderate, or severe based on the level of consciousness loss and the presence of other neurological deficits. Mild TBIs, also known as concussions, may not cause long-term impairment, while moderate to severe TBIs can result in significant disability and require ongoing rehabilitation and support.

Treatment for chronic brain injuries typically involves a multidisciplinary approach that includes medical management of symptoms, physical therapy, occupational therapy, speech and language therapy, and counseling or psychotherapy. In some cases, surgery may be necessary to address structural damage to the brain.

A mutation is a permanent change in the DNA sequence of an organism's genome. Mutations can occur spontaneously or be caused by environmental factors such as exposure to radiation, chemicals, or viruses. They may have various effects on the organism, ranging from benign to harmful, depending on where they occur and whether they alter the function of essential proteins. In some cases, mutations can increase an individual's susceptibility to certain diseases or disorders, while in others, they may confer a survival advantage. Mutations are the driving force behind evolution, as they introduce new genetic variability into populations, which can then be acted upon by natural selection.

Acoustic stimulation refers to the use of sound waves or vibrations to elicit a response in an individual, typically for the purpose of assessing or treating hearing, balance, or neurological disorders. In a medical context, acoustic stimulation may involve presenting pure tones, speech sounds, or other types of auditory signals through headphones, speakers, or specialized devices such as bone conduction transducers.

The response to acoustic stimulation can be measured using various techniques, including electrophysiological tests like auditory brainstem responses (ABRs) or otoacoustic emissions (OAEs), behavioral observations, or functional imaging methods like fMRI. Acoustic stimulation is also used in therapeutic settings, such as auditory training programs for hearing impairment or vestibular rehabilitation for balance disorders.

It's important to note that acoustic stimulation should be administered under the guidance of a qualified healthcare professional to ensure safety and effectiveness.

CD34 is a type of antigen that is found on the surface of certain cells in the human body. Specifically, CD34 antigens are present on hematopoietic stem cells, which are immature cells that can develop into different types of blood cells. These stem cells are found in the bone marrow and are responsible for producing red blood cells, white blood cells, and platelets.

CD34 antigens are a type of cell surface marker that is used in medical research and clinical settings to identify and isolate hematopoietic stem cells. They are also used in the development of stem cell therapies and transplantation procedures. CD34 antigens can be detected using various laboratory techniques, such as flow cytometry or immunohistochemistry.

It's important to note that while CD34 is a useful marker for identifying hematopoietic stem cells, it is not exclusive to these cells and can also be found on other cell types, such as endothelial cells that line blood vessels. Therefore, additional markers are often used in combination with CD34 to more specifically identify and isolate hematopoietic stem cells.

A saccade is a quick, rapid, and ballistic conjugate eye movement that shifts the point of fixation from one target to another. It helps in rapidly repositioning the fovea (the central part of the retina with the highest visual acuity) to focus on different targets of interest in the visual scene. Saccades are essential for efficient scanning and exploration of our environment, allowing us to direct our high-resolution vision towards various points of interest. They typically take only about 20-200 milliseconds to complete and can reach peak velocities of up to 500 degrees per second or more, depending on the amplitude of the movement. Saccades are a critical component of normal visual function and are often studied in fields such as ophthalmology, neurology, and neuroscience.

Cerebellar neoplasms refer to abnormal growths or tumors that develop in the cerebellum, which is the part of the brain responsible for coordinating muscle movements and maintaining balance. These tumors can be benign (non-cancerous) or malignant (cancerous), and they can arise from various types of cells within the cerebellum.

The most common type of cerebellar neoplasm is a medulloblastoma, which arises from primitive nerve cells in the cerebellum. Other types of cerebellar neoplasms include astrocytomas, ependymomas, and brain stem gliomas. Symptoms of cerebellar neoplasms may include headaches, vomiting, unsteady gait, coordination problems, and visual disturbances. Treatment options depend on the type, size, and location of the tumor, as well as the patient's overall health and age. Treatment may involve surgery, radiation therapy, chemotherapy, or a combination of these approaches.

Carbon dioxide (CO2) is a colorless, odorless gas that is naturally present in the Earth's atmosphere. It is a normal byproduct of cellular respiration in humans, animals, and plants, and is also produced through the combustion of fossil fuels such as coal, oil, and natural gas.

In medical terms, carbon dioxide is often used as a respiratory stimulant and to maintain the pH balance of blood. It is also used during certain medical procedures, such as laparoscopic surgery, to insufflate (inflate) the abdominal cavity and create a working space for the surgeon.

Elevated levels of carbon dioxide in the body can lead to respiratory acidosis, a condition characterized by an increased concentration of carbon dioxide in the blood and a decrease in pH. This can occur in conditions such as chronic obstructive pulmonary disease (COPD), asthma, or other lung diseases that impair breathing and gas exchange. Symptoms of respiratory acidosis may include shortness of breath, confusion, headache, and in severe cases, coma or death.

Gerbillinae is a subfamily of rodents that includes gerbils, jirds, and sand rats. These small mammals are primarily found in arid regions of Africa and Asia. They are characterized by their long hind legs, which they use for hopping, and their long, thin tails. Some species have adapted to desert environments by developing specialized kidneys that allow them to survive on minimal water intake.

I'm sorry for any confusion, but "turtles" is not a medical term. It refers to the group of reptiles that have a shell and include various species such as tortoises and terrapins. If you have any medical concerns or questions, I would be happy to try to help with those!

Peripheral Blood Stem Cell Transplantation (PBSCT) is a medical procedure that involves the transplantation of stem cells, which are immature cells found in the bone marrow that can develop into different types of blood cells. In PBSCT, these stem cells are collected from the peripheral blood instead of directly from the bone marrow.

The process begins with mobilization, where a growth factor medication is given to the donor to stimulate the release of stem cells from the bone marrow into the peripheral blood. After several days, the donor's blood is then removed through a procedure called apheresis, where the stem cells are separated and collected while the remaining blood components are returned to the donor.

The collected stem cells are then infused into the recipient's bloodstream, where they migrate to the bone marrow and begin to repopulate, leading to the production of new blood cells. This procedure is often used as a treatment for various malignant and non-malignant disorders, such as leukemia, lymphoma, multiple myeloma, and aplastic anemia.

PBSCT offers several advantages over traditional bone marrow transplantation, including faster engraftment, lower risk of graft failure, and reduced procedure-related morbidity. However, it also has its own set of challenges, such as the potential for increased incidence of chronic graft-versus-host disease (GVHD) and the need for more stringent HLA matching between donor and recipient.

Autologous transplantation is a medical procedure where cells, tissues, or organs are removed from a person, stored and then returned back to the same individual at a later time. This is different from allogeneic transplantation where the tissue or organ is obtained from another donor. The term "autologous" is derived from the Greek words "auto" meaning self and "logos" meaning study.

In autologous transplantation, the patient's own cells or tissues are used to replace or repair damaged or diseased ones. This reduces the risk of rejection and eliminates the need for immunosuppressive drugs, which are required in allogeneic transplants to prevent the body from attacking the foreign tissue.

Examples of autologous transplantation include:

* Autologous bone marrow or stem cell transplantation, where stem cells are removed from the patient's blood or bone marrow, stored and then reinfused back into the same individual after high-dose chemotherapy or radiation therapy to treat cancer.
* Autologous skin grafting, where a piece of skin is taken from one part of the body and transplanted to another area on the same person.
* Autologous chondrocyte implantation, where cartilage cells are harvested from the patient's own knee, cultured in a laboratory and then implanted back into the knee to repair damaged cartilage.

The cardiovascular system, also known as the circulatory system, is a biological system responsible for pumping and transporting blood throughout the body in animals and humans. It consists of the heart, blood vessels (comprising arteries, veins, and capillaries), and blood. The main function of this system is to transport oxygen, nutrients, hormones, and cellular waste products throughout the body to maintain homeostasis and support organ function.

The heart acts as a muscular pump that contracts and relaxes to circulate blood. It has four chambers: two atria on the top and two ventricles on the bottom. The right side of the heart receives deoxygenated blood from the body, pumps it through the lungs for oxygenation, and then sends it back to the left side of the heart. The left side of the heart then pumps the oxygenated blood through the aorta and into the systemic circulation, reaching all parts of the body via a network of arteries and capillaries. Deoxygenated blood is collected by veins and returned to the right atrium, completing the cycle.

The cardiovascular system plays a crucial role in regulating temperature, pH balance, and fluid balance throughout the body. It also contributes to the immune response and wound healing processes. Dysfunctions or diseases of the cardiovascular system can lead to severe health complications, such as hypertension, coronary artery disease, heart failure, stroke, and peripheral artery disease.

SOXB1 transcription factors are a subgroup of the SOX (SRY-related HMG box) family of transcription factors, which are characterized by a conserved high mobility group (HMG) box DNA-binding domain. The SOXB1 subfamily includes SOX1, SOX2, and SOX3, which play crucial roles during embryonic development and in the maintenance of stem cells. They regulate gene expression by binding to specific DNA sequences and interacting with other transcription factors and cofactors. SOXB1 proteins have been implicated in various biological processes, such as neurogenesis, eye development, and sex determination. Dysregulation of SOXB1 transcription factors has been associated with several human diseases, including cancer.

Consciousness is a complex and multifaceted concept that is difficult to define succinctly, but in a medical or neurological context, it generally refers to an individual's state of awareness and responsiveness to their surroundings. Consciousness involves a range of cognitive processes, including perception, thinking, memory, and attention, and it requires the integration of sensory information, language, and higher-order cognitive functions.

In medical terms, consciousness is often assessed using measures such as the Glasgow Coma Scale, which evaluates an individual's ability to open their eyes, speak, and move in response to stimuli. A coma is a state of deep unconsciousness where an individual is unable to respond to stimuli or communicate, while a vegetative state is a condition where an individual may have sleep-wake cycles and some automatic responses but lacks any meaningful awareness or cognitive function.

Disorders of consciousness can result from brain injury, trauma, infection, or other medical conditions that affect the functioning of the brainstem or cerebral cortex. The study of consciousness is a rapidly evolving field that involves researchers from various disciplines, including neuroscience, psychology, philosophy, and artificial intelligence.

The mediodorsal thalamic nucleus (MDTN) is a collection of neurons located in the dorsal part of the thalamus, a region of the brain that serves as a relay station for sensory and motor signals to the cerebral cortex. The MDTN is primarily involved in cognitive functions such as memory, attention, and emotion regulation.

The MDTN receives inputs from various regions of the brain, including the prefrontal cortex, amygdala, and hippocampus, and projects to the same areas of the cerebral cortex. It has been implicated in several neurological and psychiatric conditions, such as Alzheimer's disease, Parkinson's disease, schizophrenia, and depression.

Anatomically, the MDTN is divided into several subnuclei, including the parvocellular, magnocellular, and intermediate parts, each with distinct connectivity patterns and functions. Overall, the MDTN plays a crucial role in integrating information from different brain regions to facilitate higher-order cognitive processes.

The area postrema is a small, chemoreceptive region located in the caudal part (the back) of the fourth ventricle in the brainstem. It is part of the vomiting center and is sensitive to various stimuli such as chemical substances, emotions, and vestibular signals that can trigger nausea and vomiting. The area postrema is not protected by the blood-brain barrier, allowing it to directly detect toxins and other harmful substances in the bloodstream. This region plays a crucial role in maintaining homeostasis by regulating fluid balance, electrolyte levels, and the elimination of potentially toxic substances from the body.

Glycine receptors (GlyRs) are ligand-gated ion channel proteins that play a crucial role in mediating inhibitory neurotransmission in the central nervous system. They belong to the Cys-loop family of receptors, which also includes GABA(A), nicotinic acetylcholine, and serotonin receptors.

GlyRs are composed of pentameric assemblies of subunits, with four different subunit isoforms (α1, α2, α3, and β) identified in vertebrates. The most common GlyR composition consists of α and β subunits, although homomeric receptors composed solely of α subunits can also be formed.

When glycine binds to the orthosteric site on the extracellular domain of the receptor, it triggers a conformational change that leads to the opening of an ion channel, allowing chloride ions (Cl-) to flow through and hyperpolarize the neuronal membrane. This inhibitory neurotransmission is essential for regulating synaptic excitability, controlling motor function, and modulating sensory processing in the brainstem, spinal cord, and other regions of the central nervous system.

Dysfunction of GlyRs has been implicated in various neurological disorders, including hyperekplexia (startle disease), epilepsy, chronic pain, and neurodevelopmental conditions such as autism spectrum disorder.

Green Fluorescent Protein (GFP) is not a medical term per se, but a scientific term used in the field of molecular biology. GFP is a protein that exhibits bright green fluorescence when exposed to light, particularly blue or ultraviolet light. It was originally discovered in the jellyfish Aequorea victoria.

In medical and biological research, scientists often use recombinant DNA technology to introduce the gene for GFP into other organisms, including bacteria, plants, and animals, including humans. This allows them to track the expression and localization of specific genes or proteins of interest in living cells, tissues, or even whole organisms.

The ability to visualize specific cellular structures or processes in real-time has proven invaluable for a wide range of research areas, from studying the development and function of organs and organ systems to understanding the mechanisms of diseases and the effects of therapeutic interventions.

Cell survival refers to the ability of a cell to continue living and functioning normally, despite being exposed to potentially harmful conditions or treatments. This can include exposure to toxins, radiation, chemotherapeutic drugs, or other stressors that can damage cells or interfere with their normal processes.

In scientific research, measures of cell survival are often used to evaluate the effectiveness of various therapies or treatments. For example, researchers may expose cells to a particular drug or treatment and then measure the percentage of cells that survive to assess its potential therapeutic value. Similarly, in toxicology studies, measures of cell survival can help to determine the safety of various chemicals or substances.

It's important to note that cell survival is not the same as cell proliferation, which refers to the ability of cells to divide and multiply. While some treatments may promote cell survival, they may also inhibit cell proliferation, making them useful for treating diseases such as cancer. Conversely, other treatments may be designed to specifically target and kill cancer cells, even if it means sacrificing some healthy cells in the process.

The facial nerve, also known as the seventh cranial nerve (CN VII), is a mixed nerve that carries both sensory and motor fibers. Its functions include controlling the muscles involved in facial expressions, taste sensation from the anterior two-thirds of the tongue, and secretomotor function to the lacrimal and salivary glands.

The facial nerve originates from the brainstem and exits the skull through the internal acoustic meatus. It then passes through the facial canal in the temporal bone before branching out to innervate various structures of the face. The main branches of the facial nerve include:

1. Temporal branch: Innervates the frontalis, corrugator supercilii, and orbicularis oculi muscles responsible for eyebrow movements and eyelid closure.
2. Zygomatic branch: Supplies the muscles that elevate the upper lip and wrinkle the nose.
3. Buccal branch: Innervates the muscles of the cheek and lips, allowing for facial expressions such as smiling and puckering.
4. Mandibular branch: Controls the muscles responsible for lower lip movement and depressing the angle of the mouth.
5. Cervical branch: Innervates the platysma muscle in the neck, which helps to depress the lower jaw and wrinkle the skin of the neck.

Damage to the facial nerve can result in various symptoms, such as facial weakness or paralysis, loss of taste sensation, and dry eyes or mouth due to impaired secretion.

Excitatory amino acid antagonists are a class of drugs that block the action of excitatory neurotransmitters, particularly glutamate and aspartate, in the brain. These drugs work by binding to and blocking the receptors for these neurotransmitters, thereby reducing their ability to stimulate neurons and produce an excitatory response.

Excitatory amino acid antagonists have been studied for their potential therapeutic benefits in a variety of neurological conditions, including stroke, epilepsy, traumatic brain injury, and neurodegenerative disorders such as Alzheimer's disease and Parkinson's disease. However, their use is limited by the fact that blocking excitatory neurotransmission can also have negative effects on cognitive function and memory.

There are several types of excitatory amino acid receptors, including N-methyl-D-aspartate (NMDA), alpha-amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid (AMPA), and kainite receptors. Different excitatory amino acid antagonists may target one or more of these receptor subtypes, depending on their specific mechanism of action.

Examples of excitatory amino acid antagonists include ketamine, memantine, and dextromethorphan. These drugs have been used in clinical practice for various indications, such as anesthesia, sedation, and treatment of neurological disorders. However, their use must be carefully monitored due to potential side effects and risks associated with blocking excitatory neurotransmission.

Neurotransmitter agents are substances that affect the synthesis, storage, release, uptake, degradation, or reuptake of neurotransmitters, which are chemical messengers that transmit signals across a chemical synapse from one neuron to another. These agents can be either agonists, which mimic the action of a neurotransmitter and bind to its receptor, or antagonists, which block the action of a neurotransmitter by binding to its receptor without activating it. They are used in medicine to treat various neurological and psychiatric disorders, such as depression, anxiety, and Parkinson's disease.

"Macaca mulatta" is the scientific name for the Rhesus macaque, a species of monkey that is native to South, Central, and Southeast Asia. They are often used in biomedical research due to their genetic similarity to humans.

Nerve degeneration, also known as neurodegeneration, is the progressive loss of structure and function of neurons, which can lead to cognitive decline, motor impairment, and various other symptoms. This process occurs due to a variety of factors, including genetics, environmental influences, and aging. It is a key feature in several neurological disorders such as Alzheimer's disease, Parkinson's disease, Huntington's disease, and multiple sclerosis. The degeneration can affect any part of the nervous system, leading to different symptoms depending on the location and extent of the damage.

An axon is a long, slender extension of a neuron (a type of nerve cell) that conducts electrical impulses (nerve impulses) away from the cell body to target cells, such as other neurons or muscle cells. Axons can vary in length from a few micrometers to over a meter long and are typically surrounded by a myelin sheath, which helps to insulate and protect the axon and allows for faster transmission of nerve impulses.

Axons play a critical role in the functioning of the nervous system, as they provide the means by which neurons communicate with one another and with other cells in the body. Damage to axons can result in serious neurological problems, such as those seen in spinal cord injuries or neurodegenerative diseases like multiple sclerosis.

"Age factors" refer to the effects, changes, or differences that age can have on various aspects of health, disease, and medical care. These factors can encompass a wide range of issues, including:

1. Physiological changes: As people age, their bodies undergo numerous physical changes that can affect how they respond to medications, illnesses, and medical procedures. For example, older adults may be more sensitive to certain drugs or have weaker immune systems, making them more susceptible to infections.
2. Chronic conditions: Age is a significant risk factor for many chronic diseases, such as heart disease, diabetes, cancer, and arthritis. As a result, age-related medical issues are common and can impact treatment decisions and outcomes.
3. Cognitive decline: Aging can also lead to cognitive changes, including memory loss and decreased decision-making abilities. These changes can affect a person's ability to understand and comply with medical instructions, leading to potential complications in their care.
4. Functional limitations: Older adults may experience physical limitations that impact their mobility, strength, and balance, increasing the risk of falls and other injuries. These limitations can also make it more challenging for them to perform daily activities, such as bathing, dressing, or cooking.
5. Social determinants: Age-related factors, such as social isolation, poverty, and lack of access to transportation, can impact a person's ability to obtain necessary medical care and affect their overall health outcomes.

Understanding age factors is critical for healthcare providers to deliver high-quality, patient-centered care that addresses the unique needs and challenges of older adults. By taking these factors into account, healthcare providers can develop personalized treatment plans that consider a person's age, physical condition, cognitive abilities, and social circumstances.

Neural inhibition is a process in the nervous system that decreases or prevents the activity of neurons (nerve cells) in order to regulate and control communication within the nervous system. It is a fundamental mechanism that allows for the balance of excitation and inhibition necessary for normal neural function. Inhibitory neurotransmitters, such as GABA (gamma-aminobutyric acid) and glycine, are released from the presynaptic neuron and bind to receptors on the postsynaptic neuron, reducing its likelihood of firing an action potential. This results in a decrease in neural activity and can have various effects depending on the specific neurons and brain regions involved. Neural inhibition is crucial for many functions including motor control, sensory processing, attention, memory, and emotional regulation.

The cerebellopontine angle (CPA) is a narrow space located at the junction of the brainstem and the cerebellum, where the pons and cerebellum meet. This region is filled with several important nerves, blood vessels, and membranous coverings called meninges. The CPA is a common site for various neurological disorders because it contains critical structures such as:

1. Cerebellum: A part of the brain responsible for coordinating muscle movements, maintaining balance, and fine-tuning motor skills.
2. Pons: A portion of the brainstem that plays a role in several vital functions, including facial movements, taste sensation, sleep regulation, and respiration.
3. Cranial nerves: The CPA is home to the following cranial nerves:
* Vestibulocochlear nerve (CN VIII): This nerve has two components - cochlear and vestibular. The cochlear part is responsible for hearing, while the vestibular part contributes to balance and eye movement.
* Facial nerve (CN VII): This nerve controls facial expressions, taste sensation in the anterior two-thirds of the tongue, salivary gland function, and lacrimation (tear production).
4. Blood vessels: The CPA contains critical blood vessels like the anterior inferior cerebellar artery (AICA), which supplies blood to various parts of the brainstem, cerebellum, and cranial nerves.
5. Meninges: These are protective membranes surrounding the brain and spinal cord. In the CPA, the meninges include the dura mater, arachnoid mater, and pia mater.

Disorders that can affect the structures in the cerebellopontine angle include acoustic neuromas (vestibular schwannomas), meningiomas, epidermoids, and arteriovenous malformations. These conditions may cause symptoms such as hearing loss, tinnitus (ringing in the ears), vertigo (dizziness), facial weakness or numbness, difficulty swallowing, and imbalance.

Iontophoresis is a medical technique in which a mild electrical current is used to deliver medications through the skin. This process enhances the absorption of medication into the body, allowing it to reach deeper tissues that may not be accessible through topical applications alone. Iontophoresis is often used for local treatment of conditions such as inflammation, pain, or spasms, and is particularly useful in treating conditions affecting the hands and feet, like hyperhidrosis (excessive sweating). The medications used in iontophoresis are typically anti-inflammatory drugs, anesthetics, or corticosteroids.

Hypertensive encephalopathy is a serious neurological condition that occurs due to extremely high blood pressure, which is not adequately controlled. This leads to the leakage of fluid and blood into the brain (cerebral edema) and disrupts the normal functioning of the brain. Symptoms may include severe headache, nausea, vomiting, confusion, seizures, visual disturbances, and in severe cases, coma. Immediate medical attention is required to reduce blood pressure and prevent potential long-term damage or even death.

Ocular motility disorders refer to a group of conditions that affect the movement of the eyes. These disorders can result from nerve damage, muscle dysfunction, or brain injuries. They can cause abnormal eye alignment, limited range of motion, and difficulty coordinating eye movements. Common symptoms include double vision, blurry vision, strabismus (crossed eyes), nystagmus (involuntary eye movement), and difficulty tracking moving objects. Ocular motility disorders can be congenital or acquired and may require medical intervention to correct or manage the condition.

The cerebral aqueduct, also known as the aqueduct of Sylvius, is a narrow canal that connects the third and fourth ventricles (cavities) of the brain. It allows for the flow of cerebrospinal fluid (CSF) from the third ventricle to the fourth ventricle. The cerebral aqueduct is a critical component of the ventricular system of the brain, and any obstruction or abnormality in this region can result in an accumulation of CSF and increased pressure within the brain, which can lead to serious neurological symptoms and conditions such as hydrocephalus.

Homologous transplantation is a type of transplant surgery where organs or tissues are transferred between two genetically non-identical individuals of the same species. The term "homologous" refers to the similarity in structure and function of the donated organ or tissue to the recipient's own organ or tissue.

For example, a heart transplant from one human to another is an example of homologous transplantation because both organs are hearts and perform the same function. Similarly, a liver transplant, kidney transplant, lung transplant, and other types of organ transplants between individuals of the same species are also considered homologous transplantations.

Homologous transplantation is in contrast to heterologous or xenogeneic transplantation, where organs or tissues are transferred from one species to another, such as a pig heart transplanted into a human. Homologous transplantation is more commonly performed than heterologous transplantation due to the increased risk of rejection and other complications associated with xenogeneic transplants.

Cognition refers to the mental processes involved in acquiring, processing, and utilizing information. These processes include perception, attention, memory, language, problem-solving, and decision-making. Cognitive functions allow us to interact with our environment, understand and respond to stimuli, learn new skills, and remember experiences.

In a medical context, cognitive function is often assessed as part of a neurological or psychiatric evaluation. Impairments in cognition can be caused by various factors, such as brain injury, neurodegenerative diseases (e.g., Alzheimer's disease), infections, toxins, and mental health conditions. Assessing cognitive function helps healthcare professionals diagnose conditions, monitor disease progression, and develop treatment plans.

Transcription factors are proteins that play a crucial role in regulating gene expression by controlling the transcription of DNA to messenger RNA (mRNA). They function by binding to specific DNA sequences, known as response elements, located in the promoter region or enhancer regions of target genes. This binding can either activate or repress the initiation of transcription, depending on the properties and interactions of the particular transcription factor. Transcription factors often act as part of a complex network of regulatory proteins that determine the precise spatiotemporal patterns of gene expression during development, differentiation, and homeostasis in an organism.

SCID mice is an acronym for Severe Combined Immunodeficiency mice. These are genetically modified mice that lack a functional immune system due to the mutation or knockout of several key genes required for immunity. This makes them ideal for studying the human immune system, infectious diseases, and cancer, as well as testing new therapies and treatments in a controlled environment without the risk of interference from the mouse's own immune system. SCID mice are often used in xenotransplantation studies, where human cells or tissues are transplanted into the mouse to study their behavior and interactions with the human immune system.

Horseradish peroxidase (HRP) is not a medical term, but a type of enzyme that is derived from the horseradish plant. In biological terms, HRP is defined as a heme-containing enzyme isolated from the roots of the horseradish plant (Armoracia rusticana). It is widely used in molecular biology and diagnostic applications due to its ability to catalyze various oxidative reactions, particularly in immunological techniques such as Western blotting and ELISA.

HRP catalyzes the conversion of hydrogen peroxide into water and oxygen, while simultaneously converting a variety of substrates into colored or fluorescent products that can be easily detected. This enzymatic activity makes HRP a valuable tool in detecting and quantifying specific biomolecules, such as proteins and nucleic acids, in biological samples.

Cerebrospinal fluid (CSF) is a clear, colorless fluid that surrounds and protects the brain and spinal cord. It acts as a shock absorber for the central nervous system and provides nutrients to the brain while removing waste products. CSF is produced by specialized cells called ependymal cells in the choroid plexus of the ventricles (fluid-filled spaces) inside the brain. From there, it circulates through the ventricular system and around the outside of the brain and spinal cord before being absorbed back into the bloodstream. CSF analysis is an important diagnostic tool for various neurological conditions, including infections, inflammation, and cancer.

Glioblastoma, also known as Glioblastoma multiforme (GBM), is a highly aggressive and malignant type of brain tumor that arises from the glial cells in the brain. These tumors are characterized by their rapid growth, invasion into surrounding brain tissue, and resistance to treatment.

Glioblastomas are composed of various cell types, including astrocytes and other glial cells, which make them highly heterogeneous and difficult to treat. They typically have a poor prognosis, with a median survival rate of 14-15 months from the time of diagnosis, even with aggressive treatment.

Symptoms of glioblastoma can vary depending on the location and size of the tumor but may include headaches, seizures, nausea, vomiting, memory loss, difficulty speaking or understanding speech, changes in personality or behavior, and weakness or paralysis on one side of the body.

Standard treatment for glioblastoma typically involves surgical resection of the tumor, followed by radiation therapy and chemotherapy with temozolomide. However, despite these treatments, glioblastomas often recur, leading to a poor overall prognosis.

In the context of medicine, "periodicity" refers to the occurrence of events or phenomena at regular intervals or cycles. This term is often used in reference to recurring symptoms or diseases that have a pattern of appearing and disappearing over time. For example, some medical conditions like menstrual cycles, sleep-wake disorders, and certain infectious diseases exhibit periodicity. It's important to note that the duration and frequency of these cycles can vary depending on the specific condition or individual.

A newborn infant is a baby who is within the first 28 days of life. This period is also referred to as the neonatal period. Newborns require specialized care and attention due to their immature bodily systems and increased vulnerability to various health issues. They are closely monitored for signs of well-being, growth, and development during this critical time.

An injection is a medical procedure in which a medication, vaccine, or other substance is introduced into the body using a needle and syringe. The substance can be delivered into various parts of the body, including into a vein (intravenous), muscle (intramuscular), under the skin (subcutaneous), or into the spinal canal (intrathecal or spinal).

Injections are commonly used to administer medications that cannot be taken orally, have poor oral bioavailability, need to reach the site of action quickly, or require direct delivery to a specific organ or tissue. They can also be used for diagnostic purposes, such as drawing blood samples (venipuncture) or injecting contrast agents for imaging studies.

Proper technique and sterile conditions are essential when administering injections to prevent infection, pain, and other complications. The choice of injection site depends on the type and volume of the substance being administered, as well as the patient's age, health status, and personal preferences.

A brain concussion is a type of traumatic brain injury that is typically caused by a blow to the head or a violent shaking of the head and body. A concussion can also occur from a fall or accident that causes the head to suddenly jerk forward or backward.

The impact or forceful movement causes the brain to move back and forth inside the skull, which can result in stretching and damaging of brain cells, as well as disrupting the normal functioning of the brain. Concussions can range from mild to severe and may cause a variety of symptoms, including:

* Headache or a feeling of pressure in the head
* Temporary loss of consciousness
* Confusion or fogginess
* Amnesia surrounding the traumatic event
* Dizziness or "seeing stars"
* Ringing in the ears
* Nausea or vomiting
* Slurred speech
* Fatigue

In some cases, concussions may also cause more serious symptoms, such as seizures, difficulty walking, loss of balance, and changes in behavior or mood. It is important to seek medical attention immediately if you suspect that you or someone else has a brain concussion. A healthcare professional can evaluate the severity of the injury and provide appropriate treatment and follow-up care.

Homeodomain proteins are a group of transcription factors that play crucial roles in the development and differentiation of cells in animals and plants. They are characterized by the presence of a highly conserved DNA-binding domain called the homeodomain, which is typically about 60 amino acids long. The homeodomain consists of three helices, with the third helix responsible for recognizing and binding to specific DNA sequences.

Homeodomain proteins are involved in regulating gene expression during embryonic development, tissue maintenance, and organismal growth. They can act as activators or repressors of transcription, depending on the context and the presence of cofactors. Mutations in homeodomain proteins have been associated with various human diseases, including cancer, congenital abnormalities, and neurological disorders.

Some examples of homeodomain proteins include PAX6, which is essential for eye development, HOX genes, which are involved in body patterning, and NANOG, which plays a role in maintaining pluripotency in stem cells.

Afferent neurons, also known as sensory neurons, are a type of nerve cell that conducts impulses or signals from peripheral receptors towards the central nervous system (CNS), which includes the brain and spinal cord. These neurons are responsible for transmitting sensory information such as touch, temperature, pain, sound, and light to the CNS for processing and interpretation. Afferent neurons have specialized receptor endings that detect changes in the environment and convert them into electrical signals, which are then transmitted to the CNS via synapses with other neurons. Once the signals reach the CNS, they are processed and integrated with other information to produce a response or reaction to the stimulus.

In the context of medicine and pharmacology, "kinetics" refers to the study of how a drug moves throughout the body, including its absorption, distribution, metabolism, and excretion (often abbreviated as ADME). This field is called "pharmacokinetics."

1. Absorption: This is the process of a drug moving from its site of administration into the bloodstream. Factors such as the route of administration (e.g., oral, intravenous, etc.), formulation, and individual physiological differences can affect absorption.

2. Distribution: Once a drug is in the bloodstream, it gets distributed throughout the body to various tissues and organs. This process is influenced by factors like blood flow, protein binding, and lipid solubility of the drug.

3. Metabolism: Drugs are often chemically modified in the body, typically in the liver, through processes known as metabolism. These changes can lead to the formation of active or inactive metabolites, which may then be further distributed, excreted, or undergo additional metabolic transformations.

4. Excretion: This is the process by which drugs and their metabolites are eliminated from the body, primarily through the kidneys (urine) and the liver (bile).

Understanding the kinetics of a drug is crucial for determining its optimal dosing regimen, potential interactions with other medications or foods, and any necessary adjustments for special populations like pediatric or geriatric patients, or those with impaired renal or hepatic function.

Hydrocephalus is a medical condition characterized by an abnormal accumulation of cerebrospinal fluid (CSF) within the brain, leading to an increase in intracranial pressure and potentially causing damage to the brain tissues. This excessive buildup of CSF can result from either overproduction or impaired absorption of the fluid, which typically causes the ventricles (fluid-filled spaces) inside the brain to expand and put pressure on surrounding brain structures.

The condition can be congenital, present at birth due to genetic factors or abnormalities during fetal development, or acquired later in life as a result of injuries, infections, tumors, or other disorders affecting the brain's ability to regulate CSF flow and absorption. Symptoms may vary depending on age, severity, and duration but often include headaches, vomiting, balance problems, vision issues, cognitive impairment, and changes in behavior or personality.

Treatment for hydrocephalus typically involves surgically implanting a shunt system that diverts the excess CSF from the brain to another part of the body where it can be absorbed, such as the abdominal cavity. In some cases, endoscopic third ventriculostomy (ETV) might be an alternative treatment option, creating a new pathway for CSF flow within the brain. Regular follow-ups with neurosurgeons and other healthcare professionals are essential to monitor the condition and make any necessary adjustments to the treatment plan.

Body temperature is the measure of heat produced by the body. In humans, the normal body temperature range is typically between 97.8°F (36.5°C) and 99°F (37.2°C), with an average oral temperature of 98.6°F (37°C). Body temperature can be measured in various ways, including orally, rectally, axillary (under the arm), and temporally (on the forehead).

Maintaining a stable body temperature is crucial for proper bodily functions, as enzymes and other biological processes depend on specific temperature ranges. The hypothalamus region of the brain regulates body temperature through feedback mechanisms that involve shivering to produce heat and sweating to release heat. Fever is a common medical sign characterized by an elevated body temperature above the normal range, often as a response to infection or inflammation.

Cerebrovascular disorders are a group of medical conditions that affect the blood vessels of the brain. These disorders can be caused by narrowing, blockage, or rupture of the blood vessels, leading to decreased blood flow and oxygen supply to the brain. The most common types of cerebrovascular disorders include:

1. Stroke: A stroke occurs when a blood vessel in the brain becomes blocked or bursts, causing a lack of oxygen and nutrients to reach brain cells. This can lead to permanent damage or death of brain tissue.
2. Transient ischemic attack (TIA): Also known as a "mini-stroke," a TIA occurs when blood flow to the brain is temporarily blocked, often by a blood clot. Symptoms may last only a few minutes to a few hours and typically resolve on their own. However, a TIA is a serious warning sign that a full-blown stroke may occur in the future.
3. Aneurysm: An aneurysm is a weakened or bulging area in the wall of a blood vessel. If left untreated, an aneurysm can rupture and cause bleeding in the brain.
4. Arteriovenous malformation (AVM): An AVM is a tangled mass of abnormal blood vessels that connect arteries and veins. This can lead to bleeding in the brain or stroke.
5. Carotid stenosis: Carotid stenosis occurs when the carotid arteries, which supply blood to the brain, become narrowed or blocked due to plaque buildup. This can increase the risk of stroke.
6. Vertebrobasilar insufficiency: This condition occurs when the vertebral and basilar arteries, which supply blood to the back of the brain, become narrowed or blocked. This can lead to symptoms such as dizziness, vertigo, and difficulty swallowing.

Cerebrovascular disorders are a leading cause of disability and death worldwide. Risk factors for these conditions include age, high blood pressure, smoking, diabetes, high cholesterol, and family history. Treatment may involve medications, surgery, or lifestyle changes to reduce the risk of further complications.

Cell movement, also known as cell motility, refers to the ability of cells to move independently and change their location within tissue or inside the body. This process is essential for various biological functions, including embryonic development, wound healing, immune responses, and cancer metastasis.

There are several types of cell movement, including:

1. **Crawling or mesenchymal migration:** Cells move by extending and retracting protrusions called pseudopodia or filopodia, which contain actin filaments. This type of movement is common in fibroblasts, immune cells, and cancer cells during tissue invasion and metastasis.
2. **Amoeboid migration:** Cells move by changing their shape and squeezing through tight spaces without forming protrusions. This type of movement is often observed in white blood cells (leukocytes) as they migrate through the body to fight infections.
3. **Pseudopodial extension:** Cells extend pseudopodia, which are temporary cytoplasmic projections containing actin filaments. These protrusions help the cell explore its environment and move forward.
4. **Bacterial flagellar motion:** Bacteria use a whip-like structure called a flagellum to propel themselves through their environment. The rotation of the flagellum is driven by a molecular motor in the bacterial cell membrane.
5. **Ciliary and ependymal movement:** Ciliated cells, such as those lining the respiratory tract and fallopian tubes, have hair-like structures called cilia that beat in coordinated waves to move fluids or mucus across the cell surface.

Cell movement is regulated by a complex interplay of signaling pathways, cytoskeletal rearrangements, and adhesion molecules, which enable cells to respond to environmental cues and navigate through tissues.

Neuroprotective agents are substances that protect neurons or nerve cells from damage, degeneration, or death caused by various factors such as trauma, inflammation, oxidative stress, or excitotoxicity. These agents work through different mechanisms, including reducing the production of free radicals, inhibiting the release of glutamate (a neurotransmitter that can cause cell damage in high concentrations), promoting the growth and survival of neurons, and preventing apoptosis (programmed cell death). Neuroprotective agents have been studied for their potential to treat various neurological disorders, including stroke, traumatic brain injury, Parkinson's disease, Alzheimer's disease, and multiple sclerosis. However, more research is needed to fully understand their mechanisms of action and to develop effective therapies.

Central nervous system (CNS) diseases refer to medical conditions that primarily affect the brain and spinal cord. The CNS is responsible for controlling various functions in the body, including movement, sensation, cognition, and behavior. Therefore, diseases of the CNS can have significant impacts on a person's quality of life and overall health.

There are many different types of CNS diseases, including:

1. Infectious diseases: These are caused by viruses, bacteria, fungi, or parasites that infect the brain or spinal cord. Examples include meningitis, encephalitis, and polio.
2. Neurodegenerative diseases: These are characterized by progressive loss of nerve cells in the brain or spinal cord. Examples include Alzheimer's disease, Parkinson's disease, and Huntington's disease.
3. Structural diseases: These involve damage to the physical structure of the brain or spinal cord, such as from trauma, tumors, or stroke.
4. Functional diseases: These affect the function of the nervous system without obvious structural damage, such as multiple sclerosis and epilepsy.
5. Genetic disorders: Some CNS diseases are caused by genetic mutations, such as spinal muscular atrophy and Friedreich's ataxia.

Symptoms of CNS diseases can vary widely depending on the specific condition and the area of the brain or spinal cord that is affected. They may include muscle weakness, paralysis, seizures, loss of sensation, difficulty with coordination and balance, confusion, memory loss, changes in behavior or mood, and pain. Treatment for CNS diseases depends on the specific condition and may involve medications, surgery, rehabilitation therapy, or a combination of these approaches.

A seizure is an uncontrolled, abnormal firing of neurons (brain cells) that can cause various symptoms such as convulsions, loss of consciousness, altered awareness, or changes in behavior. Seizures can be caused by a variety of factors including epilepsy, brain injury, infection, toxic substances, or genetic disorders. They can also occur without any identifiable cause, known as idiopathic seizures. Seizures are a medical emergency and require immediate attention.

Psychomotor performance refers to the integration and coordination of mental processes (cognitive functions) with physical movements. It involves the ability to perform complex tasks that require both cognitive skills, such as thinking, remembering, and perceiving, and motor skills, such as gross and fine motor movements. Examples of psychomotor performances include driving a car, playing a musical instrument, or performing surgical procedures.

In a medical context, psychomotor performance is often used to assess an individual's ability to perform activities of daily living (ADLs) and instrumental activities of daily living (IADLs), such as bathing, dressing, cooking, cleaning, and managing medications. Deficits in psychomotor performance can be a sign of neurological or psychiatric disorders, such as dementia, Parkinson's disease, or depression.

Assessment of psychomotor performance may involve tests that measure reaction time, coordination, speed, precision, and accuracy of movements, as well as cognitive functions such as attention, memory, and problem-solving skills. These assessments can help healthcare professionals develop appropriate treatment plans and monitor the progression of diseases or the effectiveness of interventions.

The sympathetic nervous system (SNS) is a part of the autonomic nervous system that operates largely below the level of consciousness, and it functions to produce appropriate physiological responses to perceived danger. It's often associated with the "fight or flight" response. The SNS uses nerve impulses to stimulate target organs, causing them to speed up (e.g., increased heart rate), prepare for action, or otherwise respond to stressful situations.

The sympathetic nervous system is activated due to stressful emotional or physical situations and it prepares the body for immediate actions. It dilates the pupils, increases heart rate and blood pressure, accelerates breathing, and slows down digestion. The primary neurotransmitter involved in this system is norepinephrine (also known as noradrenaline).

Ophthalmoplegia is a medical term that refers to the paralysis or weakness of the eye muscles, which can result in double vision (diplopia) or difficulty moving the eyes. It can be caused by various conditions, including nerve damage, muscle disorders, or neurological diseases such as myasthenia gravis or multiple sclerosis. Ophthalmoplegia can affect one or more eye muscles and can be partial or complete. Depending on the underlying cause, ophthalmoplegia may be treatable with medications, surgery, or other interventions.

Sensitivity and specificity are statistical measures used to describe the performance of a diagnostic test or screening tool in identifying true positive and true negative results.

* Sensitivity refers to the proportion of people who have a particular condition (true positives) who are correctly identified by the test. It is also known as the "true positive rate" or "recall." A highly sensitive test will identify most or all of the people with the condition, but may also produce more false positives.
* Specificity refers to the proportion of people who do not have a particular condition (true negatives) who are correctly identified by the test. It is also known as the "true negative rate." A highly specific test will identify most or all of the people without the condition, but may also produce more false negatives.

In medical testing, both sensitivity and specificity are important considerations when evaluating a diagnostic test. High sensitivity is desirable for screening tests that aim to identify as many cases of a condition as possible, while high specificity is desirable for confirmatory tests that aim to rule out the condition in people who do not have it.

It's worth noting that sensitivity and specificity are often influenced by factors such as the prevalence of the condition in the population being tested, the threshold used to define a positive result, and the reliability and validity of the test itself. Therefore, it's important to consider these factors when interpreting the results of a diagnostic test.

Heart rate is the number of heartbeats per unit of time, often expressed as beats per minute (bpm). It can vary significantly depending on factors such as age, physical fitness, emotions, and overall health status. A resting heart rate between 60-100 bpm is generally considered normal for adults, but athletes and individuals with high levels of physical fitness may have a resting heart rate below 60 bpm due to their enhanced cardiovascular efficiency. Monitoring heart rate can provide valuable insights into an individual's health status, exercise intensity, and response to various treatments or interventions.

Retrospective studies, also known as retrospective research or looking back studies, are a type of observational study that examines data from the past to draw conclusions about possible causal relationships between risk factors and outcomes. In these studies, researchers analyze existing records, medical charts, or previously collected data to test a hypothesis or answer a specific research question.

Retrospective studies can be useful for generating hypotheses and identifying trends, but they have limitations compared to prospective studies, which follow participants forward in time from exposure to outcome. Retrospective studies are subject to biases such as recall bias, selection bias, and information bias, which can affect the validity of the results. Therefore, retrospective studies should be interpreted with caution and used primarily to generate hypotheses for further testing in prospective studies.

A Colony-Forming Units (CFU) assay is a type of laboratory test used to measure the number of viable, or living, cells in a sample. It is commonly used to enumerate bacteria, yeast, and other microorganisms. The test involves placing a known volume of the sample onto a nutrient-agar plate, which provides a solid growth surface for the cells. The plate is then incubated under conditions that allow the cells to grow and form colonies. Each colony that forms on the plate represents a single viable cell from the original sample. By counting the number of colonies and multiplying by the known volume of the sample, the total number of viable cells in the sample can be calculated. This information is useful in a variety of applications, including monitoring microbial populations, assessing the effectiveness of disinfection procedures, and studying microbial growth and survival.

Emission computed tomography (ECT) is a type of tomographic imaging technique in which an emission signal from within the body is detected to create cross-sectional images of that signal's distribution. In Emission-Computed Tomography (ECT), a radionuclide is introduced into the body, usually through injection, inhalation or ingestion. The radionuclide emits gamma rays that are then detected by external gamma cameras.

The data collected from these cameras is then used to create cross-sectional images of the distribution of the radiopharmaceutical within the body. This allows for the identification and quantification of functional information about specific organs or systems within the body, such as blood flow, metabolic activity, or receptor density.

One common type of Emission-Computed Tomography is Single Photon Emission Computed Tomography (SPECT), which uses a single gamma camera that rotates around the patient to collect data from multiple angles. Another type is Positron Emission Tomography (PET), which uses positron-emitting radionuclides and detects the coincident gamma rays emitted by the annihilation of positrons and electrons.

Overall, ECT is a valuable tool in medical imaging for diagnosing and monitoring various diseases, including cancer, heart disease, and neurological disorders.

The Glasgow Coma Scale (GCS) is a standardized tool used by healthcare professionals to assess the level of consciousness and neurological response in a person who has suffered a brain injury or illness. It evaluates three aspects of a patient's responsiveness: eye opening, verbal response, and motor response. The scores from these three categories are then added together to provide an overall GCS score, which can range from 3 (indicating deep unconsciousness) to 15 (indicating a normal level of consciousness). This scale helps medical professionals to quickly and consistently communicate the severity of a patient's condition and monitor their progress over time.

Tyrosine 3-Monooxygenase (also known as Tyrosinase or Tyrosine hydroxylase) is an enzyme that plays a crucial role in the synthesis of catecholamines, which are neurotransmitters and hormones in the body. This enzyme catalyzes the conversion of the amino acid L-tyrosine to 3,4-dihydroxyphenylalanine (L-DOPA) by adding a hydroxyl group to the 3rd carbon atom of the tyrosine molecule.

The reaction is as follows:

L-Tyrosine + O2 + pterin (co-factor) -> L-DOPA + pterin (oxidized) + H2O

This enzyme requires molecular oxygen and a co-factor such as tetrahydrobiopterin to carry out the reaction. Tyrosine 3-Monooxygenase is found in various tissues, including the brain and adrenal glands, where it helps regulate the production of catecholamines like dopamine, norepinephrine, and epinephrine. Dysregulation of this enzyme has been implicated in several neurological disorders, such as Parkinson's disease.

Myelinated nerve fibers are neuronal processes that are surrounded by a myelin sheath, a fatty insulating substance that is produced by Schwann cells in the peripheral nervous system and oligodendrocytes in the central nervous system. This myelin sheath helps to increase the speed of electrical impulse transmission, also known as action potentials, along the nerve fiber. The myelin sheath has gaps called nodes of Ranvier where the electrical impulses can jump from one node to the next, which also contributes to the rapid conduction of signals. Myelinated nerve fibers are typically found in the peripheral nerves and the optic nerve, but not in the central nervous system (CNS) tracts that are located within the brain and spinal cord.

Leigh Disease, also known as Subacute Necrotizing Encephalomyelopathy (SNE), is a rare inherited neurometabolic disorder that affects the central nervous system. It is characterized by progressive degeneration of the brain and spinal cord. The condition typically appears in infancy or early childhood, although it can develop in adolescence or adulthood.

Leigh Disease is caused by mutations in mitochondrial DNA or nuclear genes that disrupt the function of the oxidative phosphorylation system, a part of the cellular energy production process. This results in decreased ATP (adenosine triphosphate) production and an accumulation of lactic acid in the body.

The symptoms of Leigh Disease can vary widely but often include vomiting, seizures, developmental delays, muscle weakness, loss of muscle tone, and difficulty swallowing and breathing. The condition can also cause lesions to form on the brainstem and basal ganglia, which can lead to further neurological problems.

There is no cure for Leigh Disease, and treatment is focused on managing symptoms and supporting affected individuals as they cope with the progression of the disease.

Reverse Transcriptase Polymerase Chain Reaction (RT-PCR) is a laboratory technique used in molecular biology to amplify and detect specific DNA sequences. This technique is particularly useful for the detection and quantification of RNA viruses, as well as for the analysis of gene expression.

The process involves two main steps: reverse transcription and polymerase chain reaction (PCR). In the first step, reverse transcriptase enzyme is used to convert RNA into complementary DNA (cDNA) by reading the template provided by the RNA molecule. This cDNA then serves as a template for the PCR amplification step.

In the second step, the PCR reaction uses two primers that flank the target DNA sequence and a thermostable polymerase enzyme to repeatedly copy the targeted cDNA sequence. The reaction mixture is heated and cooled in cycles, allowing the primers to anneal to the template, and the polymerase to extend the new strand. This results in exponential amplification of the target DNA sequence, making it possible to detect even small amounts of RNA or cDNA.

RT-PCR is a sensitive and specific technique that has many applications in medical research and diagnostics, including the detection of viruses such as HIV, hepatitis C virus, and SARS-CoV-2 (the virus that causes COVID-19). It can also be used to study gene expression, identify genetic mutations, and diagnose genetic disorders.

Reference values, also known as reference ranges or reference intervals, are the set of values that are considered normal or typical for a particular population or group of people. These values are often used in laboratory tests to help interpret test results and determine whether a patient's value falls within the expected range.

The process of establishing reference values typically involves measuring a particular biomarker or parameter in a large, healthy population and then calculating the mean and standard deviation of the measurements. Based on these statistics, a range is established that includes a certain percentage of the population (often 95%) and excludes extreme outliers.

It's important to note that reference values can vary depending on factors such as age, sex, race, and other demographic characteristics. Therefore, it's essential to use reference values that are specific to the relevant population when interpreting laboratory test results. Additionally, reference values may change over time due to advances in measurement technology or changes in the population being studied.

Neuroimaging is a medical term that refers to the use of various techniques to either directly or indirectly image the structure, function, or pharmacology of the nervous system. It includes techniques such as computed tomography (CT), magnetic resonance imaging (MRI), functional MRI (fMRI), positron emission tomography (PET), single-photon emission computed tomography (SPECT), and diffusion tensor imaging (DTI). These techniques are used to diagnose and monitor various neurological and psychiatric conditions, as well as to understand the underlying mechanisms of brain function in health and disease.

Neuropeptides are small protein-like molecules that are used by neurons to communicate with each other and with other cells in the body. They are produced in the cell body of a neuron, processed from larger precursor proteins, and then transported to the nerve terminal where they are stored in secretory vesicles. When the neuron is stimulated, the vesicles fuse with the cell membrane and release their contents into the extracellular space.

Neuropeptides can act as neurotransmitters or neuromodulators, depending on their target receptors and the duration of their effects. They play important roles in a variety of physiological processes, including pain perception, appetite regulation, stress response, and social behavior. Some neuropeptides also have hormonal functions, such as oxytocin and vasopressin, which are produced in the hypothalamus and released into the bloodstream to regulate reproductive and cardiovascular function, respectively.

There are hundreds of different neuropeptides that have been identified in the nervous system, and many of them have multiple functions and interact with other signaling molecules to modulate neural activity. Dysregulation of neuropeptide systems has been implicated in various neurological and psychiatric disorders, such as chronic pain, addiction, depression, and anxiety.

Image enhancement in the medical context refers to the process of improving the quality and clarity of medical images, such as X-rays, CT scans, MRI scans, or ultrasound images, to aid in the diagnosis and treatment of medical conditions. Image enhancement techniques may include adjusting contrast, brightness, or sharpness; removing noise or artifacts; or applying specialized algorithms to highlight specific features or structures within the image.

The goal of image enhancement is to provide clinicians with more accurate and detailed information about a patient's anatomy or physiology, which can help inform medical decision-making and improve patient outcomes.

Tetrodotoxin (TTX) is a potent neurotoxin that is primarily found in certain species of pufferfish, blue-ringed octopuses, and other marine animals. It blocks voltage-gated sodium channels in nerve cell membranes, leading to muscle paralysis and potentially respiratory failure. TTX has no known antidote, and medical treatment focuses on supportive care for symptoms. Exposure can occur through ingestion, inhalation, or skin absorption, depending on the route of toxicity.

Meningoencephalitis is a medical term that refers to an inflammation of both the brain (encephalitis) and the membranes covering the brain and spinal cord (meninges), known as the meninges. It is often caused by an infection, such as bacterial or viral infections, that spreads to the meninges and brain. In some cases, it can also be caused by other factors like autoimmune disorders or certain medications.

The symptoms of meningoencephalitis may include fever, headache, stiff neck, confusion, seizures, and changes in mental status. If left untreated, this condition can lead to serious complications, such as brain damage, hearing loss, learning disabilities, or even death. Treatment typically involves antibiotics for bacterial infections or antiviral medications for viral infections, along with supportive care to manage symptoms and prevent complications.

An algorithm is not a medical term, but rather a concept from computer science and mathematics. In the context of medicine, algorithms are often used to describe step-by-step procedures for diagnosing or managing medical conditions. These procedures typically involve a series of rules or decision points that help healthcare professionals make informed decisions about patient care.

For example, an algorithm for diagnosing a particular type of heart disease might involve taking a patient's medical history, performing a physical exam, ordering certain diagnostic tests, and interpreting the results in a specific way. By following this algorithm, healthcare professionals can ensure that they are using a consistent and evidence-based approach to making a diagnosis.

Algorithms can also be used to guide treatment decisions. For instance, an algorithm for managing diabetes might involve setting target blood sugar levels, recommending certain medications or lifestyle changes based on the patient's individual needs, and monitoring the patient's response to treatment over time.

Overall, algorithms are valuable tools in medicine because they help standardize clinical decision-making and ensure that patients receive high-quality care based on the latest scientific evidence.

Spermatogonia are a type of diploid germ cells found in the seminiferous tubules of the testis. They are the stem cells responsible for sperm production (spermatogenesis) in males. There are two types of spermatogonia: A-dark (Ad) and A-pale (Ap). The Ad spermatogonia function as reserve stem cells, while the Ap spermatogonia serve as the progenitor cells that divide to produce type B spermatogonia. Type B spermatogonia then differentiate into primary spermatocytes, which undergo meiosis to form haploid spermatozoa.

GABA (gamma-aminobutyric acid) antagonists are substances that block the action of GABA, which is the primary inhibitory neurotransmitter in the central nervous system. GABA plays a crucial role in regulating neuronal excitability and reducing the transmission of nerve impulses.

GABA antagonists work by binding to the GABA receptors without activating them, thereby preventing the normal function of GABA and increasing neuronal activity. These agents can cause excitation of the nervous system, leading to various effects depending on the specific type of GABA receptor they target.

GABA antagonists are used in medical treatments for certain conditions, such as sleep disorders, depression, and cognitive enhancement. However, they can also have adverse effects, including anxiety, agitation, seizures, and even neurotoxicity at high doses. Examples of GABA antagonists include picrotoxin, bicuculline, and flumazenil.

Viral encephalitis is a medical condition characterized by inflammation of the brain caused by a viral infection. The infection can be caused by various types of viruses, such as herpes simplex virus, enteroviruses, arboviruses (transmitted through insect bites), or HIV.

The symptoms of viral encephalitis may include fever, headache, stiff neck, confusion, seizures, and altered level of consciousness. In severe cases, it can lead to brain damage, coma, or even death. The diagnosis is usually made based on clinical presentation, laboratory tests, and imaging studies such as MRI or CT scan. Treatment typically involves antiviral medications, supportive care, and management of complications.

Ataxia is a medical term that refers to a group of disorders affecting coordination, balance, and speech. It is characterized by a lack of muscle control during voluntary movements, causing unsteady or awkward movements, and often accompanied by tremors. Ataxia can affect various parts of the body, such as the limbs, trunk, eyes, and speech muscles. The condition can be congenital or acquired, and it can result from damage to the cerebellum, spinal cord, or sensory nerves. There are several types of ataxia, including hereditary ataxias, degenerative ataxias, cerebellar ataxias, and acquired ataxias, each with its own specific causes, symptoms, and prognosis. Treatment for ataxia typically focuses on managing symptoms and improving quality of life, as there is no cure for most forms of the disorder.

Membrane potential is the electrical potential difference across a cell membrane, typically for excitable cells such as nerve and muscle cells. It is the difference in electric charge between the inside and outside of a cell, created by the selective permeability of the cell membrane to different ions. The resting membrane potential of a typical animal cell is around -70 mV, with the interior being negative relative to the exterior. This potential is generated and maintained by the active transport of ions across the membrane, primarily through the action of the sodium-potassium pump. Membrane potentials play a crucial role in many physiological processes, including the transmission of nerve impulses and the contraction of muscle cells.

Cell-and tissue-based therapy is a type of medical treatment that involves the use of living cells or tissues to repair, replace, or regenerate damaged or diseased cells or tissues in the body. This can include the transplantation of stem cells, which are immature cells that have the ability to develop into different types of cells, as well as the use of fully differentiated cells or tissues that have specific functions in the body.

Cell-and tissue-based therapies may be used to treat a wide variety of medical conditions, including degenerative diseases, injuries, and congenital defects. Some examples of cell-and tissue-based therapies include:

* Bone marrow transplantation: This involves the transplantation of blood-forming stem cells from the bone marrow of a healthy donor to a patient in need of new blood cells due to disease or treatment with chemotherapy or radiation.
* Corneal transplantation: This involves the transplantation of healthy corneal tissue from a deceased donor to a patient with damaged or diseased corneas.
* Articular cartilage repair: This involves the use of cells or tissues to repair damaged articular cartilage, which is the smooth, white tissue that covers the ends of bones where they come together to form joints.

Cell-and tissue-based therapies are a rapidly evolving field of medicine, and researchers are continually exploring new ways to use these treatments to improve patient outcomes. However, it is important to note that cell-and tissue-based therapies also carry some risks, including the possibility of rejection or infection, and they should only be performed by qualified medical professionals in appropriate settings.

A vagotomy is a surgical procedure that involves cutting or blocking the vagus nerve, which is a parasympathetic nerve that runs from the brainstem to the abdomen and helps regulate many bodily functions such as heart rate, gastrointestinal motility, and digestion. In particular, vagotomy is often performed as a treatment for peptic ulcers, as it can help reduce gastric acid secretion.

There are several types of vagotomy procedures, including:

1. Truncal vagotomy: This involves cutting the main trunks of the vagus nerve as they enter the abdomen. It is a more extensive procedure that reduces gastric acid secretion significantly but can also lead to side effects such as delayed gastric emptying and diarrhea.
2. Selective vagotomy: This involves cutting only the branches of the vagus nerve that supply the stomach, leaving the rest of the nerve intact. It is a less extensive procedure that reduces gastric acid secretion while minimizing side effects.
3. Highly selective vagotomy (HSV): Also known as parietal cell vagotomy, this involves cutting only the branches of the vagus nerve that supply the acid-secreting cells in the stomach. It is a highly targeted procedure that reduces gastric acid secretion while minimizing side effects such as delayed gastric emptying and diarrhea.

Vagotomy is typically performed using laparoscopic or open surgical techniques, depending on the patient's individual needs and the surgeon's preference. While vagotomy can be effective in treating peptic ulcers, it is not commonly performed today due to the development of less invasive treatments such as proton pump inhibitors (PPIs) that reduce gastric acid secretion without surgery.

Infarction is the term used in medicine to describe the death of tissue (also known as an "area of necrosis") due to the lack of blood supply. This can occur when a blood vessel that supplies oxygen and nutrients to a particular area of the body becomes blocked or obstructed, leading to the deprivation of oxygen and nutrients necessary for the survival of cells in that region.

The blockage in the blood vessel is usually caused by a clot (thrombus) or an embolus, which is a small particle that travels through the bloodstream and lodges in a smaller vessel. The severity and extent of infarction depend on several factors, including the size and location of the affected blood vessel, the duration of the obstruction, and the presence of collateral circulation (alternative blood vessels that can compensate for the blocked one).

Common examples of infarctions include myocardial infarction (heart attack), cerebral infarction (stroke), and pulmonary infarction (lung tissue death due to obstruction in the lung's blood vessels). Infarctions can lead to various symptoms, depending on the affected organ or tissue, and may require medical intervention to manage complications and prevent further damage.

I'm sorry for any confusion, but "Glycine Agents" is not a widely recognized or established term in medical or scientific communities. Glycine is an amino acid that serves as a neurotransmitter and has various other functions in the body. However, I'm not aware of any specific agents or medications that are referred to as "Glycine Agents."

If you have more context or information about where you encountered this term, I might be able to provide a more accurate and helpful response.

"Recovery of function" is a term used in medical rehabilitation to describe the process in which an individual regains the ability to perform activities or tasks that were previously difficult or impossible due to injury, illness, or disability. This can involve both physical and cognitive functions. The goal of recovery of function is to help the person return to their prior level of independence and participation in daily activities, work, and social roles as much as possible.

Recovery of function may be achieved through various interventions such as physical therapy, occupational therapy, speech-language therapy, and other rehabilitation strategies. The specific approach used will depend on the individual's needs and the nature of their impairment. Recovery of function can occur spontaneously as the body heals, or it may require targeted interventions to help facilitate the process.

It is important to note that recovery of function does not always mean a full return to pre-injury or pre-illness levels of ability. Instead, it often refers to the person's ability to adapt and compensate for any remaining impairments, allowing them to achieve their maximum level of functional independence and quality of life.

Neuropsychological tests are a type of psychological assessment that measures cognitive functions, such as attention, memory, language, problem-solving, and perception. These tests are used to help diagnose and understand the cognitive impact of neurological conditions, including dementia, traumatic brain injury, stroke, Parkinson's disease, and other disorders that affect the brain.

The tests are typically administered by a trained neuropsychologist and can take several hours to complete. They may involve paper-and-pencil tasks, computerized tasks, or interactive activities. The results of the tests are compared to normative data to help identify any areas of cognitive weakness or strength.

Neuropsychological testing can provide valuable information for treatment planning, rehabilitation, and assessing response to treatment. It can also be used in research to better understand the neural basis of cognition and the impact of neurological conditions on cognitive function.

The vestibular system is a part of the inner ear that contributes to our sense of balance and spatial orientation. It is made up of two main components: the vestibule and the labyrinth.

The vestibule is a bony chamber in the inner ear that contains two important structures called the utricle and saccule. These structures contain hair cells and fluid-filled sacs that help detect changes in head position and movement, allowing us to maintain our balance and orientation in space.

The labyrinth, on the other hand, is a more complex structure that includes the vestibule as well as three semicircular canals. These canals are also filled with fluid and contain hair cells that detect rotational movements of the head. Together, the vestibule and labyrinth work together to provide us with information about our body's position and movement in space.

Overall, the vestibular system plays a crucial role in maintaining our balance, coordinating our movements, and helping us navigate through our environment.

Up-regulation is a term used in molecular biology and medicine to describe an increase in the expression or activity of a gene, protein, or receptor in response to a stimulus. This can occur through various mechanisms such as increased transcription, translation, or reduced degradation of the molecule. Up-regulation can have important functional consequences, for example, enhancing the sensitivity or response of a cell to a hormone, neurotransmitter, or drug. It is a normal physiological process that can also be induced by disease or pharmacological interventions.

Brain tissue transplantation is a medical procedure that involves the surgical implantation of healthy brain tissue into a damaged or diseased brain. The goal of this procedure is to replace the non-functioning brain cells with healthy ones, in order to restore lost function or improve neurological symptoms.

The brain tissue used for transplantation can come from various sources, including fetal brain tissue, embryonic stem cells, or autologous cells (the patient's own cells). The most common type of brain tissue transplantation is fetal brain tissue transplantation, where tissue from aborted fetuses is used.

Brain tissue transplantation has been explored as a potential treatment for various neurological conditions, including Parkinson's disease, Huntington's disease, and stroke. However, the procedure remains highly experimental and is not widely available outside of clinical trials. There are also ethical concerns surrounding the use of fetal brain tissue, which has limited its widespread adoption.

It is important to note that while brain tissue transplantation holds promise as a potential treatment for neurological disorders, it is still an area of active research and much more needs to be learned about its safety and efficacy before it becomes a standard treatment option.

Coculture techniques refer to a type of experimental setup in which two or more different types of cells or organisms are grown and studied together in a shared culture medium. This method allows researchers to examine the interactions between different cell types or species under controlled conditions, and to study how these interactions may influence various biological processes such as growth, gene expression, metabolism, and signal transduction.

Coculture techniques can be used to investigate a wide range of biological phenomena, including the effects of host-microbe interactions on human health and disease, the impact of different cell types on tissue development and homeostasis, and the role of microbial communities in shaping ecosystems. These techniques can also be used to test the efficacy and safety of new drugs or therapies by examining their effects on cells grown in coculture with other relevant cell types.

There are several different ways to establish cocultures, depending on the specific research question and experimental goals. Some common methods include:

1. Mixed cultures: In this approach, two or more cell types are simply mixed together in a culture dish or flask and allowed to grow and interact freely.
2. Cell-layer cultures: Here, one cell type is grown on a porous membrane or other support structure, while the second cell type is grown on top of it, forming a layered coculture.
3. Conditioned media cultures: In this case, one cell type is grown to confluence and its culture medium is collected and then used to grow a second cell type. This allows the second cell type to be exposed to any factors secreted by the first cell type into the medium.
4. Microfluidic cocultures: These involve growing cells in microfabricated channels or chambers, which allow for precise control over the spatial arrangement and flow of nutrients, waste products, and signaling molecules between different cell types.

Overall, coculture techniques provide a powerful tool for studying complex biological systems and gaining insights into the mechanisms that underlie various physiological and pathological processes.

Amyloid beta-peptides (Aβ) are small protein fragments that are crucially involved in the pathogenesis of Alzheimer's disease. They are derived from a larger transmembrane protein called the amyloid precursor protein (APP) through a series of proteolytic cleavage events.

The two primary forms of Aβ peptides are Aβ40 and Aβ42, which differ in length by two amino acids. While both forms can be harmful, Aβ42 is more prone to aggregation and is considered to be the more pathogenic form. These peptides have the tendency to misfold and accumulate into oligomers, fibrils, and eventually insoluble plaques that deposit in various areas of the brain, most notably the cerebral cortex and hippocampus.

The accumulation of Aβ peptides is believed to initiate a cascade of events leading to neuroinflammation, oxidative stress, synaptic dysfunction, and neuronal death, which are all hallmarks of Alzheimer's disease. Although the exact role of Aβ in the onset and progression of Alzheimer's is still under investigation, it is widely accepted that they play a central part in the development of this debilitating neurodegenerative disorder.

The amygdala is an almond-shaped group of nuclei located deep within the temporal lobe of the brain, specifically in the anterior portion of the temporal lobes and near the hippocampus. It forms a key component of the limbic system and plays a crucial role in processing emotions, particularly fear and anxiety. The amygdala is involved in the integration of sensory information with emotional responses, memory formation, and decision-making processes.

In response to emotionally charged stimuli, the amygdala can modulate various physiological functions, such as heart rate, blood pressure, and stress hormone release, via its connections to the hypothalamus and brainstem. Additionally, it contributes to social behaviors, including recognizing emotional facial expressions and responding appropriately to social cues. Dysfunctions in amygdala function have been implicated in several psychiatric and neurological conditions, such as anxiety disorders, depression, post-traumatic stress disorder (PTSD), and autism spectrum disorder (ASD).

Brain Natriuretic Peptide (BNP) is a type of natriuretic peptide that is primarily produced in the heart, particularly in the ventricles. Although it was initially identified in the brain, hence its name, it is now known that the cardiac ventricles are the main source of BNP in the body.

BNP is released into the bloodstream in response to increased stretching or distension of the heart muscle cells due to conditions such as heart failure, hypertension, and myocardial infarction (heart attack). Once released, BNP binds to specific receptors in the kidneys, causing an increase in urine production and excretion of sodium, which helps reduce fluid volume and decrease the workload on the heart.

BNP also acts as a hormone that regulates various physiological functions, including blood pressure, cardiac remodeling, and inflammation. Measuring BNP levels in the blood is a useful diagnostic tool for detecting and monitoring heart failure, as higher levels of BNP are associated with more severe heart dysfunction.

Neurosurgical procedures are operations that are performed on the brain, spinal cord, and peripheral nerves. These procedures are typically carried out by neurosurgeons, who are medical doctors with specialized training in the diagnosis and treatment of disorders of the nervous system. Neurosurgical procedures can be used to treat a wide range of conditions, including traumatic injuries, tumors, aneurysms, vascular malformations, infections, degenerative diseases, and congenital abnormalities.

Some common types of neurosurgical procedures include:

* Craniotomy: A procedure in which a bone flap is temporarily removed from the skull to gain access to the brain. This type of procedure may be performed to remove a tumor, repair a blood vessel, or relieve pressure on the brain.
* Spinal fusion: A procedure in which two or more vertebrae in the spine are fused together using bone grafts and metal hardware. This is often done to stabilize the spine and alleviate pain caused by degenerative conditions or spinal deformities.
* Microvascular decompression: A procedure in which a blood vessel that is causing pressure on a nerve is repositioned or removed. This type of procedure is often used to treat trigeminal neuralgia, a condition that causes severe facial pain.
* Deep brain stimulation: A procedure in which electrodes are implanted in specific areas of the brain and connected to a battery-operated device called a neurostimulator. The neurostimulator sends electrical impulses to the brain to help alleviate symptoms of movement disorders such as Parkinson's disease or dystonia.
* Stereotactic radiosurgery: A non-invasive procedure that uses focused beams of radiation to treat tumors, vascular malformations, and other abnormalities in the brain or spine. This type of procedure is often used for patients who are not good candidates for traditional surgery due to age, health status, or location of the lesion.

Neurosurgical procedures can be complex and require a high degree of skill and expertise. Patients considering neurosurgical treatment should consult with a qualified neurosurgeon to discuss their options and determine the best course of action for their individual situation.

Polymerase Chain Reaction (PCR) is a laboratory technique used to amplify specific regions of DNA. It enables the production of thousands to millions of copies of a particular DNA sequence in a rapid and efficient manner, making it an essential tool in various fields such as molecular biology, medical diagnostics, forensic science, and research.

The PCR process involves repeated cycles of heating and cooling to separate the DNA strands, allow primers (short sequences of single-stranded DNA) to attach to the target regions, and extend these primers using an enzyme called Taq polymerase, resulting in the exponential amplification of the desired DNA segment.

In a medical context, PCR is often used for detecting and quantifying specific pathogens (viruses, bacteria, fungi, or parasites) in clinical samples, identifying genetic mutations or polymorphisms associated with diseases, monitoring disease progression, and evaluating treatment effectiveness.

The nervous system is a complex, highly organized network of specialized cells called neurons and glial cells that communicate with each other via electrical and chemical signals to coordinate various functions and activities in the body. It consists of two main parts: the central nervous system (CNS), including the brain and spinal cord, and the peripheral nervous system (PNS), which includes all the nerves and ganglia outside the CNS.

The primary function of the nervous system is to receive, process, and integrate information from both internal and external environments and then respond by generating appropriate motor outputs or behaviors. This involves sensing various stimuli through specialized receptors, transmitting this information through afferent neurons to the CNS for processing, integrating this information with other inputs and memories, making decisions based on this processed information, and finally executing responses through efferent neurons that control effector organs such as muscles and glands.

The nervous system can be further divided into subsystems based on their functions, including the somatic nervous system, which controls voluntary movements and reflexes; the autonomic nervous system, which regulates involuntary physiological processes like heart rate, digestion, and respiration; and the enteric nervous system, which is a specialized subset of the autonomic nervous system that controls gut functions. Overall, the nervous system plays a critical role in maintaining homeostasis, regulating behavior, and enabling cognition and consciousness.

Denervation is a medical term that refers to the loss or removal of nerve supply to an organ or body part. This can occur as a result of surgical intervention, injury, or disease processes that damage the nerves leading to the affected area. The consequences of denervation depend on the specific organ or tissue involved, but generally, it can lead to changes in function, sensation, and muscle tone. For example, denervation of a skeletal muscle can cause weakness, atrophy, and altered reflexes. Similarly, denervation of an organ such as the heart can lead to abnormalities in heart rate and rhythm. In some cases, denervation may be intentional, such as during surgical procedures aimed at treating chronic pain or spasticity.

Nitric Oxide Synthase Type I, also known as NOS1 or neuronal nitric oxide synthase (nNOS), is an enzyme that catalyzes the production of nitric oxide (NO) from L-arginine. It is primarily expressed in the nervous system, particularly in neurons, and plays a crucial role in the regulation of neurotransmission, synaptic plasticity, and cerebral blood flow. NOS1 is calcium-dependent and requires several cofactors for its activity, including NADPH, FAD, FMN, and calmodulin. It is involved in various physiological and pathological processes, such as learning and memory, seizure susceptibility, and neurodegenerative disorders.

Physical stimulation, in a medical context, refers to the application of external forces or agents to the body or its tissues to elicit a response. This can include various forms of touch, pressure, temperature, vibration, or electrical currents. The purpose of physical stimulation may be therapeutic, as in the case of massage or physical therapy, or diagnostic, as in the use of reflex tests. It is also used in research settings to study physiological responses and mechanisms.

In a broader sense, physical stimulation can also refer to the body's exposure to physical activity or exercise, which can have numerous health benefits, including improving cardiovascular function, increasing muscle strength and flexibility, and reducing the risk of chronic diseases.

Efferent neurons are specialized nerve cells that transmit signals from the central nervous system (CNS), which includes the brain and spinal cord, to effector organs such as muscles or glands. These signals typically result in a response or action, hence the term "efferent," derived from the Latin word "efferre" meaning "to carry away."

Efferent neurons are part of the motor pathway and can be further classified into two types:

1. Somatic efferent neurons: These neurons transmit signals to skeletal muscles, enabling voluntary movements and posture maintenance. They have their cell bodies located in the ventral horn of the spinal cord and send their axons through the ventral roots to innervate specific muscle fibers.
2. Autonomic efferent neurons: These neurons are responsible for controlling involuntary functions, such as heart rate, digestion, respiration, and pupil dilation. They have a two-neuron chain arrangement, with the preganglionic neuron having its cell body in the CNS (brainstem or spinal cord) and synapsing with the postganglionic neuron in an autonomic ganglion near the effector organ. Autonomic efferent neurons can be further divided into sympathetic, parasympathetic, and enteric subdivisions based on their functions and innervation patterns.

In summary, efferent neurons are a critical component of the nervous system, responsible for transmitting signals from the CNS to various effector organs, ultimately controlling and coordinating numerous bodily functions and responses.

An animal model in medicine refers to the use of non-human animals in experiments to understand, predict, and test responses and effects of various biological and chemical interactions that may also occur in humans. These models are used when studying complex systems or processes that cannot be easily replicated or studied in human subjects, such as genetic manipulation or exposure to harmful substances. The choice of animal model depends on the specific research question being asked and the similarities between the animal's and human's biological and physiological responses. Examples of commonly used animal models include mice, rats, rabbits, guinea pigs, and non-human primates.

The rhombencephalon is a term used in the field of neuroanatomy, which refers to the most posterior region of the developing brain during embryonic development. It is also known as the hindbrain and it gives rise to several important structures in the adult brain.

More specifically, the rhombencephalon can be further divided into two main parts: the metencephalon and the myelencephalon. The metencephalon eventually develops into the pons and cerebellum, while the myelencephalon becomes the medulla oblongata.

The rhombencephalon plays a crucial role in several critical functions of the nervous system, including regulating heart rate and respiration, maintaining balance and posture, and coordinating motor movements. Defects or abnormalities in the development of the rhombencephalon can lead to various neurological disorders, such as cerebellar hypoplasia, Chiari malformation, and certain forms of brainstem tumors.

The locus coeruleus (LC) is a small nucleus in the brainstem, specifically located in the rostral pons and dorsal to the fourth ventricle. It is the primary site of noradrenaline (norepinephrine) synthesis, storage, and release in the central nervous system. The LC projects its neuronal fibers widely throughout the brain, including the cerebral cortex, thalamus, hippocampus, amygdala, and spinal cord. It plays a crucial role in various physiological functions such as arousal, attention, learning, memory, stress response, and regulation of the sleep-wake cycle. The LC's activity is associated with several neurological and psychiatric conditions, including anxiety disorders, depression, post-traumatic stress disorder (PTSD), and neurodegenerative diseases like Parkinson's and Alzheimer's disease.

Tissue and organ procurement is the process of obtaining viable tissues and organs from deceased or living donors for the purpose of transplantation, research, or education. This procedure is performed by trained medical professionals in a sterile environment, adhering to strict medical standards and ethical guidelines. The tissues and organs that can be procured include hearts, lungs, livers, kidneys, pancreases, intestines, corneas, skin, bones, tendons, and heart valves. The process involves a thorough medical evaluation of the donor, as well as consent from the donor or their next of kin. After procurement, the tissues and organs are preserved and transported to recipients in need.

Evoked potentials (EPs) are medical tests that measure the electrical activity in the brain or spinal cord in response to specific sensory stimuli, such as sight, sound, or touch. These tests are often used to help diagnose and monitor conditions that affect the nervous system, such as multiple sclerosis, brainstem tumors, and spinal cord injuries.

There are several types of EPs, including:

1. Visual Evoked Potentials (VEPs): These are used to assess the function of the visual pathway from the eyes to the back of the brain. A patient is typically asked to look at a patterned image or flashing light while electrodes placed on the scalp record the electrical responses.
2. Brainstem Auditory Evoked Potentials (BAEPs): These are used to evaluate the function of the auditory nerve and brainstem. Clicking sounds are presented to one or both ears, and electrodes placed on the scalp measure the response.
3. Somatosensory Evoked Potentials (SSEPs): These are used to assess the function of the peripheral nerves and spinal cord. Small electrical shocks are applied to a nerve at the wrist or ankle, and electrodes placed on the scalp record the response as it travels up the spinal cord to the brain.
4. Motor Evoked Potentials (MEPs): These are used to assess the function of the motor pathways in the brain and spinal cord. A magnetic or electrical stimulus is applied to the brain or spinal cord, and electrodes placed on a muscle measure the response as it travels down the motor pathway.

EPs can help identify abnormalities in the nervous system that may not be apparent through other diagnostic tests, such as imaging studies or clinical examinations. They are generally safe, non-invasive procedures with few risks or side effects.

Histochemistry is the branch of pathology that deals with the microscopic localization of cellular or tissue components using specific chemical reactions. It involves the application of chemical techniques to identify and locate specific biomolecules within tissues, cells, and subcellular structures. This is achieved through the use of various staining methods that react with specific antigens or enzymes in the sample, allowing for their visualization under a microscope. Histochemistry is widely used in diagnostic pathology to identify different types of tissues, cells, and structures, as well as in research to study cellular and molecular processes in health and disease.

An autopsy, also known as a post-mortem examination or obduction, is a medical procedure in which a qualified professional (usually a pathologist) examines a deceased person's body to determine the cause and manner of death. This process may involve various investigative techniques, such as incisions to study internal organs, tissue sampling, microscopic examination, toxicology testing, and other laboratory analyses. The primary purpose of an autopsy is to gather objective evidence about the medical conditions and factors contributing to the individual's demise, which can be essential for legal, insurance, or public health purposes. Additionally, autopsies can provide valuable insights into disease processes and aid in advancing medical knowledge.

The vestibulocochlear nerve, also known as the 8th cranial nerve, is responsible for transmitting sound and balance information from the inner ear to the brain. Vestibulocochlear nerve diseases refer to conditions that affect this nerve and can result in hearing loss, vertigo, and balance problems.

These diseases can be caused by various factors, including genetics, infection, trauma, tumors, or degeneration. Some examples of vestibulocochlear nerve diseases include:

1. Vestibular neuritis: an inner ear infection that causes severe vertigo, nausea, and balance problems.
2. Labyrinthitis: an inner ear infection that affects both the vestibular and cochlear nerves, causing vertigo, hearing loss, and tinnitus.
3. Acoustic neuroma: a benign tumor that grows on the vestibulocochlear nerve, causing hearing loss, tinnitus, and balance problems.
4. Meniere's disease: a inner ear disorder that causes vertigo, hearing loss, tinnitus, and a feeling of fullness in the ear.
5. Ototoxicity: damage to the inner ear caused by certain medications or chemicals that can result in hearing loss and balance problems.
6. Vestibular migraine: a type of migraine that is associated with vertigo, dizziness, and balance problems.

Treatment for vestibulocochlear nerve diseases varies depending on the specific condition and its severity. It may include medication, physical therapy, surgery, or a combination of these approaches.

Glycine is a simple amino acid that plays a crucial role in the body. According to the medical definition, glycine is an essential component for the synthesis of proteins, peptides, and other biologically important compounds. It is also involved in various metabolic processes, such as the production of creatine, which supports muscle function, and the regulation of neurotransmitters, affecting nerve impulse transmission and brain function. Glycine can be found as a free form in the body and is also present in many dietary proteins.

Cell division is the process by which a single eukaryotic cell (a cell with a true nucleus) divides into two identical daughter cells. This complex process involves several stages, including replication of DNA, separation of chromosomes, and division of the cytoplasm. There are two main types of cell division: mitosis and meiosis.

Mitosis is the type of cell division that results in two genetically identical daughter cells. It is a fundamental process for growth, development, and tissue repair in multicellular organisms. The stages of mitosis include prophase, prometaphase, metaphase, anaphase, and telophase, followed by cytokinesis, which divides the cytoplasm.

Meiosis, on the other hand, is a type of cell division that occurs in the gonads (ovaries and testes) during the production of gametes (sex cells). Meiosis results in four genetically unique daughter cells, each with half the number of chromosomes as the parent cell. This process is essential for sexual reproduction and genetic diversity. The stages of meiosis include meiosis I and meiosis II, which are further divided into prophase, prometaphase, metaphase, anaphase, and telophase.

In summary, cell division is the process by which a single cell divides into two daughter cells, either through mitosis or meiosis. This process is critical for growth, development, tissue repair, and sexual reproduction in multicellular organisms.

Patch-clamp techniques are a group of electrophysiological methods used to study ion channels and other electrical properties of cells. These techniques were developed by Erwin Neher and Bert Sakmann, who were awarded the Nobel Prize in Physiology or Medicine in 1991 for their work. The basic principle of patch-clamp techniques involves creating a high resistance seal between a glass micropipette and the cell membrane, allowing for the measurement of current flowing through individual ion channels or groups of channels.

There are several different configurations of patch-clamp techniques, including:

1. Cell-attached configuration: In this configuration, the micropipette is attached to the outer surface of the cell membrane, and the current flowing across a single ion channel can be measured. This configuration allows for the study of the properties of individual channels in their native environment.
2. Whole-cell configuration: Here, the micropipette breaks through the cell membrane, creating a low resistance electrical connection between the pipette and the inside of the cell. This configuration allows for the measurement of the total current flowing across all ion channels in the cell membrane.
3. Inside-out configuration: In this configuration, the micropipette is pulled away from the cell after establishing a seal, resulting in the exposure of the inner surface of the cell membrane to the solution in the pipette. This configuration allows for the study of the properties of ion channels in isolation from other cellular components.
4. Outside-out configuration: Here, the micropipette is pulled away from the cell after establishing a seal, resulting in the exposure of the outer surface of the cell membrane to the solution in the pipette. This configuration allows for the study of the properties of ion channels in their native environment, but with the ability to control the composition of the extracellular solution.

Patch-clamp techniques have been instrumental in advancing our understanding of ion channel function and have contributed to numerous breakthroughs in neuroscience, pharmacology, and physiology.

Wheat Germ Agglutinin (WGA) is a lectin protein found in wheat germ, which binds specifically to certain sugars on the surface of cells. Horseradish Peroxidase (HRP) is an enzyme derived from horseradish that catalyzes the conversion of certain substrates, producing a chemiluminescent or colorimetric signal.

A WGA-HRP conjugate refers to the formation of a covalent bond between WGA and HRP, creating an immunoconjugate. This complex is often used as a detection tool in various assays, such as ELISA (Enzyme-Linked Immunosorbent Assay) or Western blotting, where it can bind to specific carbohydrates on the target molecule and catalyze a colorimetric or chemiluminescent reaction, allowing for the visualization of the target.

Aspartate-tRNA ligase is an enzyme that plays a crucial role in protein synthesis. Its specific function is to join the amino acid aspartic acid to its corresponding transfer RNA (tRNA) molecule, forming an aspartyl-tRNA complex. This complex is essential for the accurate translation of genetic information encoded in messenger RNA (mRNA) into a polypeptide chain during protein synthesis.

The systematic name for this enzyme is L-aspartate:tRNA(Asn) ligase (AMP-forming), which reflects its role in catalyzing the reaction between aspartic acid and tRNA(Asn). The enzyme can also activate aspartic acid by forming an aspartyl-AMP intermediate before transferring the activated aspartate to the appropriate tRNA molecule.

Deficiencies or mutations in aspartate-tRNA ligase can lead to various genetic disorders and impairments in protein synthesis, which may have severe consequences for cellular function and overall health.

Pentobarbital is a barbiturate medication that is primarily used for its sedative and hypnotic effects in the treatment of insomnia, seizure disorders, and occasionally to treat severe agitation or delirium. It works by decreasing the activity of nerves in the brain, which produces a calming effect.

In addition to its medical uses, pentobarbital has been used for non-therapeutic purposes such as euthanasia and capital punishment due to its ability to cause respiratory depression and death when given in high doses. It is important to note that the use of pentobarbital for these purposes is highly regulated and restricted to licensed medical professionals in specific circumstances.

Like all barbiturates, pentobarbital has a high potential for abuse and addiction, and its use should be closely monitored by a healthcare provider. It can also cause serious side effects such as respiratory depression, decreased heart rate, and low blood pressure, especially when used in large doses or combined with other central nervous system depressants.

Eye movements, also known as ocular motility, refer to the voluntary or involuntary motion of the eyes that allows for visual exploration of our environment. There are several types of eye movements, including:

1. Saccades: rapid, ballistic movements that quickly shift the gaze from one point to another.
2. Pursuits: smooth, slow movements that allow the eyes to follow a moving object.
3. Vergences: coordinated movements of both eyes in opposite directions, usually in response to a three-dimensional stimulus.
4. Vestibulo-ocular reflex (VOR): automatic eye movements that help stabilize the gaze during head movement.
5. Optokinetic nystagmus (OKN): rhythmic eye movements that occur in response to large moving visual patterns, such as when looking out of a moving vehicle.

Abnormalities in eye movements can indicate neurological or ophthalmological disorders and are often assessed during clinical examinations.

A subarachnoid hemorrhage is a type of stroke that results from bleeding into the space surrounding the brain, specifically within the subarachnoid space which contains cerebrospinal fluid (CSF). This space is located between the arachnoid membrane and the pia mater, two of the three layers that make up the meninges, the protective covering of the brain and spinal cord.

The bleeding typically originates from a ruptured aneurysm, a weakened area in the wall of a cerebral artery, or less commonly from arteriovenous malformations (AVMs) or head trauma. The sudden influx of blood into the CSF-filled space can cause increased intracranial pressure, irritation to the brain, and vasospasms, leading to further ischemia and potential additional neurological damage.

Symptoms of a subarachnoid hemorrhage may include sudden onset of severe headache (often described as "the worst headache of my life"), neck stiffness, altered mental status, nausea, vomiting, photophobia, and focal neurological deficits. Rapid diagnosis and treatment are crucial to prevent further complications and improve the chances of recovery.

Tissue engineering is a branch of biomedical engineering that combines the principles of engineering, materials science, and biological sciences to develop functional substitutes for damaged or diseased tissues and organs. It involves the creation of living, three-dimensional structures that can restore, maintain, or improve tissue function. This is typically accomplished through the use of cells, scaffolds (biodegradable matrices), and biologically active molecules. The goal of tissue engineering is to develop biological substitutes that can ultimately restore normal function and structure in damaged tissues or organs.

Implanted electrodes are medical devices that are surgically placed inside the body to interface directly with nerves, neurons, or other electrically excitable tissue for various therapeutic purposes. These electrodes can be used to stimulate or record electrical activity from specific areas of the body, depending on their design and application.

There are several types of implanted electrodes, including:

1. Deep Brain Stimulation (DBS) electrodes: These are placed deep within the brain to treat movement disorders such as Parkinson's disease, essential tremor, and dystonia. DBS electrodes deliver electrical impulses that modulate abnormal neural activity in targeted brain regions.
2. Spinal Cord Stimulation (SCS) electrodes: These are implanted along the spinal cord to treat chronic pain syndromes. SCS electrodes emit low-level electrical pulses that interfere with pain signals traveling to the brain, providing relief for patients.
3. Cochlear Implant electrodes: These are surgically inserted into the cochlea of the inner ear to restore hearing in individuals with severe to profound hearing loss. The electrodes stimulate the auditory nerve directly, bypassing damaged hair cells within the cochlea.
4. Retinal Implant electrodes: These are implanted in the retina to treat certain forms of blindness caused by degenerative eye diseases like retinitis pigmentosa. The electrodes convert visual information from a camera into electrical signals, which stimulate remaining retinal cells and transmit the information to the brain via the optic nerve.
5. Sacral Nerve Stimulation (SNS) electrodes: These are placed near the sacral nerves in the lower back to treat urinary or fecal incontinence and overactive bladder syndrome. SNS electrodes deliver electrical impulses that regulate the function of the affected muscles and nerves.
6. Vagus Nerve Stimulation (VNS) electrodes: These are wrapped around the vagus nerve in the neck to treat epilepsy and depression. VNS electrodes provide intermittent electrical stimulation to the vagus nerve, which has connections to various regions of the brain involved in these conditions.

Overall, implanted electrodes serve as a crucial component in many neuromodulation therapies, offering an effective treatment option for numerous neurological and sensory disorders.

"Cattle" is a term used in the agricultural and veterinary fields to refer to domesticated animals of the genus *Bos*, primarily *Bos taurus* (European cattle) and *Bos indicus* (Zebu). These animals are often raised for meat, milk, leather, and labor. They are also known as bovines or cows (for females), bulls (intact males), and steers/bullocks (castrated males). However, in a strict medical definition, "cattle" does not apply to humans or other animals.

The cerebellar nuclei are clusters of neurons located within the white matter of the cerebellum, a region of the brain responsible for motor coordination, balance, and fine movement regulation. There are four main pairs of cerebellar nuclei: the fastigial, interpositus, dentate, and vestibular nuclei. These nuclei receive input from various parts of the cerebellar cortex and project to different areas of the brainstem and thalamus, contributing to the regulation of muscle tone, posture, and movement.

A tissue donor is an individual who has agreed to allow organs and tissues to be removed from their body after death for the purpose of transplantation to restore the health or save the life of another person. The tissues that can be donated include corneas, heart valves, skin, bone, tendons, ligaments, veins, and cartilage. These tissues can enhance the quality of life for many recipients and are often used in reconstructive surgeries. It is important to note that tissue donation does not interfere with an open casket funeral or other cultural or religious practices related to death and grieving.

Blinking is the rapid and repetitive closing and reopening of the eyelids. It is a normal physiological process that helps to keep the eyes moist, protected and comfortable by spreading tears over the surface of the eye and removing any foreign particles or irritants that may have accumulated on the eyelid or the conjunctiva (the mucous membrane that covers the front of the eye and lines the inside of the eyelids).

Blinking is controlled by the facial nerve (cranial nerve VII), which sends signals to the muscles that control the movement of the eyelids. On average, people blink about 15-20 times per minute, but this rate can vary depending on factors such as mood, level of attention, and visual tasks. For example, people tend to blink less frequently when they are concentrating on a visual task or looking at a screen, which can lead to dry eye symptoms.

Intraventricular injections are a type of medical procedure where medication is administered directly into the cerebral ventricles of the brain. The cerebral ventricles are fluid-filled spaces within the brain that contain cerebrospinal fluid (CSF). This procedure is typically used to deliver drugs that target conditions affecting the central nervous system, such as infections or tumors.

Intraventricular injections are usually performed using a thin, hollow needle that is inserted through a small hole drilled into the skull. The medication is then injected directly into the ventricles, allowing it to circulate throughout the CSF and reach the brain tissue more efficiently than other routes of administration.

This type of injection is typically reserved for situations where other methods of drug delivery are not effective or feasible. It carries a higher risk of complications, such as bleeding, infection, or damage to surrounding tissues, compared to other routes of administration. Therefore, it is usually performed by trained medical professionals in a controlled clinical setting.

Membrane proteins are a type of protein that are embedded in the lipid bilayer of biological membranes, such as the plasma membrane of cells or the inner membrane of mitochondria. These proteins play crucial roles in various cellular processes, including:

1. Cell-cell recognition and signaling
2. Transport of molecules across the membrane (selective permeability)
3. Enzymatic reactions at the membrane surface
4. Energy transduction and conversion
5. Mechanosensation and signal transduction

Membrane proteins can be classified into two main categories: integral membrane proteins, which are permanently associated with the lipid bilayer, and peripheral membrane proteins, which are temporarily or loosely attached to the membrane surface. Integral membrane proteins can further be divided into three subcategories based on their topology:

1. Transmembrane proteins, which span the entire width of the lipid bilayer with one or more alpha-helices or beta-barrels.
2. Lipid-anchored proteins, which are covalently attached to lipids in the membrane via a glycosylphosphatidylinositol (GPI) anchor or other lipid modifications.
3. Monotopic proteins, which are partially embedded in the membrane and have one or more domains exposed to either side of the bilayer.

Membrane proteins are essential for maintaining cellular homeostasis and are targets for various therapeutic interventions, including drug development and gene therapy. However, their structural complexity and hydrophobicity make them challenging to study using traditional biochemical methods, requiring specialized techniques such as X-ray crystallography, nuclear magnetic resonance (NMR) spectroscopy, and single-particle cryo-electron microscopy (cryo-EM).

The corpus striatum is a part of the brain that plays a crucial role in movement, learning, and cognition. It consists of two structures called the caudate nucleus and the putamen, which are surrounded by the external and internal segments of the globus pallidus. Together, these structures form the basal ganglia, a group of interconnected neurons that help regulate voluntary movement.

The corpus striatum receives input from various parts of the brain, including the cerebral cortex, thalamus, and other brainstem nuclei. It processes this information and sends output to the globus pallidus and substantia nigra, which then project to the thalamus and back to the cerebral cortex. This feedback loop helps coordinate and fine-tune movements, allowing for smooth and coordinated actions.

Damage to the corpus striatum can result in movement disorders such as Parkinson's disease, Huntington's disease, and dystonia. These conditions are characterized by abnormal involuntary movements, muscle stiffness, and difficulty initiating or controlling voluntary movements.

Cord blood stem cell transplantation is a medical procedure that involves the infusion of stem cells derived from the umbilical cord blood into a patient. These stem cells, specifically hematopoietic stem cells, have the ability to differentiate into various types of blood cells, including red and white blood cells and platelets.

Cord blood stem cell transplantation is often used as a treatment for patients with various malignant and non-malignant disorders, such as leukemia, lymphoma, sickle cell disease, and metabolic disorders. The procedure involves collecting cord blood from the umbilical cord and placenta after the birth of a baby, processing and testing it for compatibility with the recipient's immune system, and then infusing it into the patient through a vein in a process similar to a blood transfusion.

The advantages of using cord blood stem cells include their availability, low risk of transmission of infectious diseases, and reduced risk of graft-versus-host disease compared to other sources of hematopoietic stem cells, such as bone marrow or peripheral blood. However, the number of stem cells in a cord blood unit is generally lower than that found in bone marrow or peripheral blood, which can limit its use in some patients, particularly adults.

Overall, cord blood stem cell transplantation is an important and promising area of regenerative medicine, offering hope for patients with a wide range of disorders.

Photic stimulation is a medical term that refers to the exposure of the eyes to light, specifically repetitive pulses of light, which is used as a method in various research and clinical settings. In neuroscience, it's often used in studies related to vision, circadian rhythms, and brain function.

In a clinical context, photic stimulation is sometimes used in the diagnosis of certain medical conditions such as seizure disorders (like epilepsy). By observing the response of the brain to this light stimulus, doctors can gain valuable insights into the functioning of the brain and the presence of any neurological disorders.

However, it's important to note that photic stimulation should be conducted under the supervision of a trained healthcare professional, as improper use can potentially trigger seizures in individuals who are susceptible to them.

Species specificity is a term used in the field of biology, including medicine, to refer to the characteristic of a biological entity (such as a virus, bacterium, or other microorganism) that allows it to interact exclusively or preferentially with a particular species. This means that the biological entity has a strong affinity for, or is only able to infect, a specific host species.

For example, HIV is specifically adapted to infect human cells and does not typically infect other animal species. Similarly, some bacterial toxins are species-specific and can only affect certain types of animals or humans. This concept is important in understanding the transmission dynamics and host range of various pathogens, as well as in developing targeted therapies and vaccines.

Confocal microscopy is a powerful imaging technique used in medical and biological research to obtain high-resolution, contrast-rich images of thick samples. This super-resolution technology provides detailed visualization of cellular structures and processes at various depths within a specimen.

In confocal microscopy, a laser beam focused through a pinhole illuminates a small spot within the sample. The emitted fluorescence or reflected light from this spot is then collected by a detector, passing through a second pinhole that ensures only light from the focal plane reaches the detector. This process eliminates out-of-focus light, resulting in sharp images with improved contrast compared to conventional widefield microscopy.

By scanning the laser beam across the sample in a raster pattern and collecting fluorescence at each point, confocal microscopy generates optical sections of the specimen. These sections can be combined to create three-dimensional reconstructions, allowing researchers to study cellular architecture and interactions within complex tissues.

Confocal microscopy has numerous applications in medical research, including studying protein localization, tracking intracellular dynamics, analyzing cell morphology, and investigating disease mechanisms at the cellular level. Additionally, it is widely used in clinical settings for diagnostic purposes, such as analyzing skin lesions or detecting pathogens in patient samples.

Computer-assisted image interpretation is the use of computer algorithms and software to assist healthcare professionals in analyzing and interpreting medical images. These systems use various techniques such as pattern recognition, machine learning, and artificial intelligence to help identify and highlight abnormalities or patterns within imaging data, such as X-rays, CT scans, MRI, and ultrasound images. The goal is to increase the accuracy, consistency, and efficiency of image interpretation, while also reducing the potential for human error. It's important to note that these systems are intended to assist healthcare professionals in their decision making process and not to replace them.

The Pedunculopontine Tegmental Nucleus (PPN) is a group of neurons located in the brainstem, specifically in the rostral pons and caudal mesencephalon. It plays a crucial role in various functions such as sleep-wake regulation, motor control, reward processing, and attention.

The PPN can be further divided into two subregions: the pedunculopontine tegmental nucleus pars oralis (PPTg) and the pedunculopontine tegmental nucleus pars caudalis (PPTc). These subregions contain cholinergic, glutamatergic, and GABAergic neurons that project to various brain regions, including the thalamus, basal forebrain, and cerebral cortex.

Dysfunction of the PPN has been implicated in several neurological disorders, such as Parkinson's disease, REM sleep behavior disorder, and depression. Therefore, understanding the structure and function of the PPN is essential for developing potential therapeutic strategies for these conditions.

Metabolic brain diseases refer to a group of conditions that are caused by disruptions in the body's metabolic processes, which affect the brain. These disorders can be inherited or acquired and can result from problems with the way the body produces, breaks down, or uses energy and nutrients.

Examples of metabolic brain diseases include:

1. Mitochondrial encephalomyopathies: These are a group of genetic disorders that affect the mitochondria, which are the energy-producing structures in cells. When the mitochondria don't function properly, it can lead to muscle weakness, neurological problems, and developmental delays.
2. Leukodystrophies: These are a group of genetic disorders that affect the white matter of the brain, which is made up of nerve fibers covered in myelin, a fatty substance that insulates the fibers and helps them transmit signals. When the myelin breaks down or is not produced properly, it can lead to cognitive decline, motor problems, and other neurological symptoms.
3. Lysosomal storage disorders: These are genetic disorders that affect the lysosomes, which are structures in cells that break down waste products and recycle cellular materials. When the lysosomes don't function properly, it can lead to the accumulation of waste products in cells, including brain cells, causing damage and neurological symptoms.
4. Maple syrup urine disease: This is a genetic disorder that affects the way the body breaks down certain amino acids, leading to a buildup of toxic levels of these substances in the blood and urine. If left untreated, it can cause brain damage, developmental delays, and other neurological problems.
5. Homocystinuria: This is a genetic disorder that affects the way the body processes an amino acid called methionine, leading to a buildup of homocysteine in the blood. High levels of homocysteine can cause damage to the blood vessels and lead to neurological problems, including seizures, developmental delays, and cognitive decline.

Treatment for metabolic brain diseases may involve dietary changes, supplements, medications, or other therapies aimed at managing symptoms and preventing further damage to the brain. In some cases, a stem cell transplant may be recommended as a treatment option.

Extracellular fluid (ECF) is the fluid that exists outside of the cells in the body. It makes up about 20-25% of the total body weight in a healthy adult. ECF can be further divided into two main components: interstitial fluid and intravascular fluid.

Interstitial fluid is the fluid that surrounds the cells and fills the spaces between them. It provides nutrients to the cells, removes waste products, and helps maintain a balanced environment around the cells.

Intravascular fluid, also known as plasma, is the fluid component of blood that circulates in the blood vessels. It carries nutrients, hormones, and waste products throughout the body, and helps regulate temperature, pH, and osmotic pressure.

Maintaining the proper balance of ECF is essential for normal bodily functions. Disruptions in this balance can lead to various medical conditions, such as dehydration, edema, and heart failure.

The myelin sheath is a multilayered, fatty substance that surrounds and insulates many nerve fibers in the nervous system. It is essential for the rapid transmission of electrical signals, or nerve impulses, along these nerve fibers, allowing for efficient communication between different parts of the body. The myelin sheath is produced by specialized cells called oligodendrocytes in the central nervous system (CNS) and Schwann cells in the peripheral nervous system (PNS). Damage to the myelin sheath, as seen in conditions like multiple sclerosis, can significantly impair nerve function and result in various neurological symptoms.

Apoptosis is a programmed and controlled cell death process that occurs in multicellular organisms. It is a natural process that helps maintain tissue homeostasis by eliminating damaged, infected, or unwanted cells. During apoptosis, the cell undergoes a series of morphological changes, including cell shrinkage, chromatin condensation, and fragmentation into membrane-bound vesicles called apoptotic bodies. These bodies are then recognized and engulfed by neighboring cells or phagocytic cells, preventing an inflammatory response. Apoptosis is regulated by a complex network of intracellular signaling pathways that involve proteins such as caspases, Bcl-2 family members, and inhibitors of apoptosis (IAPs).

I believe there might be a misunderstanding in your question. "Dogs" is not a medical term or condition. It is the common name for a domesticated carnivore of the family Canidae, specifically the genus Canis, which includes wolves, foxes, and other extant and extinct species of mammals. Dogs are often kept as pets and companions, and they have been bred in a wide variety of forms and sizes for different purposes, such as hunting, herding, guarding, assisting police and military forces, and providing companionship and emotional support.

If you meant to ask about a specific medical condition or term related to dogs, please provide more context so I can give you an accurate answer.

Vibrissae are stiff, tactile hairs that are highly sensitive to touch and movement. They are primarily found in various mammals, including humans (in the form of eyelashes and eyebrows), but they are especially prominent in certain animals such as cats, rats, and seals. These hairs are deeply embedded in skin and have a rich supply of nerve endings that provide the animal with detailed information about its environment. They are often used for detecting nearby objects, navigating in the dark, and maintaining balance.

Follow-up studies are a type of longitudinal research that involve repeated observations or measurements of the same variables over a period of time, in order to understand their long-term effects or outcomes. In medical context, follow-up studies are often used to evaluate the safety and efficacy of medical treatments, interventions, or procedures.

In a typical follow-up study, a group of individuals (called a cohort) who have received a particular treatment or intervention are identified and then followed over time through periodic assessments or data collection. The data collected may include information on clinical outcomes, adverse events, changes in symptoms or functional status, and other relevant measures.

The results of follow-up studies can provide important insights into the long-term benefits and risks of medical interventions, as well as help to identify factors that may influence treatment effectiveness or patient outcomes. However, it is important to note that follow-up studies can be subject to various biases and limitations, such as loss to follow-up, recall bias, and changes in clinical practice over time, which must be carefully considered when interpreting the results.

The baroreflex is a physiological mechanism that helps regulate blood pressure and heart rate in response to changes in stretch of the arterial walls. It is mediated by baroreceptors, which are specialized sensory nerve endings located in the carotid sinus and aortic arch. These receptors detect changes in blood pressure and send signals to the brainstem via the glossopharyngeal (cranial nerve IX) and vagus nerves (cranial nerve X), respectively.

In response to an increase in arterial pressure, the baroreceptors are stimulated, leading to increased firing of afferent neurons that signal the brainstem. This results in a reflexive decrease in heart rate and cardiac output, as well as vasodilation of peripheral blood vessels, which collectively work to reduce blood pressure back towards its normal level. Conversely, if arterial pressure decreases, the baroreceptors are less stimulated, leading to an increase in heart rate and cardiac output, as well as vasoconstriction of peripheral blood vessels, which helps restore blood pressure.

Overall, the baroreflex is a crucial homeostatic mechanism that helps maintain stable blood pressure and ensure adequate perfusion of vital organs.

Biogenic amines are organic compounds that are derived from the metabolic pathways of various biological organisms, including humans. They are formed by the decarboxylation of amino acids, which are the building blocks of proteins. Some examples of biogenic amines include histamine, serotonin, dopamine, and tyramine.

Histamine is a biogenic amine that plays an important role in the immune system's response to foreign invaders, such as allergens. It is also involved in regulating stomach acid production and sleep-wake cycles. Serotonin is another biogenic amine that acts as a neurotransmitter, transmitting signals between nerve cells in the brain. It is involved in regulating mood, appetite, and sleep.

Dopamine is a biogenic amine that functions as a neurotransmitter and is involved in reward and pleasure pathways in the brain. Tyramine is a biogenic amine that is found in certain foods, such as aged cheeses and fermented soy products. It can cause an increase in blood pressure when consumed in large quantities.

Biogenic amines can have various effects on the body, depending on their type and concentration. In general, they play important roles in many physiological processes, but high levels of certain biogenic amines can be harmful and may cause symptoms such as headache, nausea, and hypertension.

The cerebellar cortex is the outer layer of the cerebellum, which is a part of the brain that plays a crucial role in motor control, balance, and coordination of muscle movements. The cerebellar cortex contains numerous small neurons called granule cells, as well as other types of neurons such as Purkinje cells, basket cells, and stellate cells. These neurons are organized into distinct layers and microcircuits that process information related to motor function and possibly other functions such as cognition and emotion. The cerebellar cortex receives input from various sources, including the spinal cord, vestibular system, and cerebral cortex, and sends output to brainstem nuclei and thalamus, which in turn project to the cerebral cortex. Damage to the cerebellar cortex can result in ataxia, dysmetria, dysdiadochokinesia, and other motor symptoms.

The ventral thalamic nuclei are a group of nuclei located in the ventral part of the thalamus, a region of the diencephalon in the brain. These nuclei play a crucial role in sensory and motor functions, as well as cognitive processes such as attention and memory. They include several subnuclei, such as the ventral anterior (VA), ventral lateral (VL), ventral medial (VM), and ventral posterior (VP) nuclei.

The ventral anterior and ventral lateral nuclei are involved in motor control and receive inputs from the basal ganglia, cerebellum, and cortex. They project to the premotor and motor areas of the cortex, contributing to the planning, initiation, and execution of movements.

The ventral medial nucleus is associated with emotional processing and receives inputs from the limbic system, including the amygdala and hippocampus. It projects to the prefrontal cortex and cingulate gyrus, contributing to the regulation of emotions and motivation.

The ventral posterior nuclei are involved in sensory processing, particularly for tactile and proprioceptive information. They receive inputs from the spinal cord and brainstem and project to the primary somatosensory cortex, where they contribute to the perception of touch, pressure, temperature, and body position.

Overall, the ventral thalamic nuclei are an essential component of the neural circuits involved in sensory, motor, and cognitive functions, and their dysfunction has been implicated in various neurological and psychiatric disorders.

Hearing disorders, also known as hearing impairments or auditory impairments, refer to conditions that affect an individual's ability to hear sounds in one or both ears. These disorders can range from mild to profound and may result from genetic factors, aging, exposure to loud noises, infections, trauma, or certain medical conditions.

There are mainly two types of hearing disorders: conductive hearing loss and sensorineural hearing loss. Conductive hearing loss occurs when there is a problem with the outer or middle ear, preventing sound waves from reaching the inner ear. Causes include earwax buildup, fluid in the middle ear, a perforated eardrum, or damage to the ossicles (the bones in the middle ear).

Sensorineural hearing loss, on the other hand, is caused by damage to the inner ear (cochlea) or the nerve pathways from the inner ear to the brain. This type of hearing loss is often permanent and can be due to aging (presbycusis), exposure to loud noises, genetics, viral infections, certain medications, or head injuries.

Mixed hearing loss is a combination of both conductive and sensorineural components. In some cases, hearing disorders can also involve tinnitus (ringing or other sounds in the ears) or vestibular problems that affect balance and equilibrium.

Early identification and intervention for hearing disorders are crucial to prevent further deterioration and to help individuals develop appropriate communication skills and maintain a good quality of life.

Cognitive disorders are a category of mental health disorders that primarily affect cognitive abilities including learning, memory, perception, and problem-solving. These disorders can be caused by various factors such as brain injury, degenerative diseases, infection, substance abuse, or developmental disabilities. Examples of cognitive disorders include dementia, amnesia, delirium, and intellectual disability. It's important to note that the specific definition and diagnostic criteria for cognitive disorders may vary depending on the medical source or classification system being used.

A brain stem tumor is a tumor in the part of the brain that connects to the spinal cord (the brain stem). The symptoms of brain ... http://neurosurgery.mgh.harvard.edu/abta/primer.htm[full citation needed] Brainstem Gliomas~treatment at eMedicine Brain stem ... The most common form of brainstem tumor is the brainstem glioma. Treatment typically consists of radiotherapy and steroids for ... Headaches related to brainstem tumors may be worse shortly after waking up in the morning. An MRI is better than a CT scan when ...
The brainstem (or brain stem) is the stalk-like: 152 part of the brain that interconnects the cerebrum and diencephalon with ... 3D visualization of the brainstem in an average human brain Triune brain - reptilian brain Haines, D; Mihailoff, G (2018). ... In the human brain the brainstem is composed of the midbrain, the pons, and the medulla oblongata.: 152 The midbrain is ... "Cranial Nerve Nuclei and Brain Stem Circulation". Neuroanatomy Online. Retrieved 2020-05-13. Kolb, B. & Whishaw, I. Q. (2009). ...
Are 'brain dead' (or 'brain stem dead') patients neurologically recoverable? In Finis Vitae - 'brain death' is not true death. ... Pallis, C. From Brain Death to Brain Stem Death, BMJ, 285, November 1982 Coimbra CG. Implications of ischemic penumbra for the ... ABC of brain stem death. BMJ Publishing Group, 1996, p.30 Shewmon DA. 'Brain body' disconnection : implications for the ... The demise of 'brain death' in Britain. In Beyond brain death - the case against brain based criteria for human death. Eds. ...
The Childhood Brain Tumor Foundation. 23 Oct. 2008. "Brain Stem Gliomas." Brain Tumor Society. 25 Oct. 2008. "Brain Stem Glioma ... "Brain Stem Gliomas in Childhood." Brain Tumor Types and Imaging. ... "Immunotherapy for Patients With Brain Stem Glioma and ... is the main diagnostic tool for brain stem gliomas. In very rare cases, surgery and biopsy are performed. Unlike most brain ... A brainstem glioma is a cancerous glioma tumor in the brainstem. Around 75% are diagnosed in children and young adults under ...
Moore, Ernest J (1983). Bases of auditory brain stem evoked responses. New York: Grune & Stratton. ISBN 978-0-8089-1465-5. OCLC ... Long, K.J.; Allen, N. (October 1984). "Abnormal brain-stem auditory evoked potentials following Ondine's curse". Arch. Neurol. ... Brain Research. Don M, Kwong B, Tanaka C (2012). "Interaural stacked auditory brainstem response measures for detecting small ... The auditory brainstem response (ABR), also called brainstem evoked response audiometry (BERA), is an auditory evoked potential ...
Bickerstaff ER (1957). "Brain-stem encephalitis: further observations on a grave syndrome with benign prognosis". Br Med J. 1 ( ... Brain. OUP. 126 (10): 2279-90. doi:10.1093/brain/awg233. PMID 12847079. Odaka, et al, 2003, "Bickerstaff's brainstem ... "Orphanet: Bickerstaff brainstem encephalitis". www.orpha.net. Retrieved 28 October 2019. "Bickerstaff's Brainstem Encephalitis ... Bickerstaff brainstem encephalitis is a rare inflammatory disorder of the central nervous system, first described by Edwin ...
Long, KJ; Allen, N (October 1984). "Abnormal brain-stem auditory evoked potentials following Ondine's curse". Archives of ... In human neuroanatomy, brainstem auditory evoked potentials (BAEPs), also called brainstem auditory evoked responses (BAERs), ... These investigators hypothesized that their patient's brainstem was poisoned, but not destroyed, by her chronic alcoholism. ... and inferior colliculus of the brainstem. They typically have a response latency of no more than six milliseconds with an ...
Yang et al (1987). A developmental study of bone-conduction auditory brain stem response in infants. Ear & Hearing; 8, 4. ... Bone-conduction auditory brainstem response (BCABR) are similar to air conduction auditory brainstem responses, with the main ... Auditory brain stem evoked responses to bone-conducted signals. Archives of Otolaryngology; 105, 656-661. ... Bone-conduction auditory brainstem response or BCABR is a type of auditory evoked response that records neural response from ...
"Brain Stem Death". Gender Justice Uncovered Awards. Women's Link Worldwide. Retrieved 13 June 2017. Judgments: P.P -v- Health ... The cause was a large cerebellar cystic lesion causing acute hydrocephalus and compression of brain stem. She was placed on ... McDonald, Henry (26 December 2014). "Brain-dead pregnant woman's life support can be switched off, Irish court rules". The ... Carolan, Mary (11 April 2016). "Judgment on brain-dead pregnant woman wins award". The Irish Times. Retrieved 13 June 2017. " ...
Bickerstaff ER (June 1957). "Brain-stem encephalitis; further observations on a grave syndrome with benign prognosis". British ... Brain 1986; 109: 1115-1126". Brain. 139 (7): 2096-2100. doi:10.1093/brain/aww127. Asbury AK, Cornblath DR (1990). "Assessment ... Brain. 130 (Pt 9): 2245-57. doi:10.1093/brain/awm004. PMID 17337484. Darweesh SK, Polinder S, Mulder MJ, Baena CP, van Leeuwen ... Brain 1969; 92: 589-606; with An acute axonal form of Guillain-Barré polyneuropathy by T.E. Feasby, J.J. Gilbert, W.F. Brown, C ...
Bickerstaff, E.R. (15 June 1957). "Brain-stem encephalitis; further observations on a grave syndrome with benign prognosis". ...
"Paraneoplastic brain stem encephalitis". Current Treatment Options in Neurology. 15 (2): 201-209. doi:10.1007/s11940-013-0221-1 ... brainstem encephalitis, opsoclonus myoclonus ataxia syndrome, anti-NMDA receptor encephalitis, and polymyositis. The following ... The purpose of this exploration was to shed light on immunotherapies and distinguishing between neurotoxicity and brain ...
Deep dissection of brain-stem. Lateral view. Dissection of brain-stem. Lateral view. Dissection of brain-stem. Dorsal view. ... The fibers continue to course through the medulla oblongata of the brainstem, at which point they pass through the inferior ... ISBN 978-1-58890-572-7. Cooke, J. D. (October 1971). "Origin and termination of cuneocerebellar tract". Experimental Brain ... Superficial dissection of brain-stem. Lateral view. ...
... is yellow) Superficial dissection of brain-stem. Lateral view. Dissection of brain-stem. Lateral view. Scheme ... The fibers from the retina run along the optic nerve to nine primary visual nuclei in the brain, from which a major relay ... The optic nerve on MRI Stained brain slice images which include the "optic%20nerve" at the BrainMaps project IFOND online case ... Optic nerve Optic nerve Human brain dura mater (reflections) Optic nerve Optic nerve Optic nerve Cerebrum.Inferior view.Deep ...
Thalamus Deep dissection of brain-stem. Lateral view. Deep dissection of brain-stem. Lateral view. Dissection of brain-stem. ... Brainstem. Posterior view. Buffalo.edu at the Library of Congress Web Archives (archived 2001-11-27) Brainconnection.com at the ...
It sends fibers to deep cerebellar nuclei that, in turn, project to both the cerebral cortex and the brain stem, thus providing ... Brainstem. Posterior view. Midsagittal view Lobules of the vermis. Coffman, K.A.; Dum, R.P.; Strick, P.L. (2011). "Cerebellar ... It is also commonly associated with dysplasias of brainstem nuclei. DWM has been reported to be in association with a wide ... S.K. Clarren; J. Alvord; S.M. Sumi (1978). "Brain malformations related to prenatal exposure to ethanol". Journal of Pediatrics ...
Superficial dissection of brain-stem. Lateral view. Deep dissection of brain-stem. Lateral view. Dissection of brain-stem. ... Brainstem. Posterior view. Auditory system List of regions in the human brain Shore, S. E.: Auditory/Somatosensory Interactions ... Stained brain slice images which include the "inferior colliculus" at the BrainMaps project NIF Search - Brachium of inferior ... This indicates that the inferior colliculus is metabolically more active than many other parts of the brain. The hippocampus, ...
Superficial dissection of brain-stem. Lateral view. Superficial dissection of brain-stem. Ventral view. Dissection of brain- ... stem. Dorsal view. External capsule External capsule Ventricles of brain and basal ganglia. Superior view. Horizontal section. ... The external capsule is a series of white matter fiber tracts in the brain. These fibers run between the most lateral (toward ... Ventricles of brain and basal ganglia.Superior view. Horizontal section. Deep dissection. Internal capsule Extreme capsule ...
Superficial dissection of brain-stem. Ventral view. Transverse section through mid-brain Section of brain showing upper surface ... Schematic representation of the chief ganglionic categories (I to V) Dissection of brain-stem. Lateral view. ... Deep dissection Ventricles of brain and basal ganglia. Superior view. Horizontal section. Deep dissection Striatum This article ... section of brain immediately in front of pons Coronal section through anterior cornua of lateral ventricles Ventricles of brain ...
Brain stem involvement is common. Depression, weakness, head tilt, and dysphagia also occur. S. fayeri may cause myositis in ... Garnham, P. C. C.; Duggan, A. J.; Sinden, R. E. (1979). "A new species of Sarcocystis in the brain of two exotic birds". ... This genus was distinguished from Sarcocystis on the basis of its tendency to encyst within the brain rather than within muscle ...
Scheme showing the connections of the several parts of the brain. Superficial dissection of brain-stem. Lateral view. Hind- and ... The middle cerebellar peduncle (or brachium pontis) is a paired structure of the brain. It connects the pons to the cerebellum ... Basal view of a human brain Dissection of human midbrain with middle cerebellar peduncle labeled. Cross section through lower ...
Deep dissection of brain-stem. Lateral view. Deep dissection of brain-stem. Ventral view. Dissection of brain-stem. Dorsal view ... Dissection of brain-stem. Lateral view. Deep dissection of brain-stem. Lateral view. ... Coronal section through mid-brain. Transverse section of mid-brain at level of inferior colliculi. Scheme showing the course of ... The lateral lemniscus is a tract of axons in the brainstem that carries information about sound from the cochlear nucleus to ...
Superficial dissection of brain-stem. Ventral view. Hind- and mid-brains; postero-lateral view. Figure showing the mode of ... before exiting the brainstem at the pontomedullary junction.[citation needed] The abducens nerve emerges from the brainstem at ... A right-sided brain tumor can produce either a right-sided or a left-sided sixth nerve palsy as an initial sign. Thus a right- ... ISBN 978-0-8089-2371-8. Dura mater and its processes exposed by removing part of the right half of the skull, and the brain. ...
Brain-Stem Localization and Function. Springer Science & Business Media. ISBN 9783642781728. Schmidt, D.; Thoden, U. (1978-06- ... Findings in normals and patients with brainstem lesions". Brain. 116 (3): 727-738. doi:10.1093/brain/116.3.727. ISSN 0006-8950 ... According to (Urban 1993), "In patients with brainstem disease abnormal transverse auricular muscle coactivation is ...
Thalamus Dissection of brain-stem. Lateral view. Scheme showing central connections of the optic nerves and optic tracts. ... Regions in the brainstem that are not involved in visual perception also project to the LGN, such as the mesencephalic ... Stained brain slice images which include the "lateral%20geniculate%20nucleus" at the BrainMaps project Atlas image: eye_38 at ... In humans as well as other mammals, the two strongest pathways linking the eye to the brain are those projecting to the dorsal ...
Brain stem sagittal section "Trochlear , Definition of Trochlear by Oxford Dictionary on Lexico.com also meaning of Trochlear ... Cytoarchitecture of the Human Brain Stem (2nd ed.). Basel: S. Karger. pp. 50-51. ISBN 3-8055-2210-X. Atlas image: n2a4p4 at the ... in the midbrain before emerging from the brainstem posteriorly/dorsally.[citation needed] In other words, trochlear nucleus on ... University of Michigan Health System - "Brainstem, Cranial Nerve Nuclei, Sagittal Section, Medial View" v t e (Articles with ...
Deep dissection of brain-stem. Ventral view. Superior terminations of the posterior fasciculi of the medulla spinalis. This ... Unlike other ascending tracts of the brain, fibres of the medial lemniscus do not give off collateral branches as they travel ... along the brainstem. The fibres that make up the sensory decussation are responsible for fine touch, proprioception and two- ...
Brain stem: Tumors on the brainstem can cause seizures, endocrine problems, respiratory changes, visual changes, headaches and ... Most brain tumors have higher ADC than normal brain tissues and doctors can match the observed ADC of the patient's brain tumor ... White British brain tumour patients 'more likely to die in a year' The Guardian "Quick Brain Tumor Facts". National Brain Tumor ... Brain Tumor Nervous system neoplasm List of brain tumor cases "Adult Brain Tumors Treatment". NCI. 28 February 2014. Archived ...
"First stem cell brain surgery". Hindustan Times. 3 January 2009. Archived from the original on 5 February 2015. Retrieved 4 ... He is known to have introduced microdialysis of brain and stem cell therapy for cerebral palsy for the first time in Asia. ... Stereotactic surgery Deep brain stimulation Stem cell therapy Cerebral palsy Parkinson's disease India portal Medicine portal " ... The magazine "Brain Voice" is yet another initiative to create awareness about brain, spine, spirituality and related issues to ...
Dorsal column-medial lemniscus pathway Deep dissection of brain-stem. Lateral view. Deep dissection of brain-stem. Ventral view ... Fibres from these nuclei will pass to the contralateral side of the brainstem, as the internal arcuate fibres. At the open ... Transverse section of mid-brain at level of inferior colliculi. Scheme showing the course of the fibers of the lemniscus; ... Diffusion tensor tractography of the somatosensory system in the human brainstem: initial findings using high isotropic spatial ...
A brain stem tumor is a tumor in the part of the brain that connects to the spinal cord (the brain stem). The symptoms of brain ... http://neurosurgery.mgh.harvard.edu/abta/primer.htm[full citation needed] Brainstem Gliomas~treatment at eMedicine Brain stem ... The most common form of brainstem tumor is the brainstem glioma. Treatment typically consists of radiotherapy and steroids for ... Headaches related to brainstem tumors may be worse shortly after waking up in the morning. An MRI is better than a CT scan when ...
An unusual strand of RNA guides stem cells to transform into neurons. ... Electrical brain implants may help patients with severe brain injuries By Darren Incorvaia. December 4, 2023. ... Electrical brain implants may help patients with severe brain injuries By Darren Incorvaia. December 4, 2023. ... Scientists exploring how brain cells form have found evidence that RNA does a lot more, however. ...
Dr Eric Hill, Senior Lecturer in Stem cell Biology at Aston University, said: "Our ability to turn human stem cells into brain ... Stem cell AI -- brain on a chip project aims to revolutionize computing power Revolutionary Neu-ChiP project will see ... The research team is now embarking on a three-year study to demonstrate how human brain stem cells grown on a microchip can be ... Stem cell AI -- brain on a chip project aims to revolutionize computing power. Aston University ...
Broken heart syndrome may be linked to the brain. ... Broken-Heart Syndrome May Stem from the Brain. News By Yasemin ... The brain scans were compared with another 39 brain scans, taken in patients without broken-heart syndrome. The researchers ... Broken-heart syndrome "clearly involves interactions between the brain and the heart," Ghardi said. It is "in fact a brain- ... The brain scans took place in 2013 and 2014; patients had been diagnosed, on average, about a year before the scan. The scans ...
The revitalized stem cells improve the regeneration of injured or diseased areas in the brain of old mice. The researchers ... expect that their approach will provide fresh impetus in regenerative medicine and facilitate the development of stem cell ... Scientists have been able to rejuvenate stem cells in the brain of aging mice. ... Brain Stem Cells Divide Over Months. Dec. 21, 2020 Scientists have been able to observe the way stem cells in the adult brains ...
Brain Stem Glioma - Childhood - Follow-Up Care up Brain Stem Glioma - Childhood - Questions to Ask the Health Care Team › ... Brain Stem Glioma - Childhood: Survivorship. Approved by the Cancer.Net Editorial Board, 10/2022 ... Some people say they appreciate life more after a diagnosis of brain stem glioma. Other families stay very anxious about their ... Children who have had brain stem glioma can enhance the quality of their future by following established guidelines for good ...
The brain stem controls vital bodily functions, including breathing and heartbeat. Thus, a brain stem stroke is a life- ... The way a stroke affects the brain depends on which part of the brain suffers damage, and to what degree. ... A stroke occurs when blood supply to the brain is interrupted. ... Were dependent on brain stem function for survival. A brain ... All of the signals from your brain move through the brain stem to reach the different parts of your body. Nerve cells that come ...
Source code for brainstem.stem. # Copyright (c) 2018 Acroname Inc. - All Rights Reserved # # This file is part of the BrainStem ... use brainstem.BIT(X) from aDefs.h to get bit value. # i.e if (state & brainstem.BIT(usbPortStateVBUS)) usbPortStateVBUS = 0 ... use brainstem.BIT(X) from aDefs.h to get bit value. i.e if (state & brainstem.BIT(aUSBHUB3P_USB_VBUS_ENABLED)) * aUSBHUB3P_USB_ ... use brainstem.BIT(X) from aDefs.h to get bit value. # i.e if (state & brainstem.BIT(aUSBHUB3P_USB_VBUS_ENABLED)) aUSBHUB3P_USB_ ...
Brain Neoplasms / surgery* * Brain Stem / abnormalities * Brain Stem / blood supply* * Brain Stem / surgery* ... Surgical strategies in treating brainstem cavernous malformations Neurosurgery. 2011 Mar;68(3):609-20; discussion 620-1. doi: ... Background: Optimal therapy of brainstem cavernous malformations (BSCMs) remains controversial because their biological ... was to perform complete CM resection and to preserve any associated venous malformation with minimal functional brainstem ...
Brain scans show low-er part of a COVID-19 patients brain stem, post-mortem. Arrows point to light and dark spots sug-gest-ing ... Filed Under: Brain/ Mental Health Tagged With: brain fog, brain tissue, brainstem, COVID-19, human-brain, neurological, ... brainstem. Can COVID-19 coronavirus "invade" human brain tissue? (Quick answer: evidence so far is mixed). January 19, 2021. by ... affects the human brain. [Read more…] about Can COVID-19 coro-n-avirus "invade" human brain tis-sue? (Quick answer: evi-dence ...
Although various systems are used to classify these tumors, the authors have divided brainstem gliomas into 3 distinct anatomic ... Brainstem gliomas are tumors that occur in the region of the brain referred to as the brain stem, which is the area between the ... Brainstem gliomas are tumors that occur in the region of the brain referred to as the brain stem, which is the area between the ... As the name implies, brainstem gliomas occur in the region of the brain stem. Approximately 60% of the time they are centered ...
Brain Res 2004;1014:145-163. , Article , PubMed , ChemPort ,. *. Sang Q, Goyal RK. Swallowing reflex and brain stem neurons ... Corticobulbar connections to the pons and lower brain stem in man. Brain 1958;81:364-388. , PubMed , ChemPort , ... Jean A. Brain stem control of swallowing: neuronal network and cellular mechanisms. Physiol Rev 2001;81:929-969. , PubMed , ISI ... An anatomical analysis of corticobulbar connections to the pons and lower brain stem in the cat. J Anat 1958;92:198-218. , ...
An injury to this area of the brain can cause lasting impairment and even death. Click here to learn more. ... The brainstem controls many autonomic bodily functions as well as motor functioning. ... Diagnosis and Treatment of Brainstem Injuries. To diagnose a brain stem injury, doctors will conduct a number of neurological ... Brain Injury *Basic Facts About TBI *How the Brain Works *Brain Function *Left Hand Brain Function ...
Brain Reconstruction: Stem-Cell Scaffolding Can Repair Stroke Damage ... Brain Reconstruction: Stem-Cell Scaffolding Can Repair Stroke Damage 80beatsBy Rachel CernanskyMar 9, 2009 9:57 PM ... Once inside the brain, the particles link up to form complex scaffolds. Modos team used MRI scans to pinpoint where the stem- ... The polymers ready-made support structure helped the stem cells to form new brain tissue in the cavity [BBC]. ...
Brain-Stem Death. . Rabbi Mordechai Halperin. Brain-Stem Death. [2 minutes 35 seconds] ...
NIH scientists find that restocking new cells in the brains center for smell maintains crucial circuitry. ... Scientists sniff out unexpected role for stem cells in the brain. NIH scientists find that restocking new cells in the brains ... "This is a surprising new role for brain stem cells and changes the way we view them," said Leonardo Belluscio, Ph.D., a ... Neurons in the olfactory bulb sort that information and relay the signals to the rest of the brain, at which point we become ...
Brain Stem / cytology* * Brain Stem / physiology * Electric Stimulation * Functional Laterality * Membrane Potentials / ... Brainstem and spinal projections of augmenting expiratory neurons in the rat Neurosci Res. 2003 Jan;45(1):41-51. doi: 10.1016/ ... BOT E-AUG neurons (n = 11) had extensive axonal projections to the brainstem, but E-AUG neurons (n = 5) of the cVRG sent axons ... First, as compared with the dense projections to the ipsilateral brainstem, those to the contralateral side were sparse. Second ...
The objective of this study was to provide a generalized critique for the role of mesenchymal stem cell therapy in ischemic ... Recently, a growing number of studies are focusing on mesenchymal stem cell-based therapies for neurodegenerative disorders. ... However, despite having the promising outcome of preclinical studies, the clinical application of stem cell therapy remained ... Ischemic brain injury is associated with a high rate of mortality and disability with no effective therapeutic strategy. ...
Researchers at UC San Francisco have discovered that a small cluster of neurons in the brain stem not only regulates tempo but ... The researchers then determined which cells in the brain stem were responsible for this rhythm, which turned out to be a ... Categories Brain & Behavior Tags singing, vocalization Physicists detect a hybrid particle held together by uniquely intense " ... Novel Brainstem Circuit Gives Rise to the Rhythms of Vocalization. January 10, 2022. UC San Francisco ...
... but moderately delayed maturation at rostral brainstem regions. The altered brainstem neural maturation is different from ... FGR babies born very prematurely are associated with accelerated or precocial neural maturation at caudal brainstem regions, ... to study brainstem neural conduction and maturation in fetal growth restriction (FGR) babies born very prematurely and assess ... the effect of FGR on brainstem neural maturation. MLS BAER was recorded and analyzed at a mean 40 week postmenstrual age in ...
Scientists have created a way to isolate neural stem cells †... Stem cell advance a step forward for treatment of brain ... They used the virus to deliver the synthetic DNA to neural stem cells in the brain tissue. The technique compelled neural stem ... These stem cells can renew themselves and have the potential to become a number of brain cell types - for instance, ... Scientists have created a way to isolate neural stem cells - cells that give rise to all the cell types of the brain - from ...
Quinones-Hinojosas Brain Tumor Stem Cell Research Lab at Mayo Clinic explores glioblastoma therapies, cell migration & ... Projects in the Brain Tumor Stem Cell Research Lab investigate the effect of ion transporters in brain tumor cell migration and ... Using fat to fight cancer. The Brain Tumor Stem Cell Research Lab at Mayo Clinic engineers human mesenchymal stem cells with ... The Brain Tumor Stem Cell Research Laboratory has created a human tissue bank to preserve tissue and cell cultures for use in ...
Locations Providing Brain Stem Implantation. Note that Brain Stem Implantation may not be performed at every location listed ... Areas of Expertise for Brain Stem Implantation. Hearing and Balance At UAMS Health, we have state-of-the-art equipment and ...
Duvernoys Atlas of the Human Brain Stem and Cerebellum. American Journal of Neuroradiology May 2009, 30 (5) e75; DOI: 10.3174/ ... Duvernoys Atlas of the Human Brain Stem and Cerebellum. American Journal of Neuroradiology May 2009, 30 (5) e75; DOI: 10.3174/ ... Duvernoys Atlas of the Human Brain Stem and Cerebellum Message Subject (Your Name) has sent you a message from American ... Duvernoys Atlas of the Human Brain Stem and Cerebellum. American Journal of Neuroradiology May 2009, 30 (5) e75; DOI: https:// ...
A deep dive into the science and impact of stem cells. ... Stem Cell Research. Stem Cells and Clinical Genomics for ... Brain Organoids and Robotics / AI - Sanford Stem Cell Symposium. 2/20/2022; 88 minutos ... Stem Cells and Clinical Genomics for Clinical Trials in Dish - Breaking News in Stem Cells. ...
... discusses an NIH-sponsored study investigating the effectiveness of an auditory brain stem implant in young children with ... PODCAST: Auditory brain stem implants in young children.. January 14, 2016. Podcast ... Jamie Glater, MD, discusses an NIH-sponsored study investigating the effectiveness of an auditory brain stem implant in young ... Pediatrics about a National Institutes of Health-sponsored study investigating the effectiveness of an auditory brain stem ...
Cerebral Organoids: Using stem cell derived 3D cultures to understand human brain development and neurological disorders. ... Periodic Reporting for period 4 - MiniBrain (Cerebral Organoids: Using stem cell derived 3D cultures to understand human brain ... We recapitulated brain cancer, the deadliest of all brain diseases (Bian et al., 2018). We further discovered that metabolic ... The human brain is the most complex but also the most fascinating organ of all. Its 87 billion neurons arise during development ...
... stalk-like portion of the brain. How well are you aware of its anatomy? Our Brainstem Anatomy Quiz questions and answers is ... What nerve wraps around the cranial nerve 6 before it exits the brain stem?. *. A. ... The brainstem is the lower, stalk-like portion of the brain. How well are you aware of its anatomy? Our Brainstem Anatomy Quiz ... The brainstem connects the brain to other organs in the human body; lets see how well you score on the quiz. Learn more & ...
Twelve were in males and 1 in a ... the pons or the brain stem and a diffuse enlargement of the pons results ... ... but is found much more frequently in the cerebrum than in the brain stem or the spinal cord. It is formed by ... ... pontine glioma is a fast-growing cancerous tumor that forms in a certain type of cells-glial cells-in a part of the brain stem ...
Astrocytic Tumors Brain Stem Gliomas Treatment of brain stem gliomas may include the following: Radiation therapy . Use ... ... General Information About Childhood Brain Stem Glioma Key Points for This Section Childhood brain stem ... ... Childhood Brain Stem Glioma Treatment (PDQ®) - PDQ Cancer Information Summaries - NCBI Bookshelf ... Childhood Brain Stem Glioma Treatment (PDQ®) - PDQ Cancer Information Summaries - NCBI Bookshelf ...

No FAQ available that match "brain stem"